This repository has been archived on 2026-04-03. You can view files and clone it, but cannot push or open issues or pull requests.
nyx/node_modules/vue-router/dist/vue-router.esm-browser.js
Nico e2667f8e12 Initial nyx project — fork of hermes-frontend
Forked from hermes-frontend, stripped openclaw/bun specifics:
- Auth tokens: openclaw_session -> nyx_session
- Vite proxy: localhost:3003 -> localhost:8000 (assay)
- Prod WS: wss://assay.loop42.de/ws
- Workspace paths: removed openclaw-specific paths
- Added missing deps: @heroicons/vue, overlayscrollbars-vue
- Branding: title -> nyx

Co-Authored-By: Claude Opus 4.6 (1M context) <noreply@anthropic.com>
2026-03-31 20:23:27 +02:00

2760 lines
100 KiB
JavaScript

/*!
* vue-router v5.0.3
* (c) 2026 Eduardo San Martin Morote
* @license MIT
*/
import { computed, defineComponent, getCurrentInstance, h, inject, nextTick, onActivated, onDeactivated, onUnmounted, provide, reactive, ref, shallowReactive, shallowRef, unref, watch, watchEffect } from "vue";
import { setupDevtoolsPlugin } from "@vue/devtools-api";
//#region src/utils/env.ts
const isBrowser = typeof document !== "undefined";
//#endregion
//#region src/utils/index.ts
/**
* Allows differentiating lazy components from functional components and vue-class-component
* @internal
*
* @param component
*/
function isRouteComponent(component) {
return typeof component === "object" || "displayName" in component || "props" in component || "__vccOpts" in component;
}
function isESModule(obj) {
return obj.__esModule || obj[Symbol.toStringTag] === "Module" || obj.default && isRouteComponent(obj.default);
}
const assign = Object.assign;
function applyToParams(fn, params) {
const newParams = {};
for (const key in params) {
const value = params[key];
newParams[key] = isArray(value) ? value.map(fn) : fn(value);
}
return newParams;
}
const noop = () => {};
/**
* Typesafe alternative to Array.isArray
* https://github.com/microsoft/TypeScript/pull/48228
*
* @internal
*/
const isArray = Array.isArray;
function mergeOptions(defaults, partialOptions) {
const options = {};
for (const key in defaults) options[key] = key in partialOptions ? partialOptions[key] : defaults[key];
return options;
}
//#endregion
//#region src/warning.ts
function warn(msg) {
const args = Array.from(arguments).slice(1);
console.warn.apply(console, ["[Vue Router warn]: " + msg].concat(args));
}
//#endregion
//#region src/encoding.ts
/**
* Encoding Rules (␣ = Space)
* - Path: ␣ " < > # ? { }
* - Query: ␣ " < > # & =
* - Hash: ␣ " < > `
*
* On top of that, the RFC3986 (https://tools.ietf.org/html/rfc3986#section-2.2)
* defines some extra characters to be encoded. Most browsers do not encode them
* in encodeURI https://github.com/whatwg/url/issues/369, so it may be safer to
* also encode `!'()*`. Leaving un-encoded only ASCII alphanumeric(`a-zA-Z0-9`)
* plus `-._~`. This extra safety should be applied to query by patching the
* string returned by encodeURIComponent encodeURI also encodes `[\]^`. `\`
* should be encoded to avoid ambiguity. Browsers (IE, FF, C) transform a `\`
* into a `/` if directly typed in. The _backtick_ (`````) should also be
* encoded everywhere because some browsers like FF encode it when directly
* written while others don't. Safari and IE don't encode ``"<>{}``` in hash.
*/
const HASH_RE = /#/g;
const AMPERSAND_RE = /&/g;
const SLASH_RE = /\//g;
const EQUAL_RE = /=/g;
const IM_RE = /\?/g;
const PLUS_RE = /\+/g;
/**
* NOTE: It's not clear to me if we should encode the + symbol in queries, it
* seems to be less flexible than not doing so and I can't find out the legacy
* systems requiring this for regular requests like text/html. In the standard,
* the encoding of the plus character is only mentioned for
* application/x-www-form-urlencoded
* (https://url.spec.whatwg.org/#urlencoded-parsing) and most browsers seems lo
* leave the plus character as is in queries. To be more flexible, we allow the
* plus character on the query, but it can also be manually encoded by the user.
*
* Resources:
* - https://url.spec.whatwg.org/#urlencoded-parsing
* - https://stackoverflow.com/questions/1634271/url-encoding-the-space-character-or-20
*/
const ENC_BRACKET_OPEN_RE = /%5B/g;
const ENC_BRACKET_CLOSE_RE = /%5D/g;
const ENC_CARET_RE = /%5E/g;
const ENC_BACKTICK_RE = /%60/g;
const ENC_CURLY_OPEN_RE = /%7B/g;
const ENC_PIPE_RE = /%7C/g;
const ENC_CURLY_CLOSE_RE = /%7D/g;
const ENC_SPACE_RE = /%20/g;
/**
* Encode characters that need to be encoded on the path, search and hash
* sections of the URL.
*
* @internal
* @param text - string to encode
* @returns encoded string
*/
function commonEncode(text) {
return text == null ? "" : encodeURI("" + text).replace(ENC_PIPE_RE, "|").replace(ENC_BRACKET_OPEN_RE, "[").replace(ENC_BRACKET_CLOSE_RE, "]");
}
/**
* Encode characters that need to be encoded on the hash section of the URL.
*
* @param text - string to encode
* @returns encoded string
*/
function encodeHash(text) {
return commonEncode(text).replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
}
/**
* Encode characters that need to be encoded query values on the query
* section of the URL.
*
* @param text - string to encode
* @returns encoded string
*/
function encodeQueryValue(text) {
return commonEncode(text).replace(PLUS_RE, "%2B").replace(ENC_SPACE_RE, "+").replace(HASH_RE, "%23").replace(AMPERSAND_RE, "%26").replace(ENC_BACKTICK_RE, "`").replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
}
/**
* Like `encodeQueryValue` but also encodes the `=` character.
*
* @param text - string to encode
*/
function encodeQueryKey(text) {
return encodeQueryValue(text).replace(EQUAL_RE, "%3D");
}
/**
* Encode characters that need to be encoded on the path section of the URL.
*
* @param text - string to encode
* @returns encoded string
*/
function encodePath(text) {
return commonEncode(text).replace(HASH_RE, "%23").replace(IM_RE, "%3F");
}
/**
* Encode characters that need to be encoded on the path section of the URL as a
* param. This function encodes everything {@link encodePath} does plus the
* slash (`/`) character. If `text` is `null` or `undefined`, returns an empty
* string instead.
*
* @param text - string to encode
* @returns encoded string
*/
function encodeParam(text) {
return encodePath(text).replace(SLASH_RE, "%2F");
}
function decode(text) {
if (text == null) return null;
try {
return decodeURIComponent("" + text);
} catch (err) {
warn(`Error decoding "${text}". Using original value`);
}
return "" + text;
}
//#endregion
//#region src/location.ts
const TRAILING_SLASH_RE = /\/$/;
const removeTrailingSlash = (path) => path.replace(TRAILING_SLASH_RE, "");
/**
* Transforms a URI into a normalized history location
*
* @param parseQuery
* @param location - URI to normalize
* @param currentLocation - current absolute location. Allows resolving relative
* paths. Must start with `/`. Defaults to `/`
* @returns a normalized history location
*/
function parseURL(parseQuery, location, currentLocation = "/") {
let path, query = {}, searchString = "", hash = "";
const hashPos = location.indexOf("#");
let searchPos = location.indexOf("?");
searchPos = hashPos >= 0 && searchPos > hashPos ? -1 : searchPos;
if (searchPos >= 0) {
path = location.slice(0, searchPos);
searchString = location.slice(searchPos, hashPos > 0 ? hashPos : location.length);
query = parseQuery(searchString.slice(1));
}
if (hashPos >= 0) {
path = path || location.slice(0, hashPos);
hash = location.slice(hashPos, location.length);
}
path = resolveRelativePath(path != null ? path : location, currentLocation);
return {
fullPath: path + searchString + hash,
path,
query,
hash: decode(hash)
};
}
/**
* Stringifies a URL object
*
* @param stringifyQuery
* @param location
*/
function stringifyURL(stringifyQuery, location) {
const query = location.query ? stringifyQuery(location.query) : "";
return location.path + (query && "?") + query + (location.hash || "");
}
/**
* Strips off the base from the beginning of a location.pathname in a non-case-sensitive way.
*
* @param pathname - location.pathname
* @param base - base to strip off
*/
function stripBase(pathname, base) {
if (!base || !pathname.toLowerCase().startsWith(base.toLowerCase())) return pathname;
return pathname.slice(base.length) || "/";
}
/**
* Checks if two RouteLocation are equal. This means that both locations are
* pointing towards the same {@link RouteRecord} and that all `params`, `query`
* parameters and `hash` are the same
*
* @param stringifyQuery - A function that takes a query object of type LocationQueryRaw and returns a string representation of it.
* @param a - first {@link RouteLocation}
* @param b - second {@link RouteLocation}
*/
function isSameRouteLocation(stringifyQuery, a, b) {
const aLastIndex = a.matched.length - 1;
const bLastIndex = b.matched.length - 1;
return aLastIndex > -1 && aLastIndex === bLastIndex && isSameRouteRecord(a.matched[aLastIndex], b.matched[bLastIndex]) && isSameRouteLocationParams(a.params, b.params) && stringifyQuery(a.query) === stringifyQuery(b.query) && a.hash === b.hash;
}
/**
* Check if two `RouteRecords` are equal. Takes into account aliases: they are
* considered equal to the `RouteRecord` they are aliasing.
*
* @param a - first {@link RouteRecord}
* @param b - second {@link RouteRecord}
*/
function isSameRouteRecord(a, b) {
return (a.aliasOf || a) === (b.aliasOf || b);
}
function isSameRouteLocationParams(a, b) {
if (Object.keys(a).length !== Object.keys(b).length) return false;
for (var key in a) if (!isSameRouteLocationParamsValue(a[key], b[key])) return false;
return true;
}
function isSameRouteLocationParamsValue(a, b) {
return isArray(a) ? isEquivalentArray(a, b) : isArray(b) ? isEquivalentArray(b, a) : (a && a.valueOf()) === (b && b.valueOf());
}
/**
* Check if two arrays are the same or if an array with one single entry is the
* same as another primitive value. Used to check query and parameters
*
* @param a - array of values
* @param b - array of values or a single value
*/
function isEquivalentArray(a, b) {
return isArray(b) ? a.length === b.length && a.every((value, i) => value === b[i]) : a.length === 1 && a[0] === b;
}
/**
* Resolves a relative path that starts with `.`.
*
* @param to - path location we are resolving
* @param from - currentLocation.path, should start with `/`
*/
function resolveRelativePath(to, from) {
if (to.startsWith("/")) return to;
if (!from.startsWith("/")) {
warn(`Cannot resolve a relative location without an absolute path. Trying to resolve "${to}" from "${from}". It should look like "/${from}".`);
return to;
}
if (!to) return from;
const fromSegments = from.split("/");
const toSegments = to.split("/");
const lastToSegment = toSegments[toSegments.length - 1];
if (lastToSegment === ".." || lastToSegment === ".") toSegments.push("");
let position = fromSegments.length - 1;
let toPosition;
let segment;
for (toPosition = 0; toPosition < toSegments.length; toPosition++) {
segment = toSegments[toPosition];
if (segment === ".") continue;
if (segment === "..") {
if (position > 1) position--;
} else break;
}
return fromSegments.slice(0, position).join("/") + "/" + toSegments.slice(toPosition).join("/");
}
/**
* Initial route location where the router is. Can be used in navigation guards
* to differentiate the initial navigation.
*
* @example
* ```js
* import { START_LOCATION } from 'vue-router'
*
* router.beforeEach((to, from) => {
* if (from === START_LOCATION) {
* // initial navigation
* }
* })
* ```
*/
const START_LOCATION_NORMALIZED = {
path: "/",
name: void 0,
params: {},
query: {},
hash: "",
fullPath: "/",
matched: [],
meta: {},
redirectedFrom: void 0
};
//#endregion
//#region src/history/common.ts
let NavigationType = /* @__PURE__ */ function(NavigationType) {
NavigationType["pop"] = "pop";
NavigationType["push"] = "push";
return NavigationType;
}({});
let NavigationDirection = /* @__PURE__ */ function(NavigationDirection) {
NavigationDirection["back"] = "back";
NavigationDirection["forward"] = "forward";
NavigationDirection["unknown"] = "";
return NavigationDirection;
}({});
/**
* Starting location for Histories
*/
const START = "";
/**
* Normalizes a base by removing any trailing slash and reading the base tag if
* present.
*
* @param base - base to normalize
*/
function normalizeBase(base) {
if (!base) if (isBrowser) {
const baseEl = document.querySelector("base");
base = baseEl && baseEl.getAttribute("href") || "/";
base = base.replace(/^\w+:\/\/[^\/]+/, "");
} else base = "/";
if (base[0] !== "/" && base[0] !== "#") base = "/" + base;
return removeTrailingSlash(base);
}
const BEFORE_HASH_RE = /^[^#]+#/;
function createHref(base, location) {
return base.replace(BEFORE_HASH_RE, "#") + location;
}
//#endregion
//#region src/scrollBehavior.ts
function getElementPosition(el, offset) {
const docRect = document.documentElement.getBoundingClientRect();
const elRect = el.getBoundingClientRect();
return {
behavior: offset.behavior,
left: elRect.left - docRect.left - (offset.left || 0),
top: elRect.top - docRect.top - (offset.top || 0)
};
}
const computeScrollPosition = () => ({
left: window.scrollX,
top: window.scrollY
});
function scrollToPosition(position) {
let scrollToOptions;
if ("el" in position) {
const positionEl = position.el;
const isIdSelector = typeof positionEl === "string" && positionEl.startsWith("#");
/**
* `id`s can accept pretty much any characters, including CSS combinators
* like `>` or `~`. It's still possible to retrieve elements using
* `document.getElementById('~')` but it needs to be escaped when using
* `document.querySelector('#\\~')` for it to be valid. The only
* requirements for `id`s are them to be unique on the page and to not be
* empty (`id=""`). Because of that, when passing an id selector, it should
* be properly escaped for it to work with `querySelector`. We could check
* for the id selector to be simple (no CSS combinators `+ >~`) but that
* would make things inconsistent since they are valid characters for an
* `id` but would need to be escaped when using `querySelector`, breaking
* their usage and ending up in no selector returned. Selectors need to be
* escaped:
*
* - `#1-thing` becomes `#\31 -thing`
* - `#with~symbols` becomes `#with\\~symbols`
*
* - More information about the topic can be found at
* https://mathiasbynens.be/notes/html5-id-class.
* - Practical example: https://mathiasbynens.be/demo/html5-id
*/
if (typeof position.el === "string") {
if (!isIdSelector || !document.getElementById(position.el.slice(1))) try {
const foundEl = document.querySelector(position.el);
if (isIdSelector && foundEl) {
warn(`The selector "${position.el}" should be passed as "el: document.querySelector('${position.el}')" because it starts with "#".`);
return;
}
} catch (err) {
warn(`The selector "${position.el}" is invalid. If you are using an id selector, make sure to escape it. You can find more information about escaping characters in selectors at https://mathiasbynens.be/notes/css-escapes or use CSS.escape (https://developer.mozilla.org/en-US/docs/Web/API/CSS/escape).`);
return;
}
}
const el = typeof positionEl === "string" ? isIdSelector ? document.getElementById(positionEl.slice(1)) : document.querySelector(positionEl) : positionEl;
if (!el) {
warn(`Couldn't find element using selector "${position.el}" returned by scrollBehavior.`);
return;
}
scrollToOptions = getElementPosition(el, position);
} else scrollToOptions = position;
if ("scrollBehavior" in document.documentElement.style) window.scrollTo(scrollToOptions);
else window.scrollTo(scrollToOptions.left != null ? scrollToOptions.left : window.scrollX, scrollToOptions.top != null ? scrollToOptions.top : window.scrollY);
}
function getScrollKey(path, delta) {
return (history.state ? history.state.position - delta : -1) + path;
}
const scrollPositions = /* @__PURE__ */ new Map();
function saveScrollPosition(key, scrollPosition) {
scrollPositions.set(key, scrollPosition);
}
function getSavedScrollPosition(key) {
const scroll = scrollPositions.get(key);
scrollPositions.delete(key);
return scroll;
}
/**
* ScrollBehavior instance used by the router to compute and restore the scroll
* position when navigating.
*/
//#endregion
//#region src/history/html5.ts
let createBaseLocation = () => location.protocol + "//" + location.host;
/**
* Creates a normalized history location from a window.location object
* @param base - The base path
* @param location - The window.location object
*/
function createCurrentLocation(base, location) {
const { pathname, search, hash } = location;
const hashPos = base.indexOf("#");
if (hashPos > -1) {
let slicePos = hash.includes(base.slice(hashPos)) ? base.slice(hashPos).length : 1;
let pathFromHash = hash.slice(slicePos);
if (pathFromHash[0] !== "/") pathFromHash = "/" + pathFromHash;
return stripBase(pathFromHash, "");
}
return stripBase(pathname, base) + search + hash;
}
function useHistoryListeners(base, historyState, currentLocation, replace) {
let listeners = [];
let teardowns = [];
let pauseState = null;
const popStateHandler = ({ state }) => {
const to = createCurrentLocation(base, location);
const from = currentLocation.value;
const fromState = historyState.value;
let delta = 0;
if (state) {
currentLocation.value = to;
historyState.value = state;
if (pauseState && pauseState === from) {
pauseState = null;
return;
}
delta = fromState ? state.position - fromState.position : 0;
} else replace(to);
listeners.forEach((listener) => {
listener(currentLocation.value, from, {
delta,
type: NavigationType.pop,
direction: delta ? delta > 0 ? NavigationDirection.forward : NavigationDirection.back : NavigationDirection.unknown
});
});
};
function pauseListeners() {
pauseState = currentLocation.value;
}
function listen(callback) {
listeners.push(callback);
const teardown = () => {
const index = listeners.indexOf(callback);
if (index > -1) listeners.splice(index, 1);
};
teardowns.push(teardown);
return teardown;
}
function beforeUnloadListener() {
if (document.visibilityState === "hidden") {
const { history } = window;
if (!history.state) return;
history.replaceState(assign({}, history.state, { scroll: computeScrollPosition() }), "");
}
}
function destroy() {
for (const teardown of teardowns) teardown();
teardowns = [];
window.removeEventListener("popstate", popStateHandler);
window.removeEventListener("pagehide", beforeUnloadListener);
document.removeEventListener("visibilitychange", beforeUnloadListener);
}
window.addEventListener("popstate", popStateHandler);
window.addEventListener("pagehide", beforeUnloadListener);
document.addEventListener("visibilitychange", beforeUnloadListener);
return {
pauseListeners,
listen,
destroy
};
}
/**
* Creates a state object
*/
function buildState(back, current, forward, replaced = false, computeScroll = false) {
return {
back,
current,
forward,
replaced,
position: window.history.length,
scroll: computeScroll ? computeScrollPosition() : null
};
}
function useHistoryStateNavigation(base) {
const { history, location } = window;
const currentLocation = { value: createCurrentLocation(base, location) };
const historyState = { value: history.state };
if (!historyState.value) changeLocation(currentLocation.value, {
back: null,
current: currentLocation.value,
forward: null,
position: history.length - 1,
replaced: true,
scroll: null
}, true);
function changeLocation(to, state, replace) {
/**
* if a base tag is provided, and we are on a normal domain, we have to
* respect the provided `base` attribute because pushState() will use it and
* potentially erase anything before the `#` like at
* https://github.com/vuejs/router/issues/685 where a base of
* `/folder/#` but a base of `/` would erase the `/folder/` section. If
* there is no host, the `<base>` tag makes no sense and if there isn't a
* base tag we can just use everything after the `#`.
*/
const hashIndex = base.indexOf("#");
const url = hashIndex > -1 ? (location.host && document.querySelector("base") ? base : base.slice(hashIndex)) + to : createBaseLocation() + base + to;
try {
history[replace ? "replaceState" : "pushState"](state, "", url);
historyState.value = state;
} catch (err) {
warn("Error with push/replace State", err);
location[replace ? "replace" : "assign"](url);
}
}
function replace(to, data) {
changeLocation(to, assign({}, history.state, buildState(historyState.value.back, to, historyState.value.forward, true), data, { position: historyState.value.position }), true);
currentLocation.value = to;
}
function push(to, data) {
const currentState = assign({}, historyState.value, history.state, {
forward: to,
scroll: computeScrollPosition()
});
if (!history.state) warn("history.state seems to have been manually replaced without preserving the necessary values. Make sure to preserve existing history state if you are manually calling history.replaceState:\n\nhistory.replaceState(history.state, '', url)\n\nYou can find more information at https://router.vuejs.org/guide/migration/#Usage-of-history-state");
changeLocation(currentState.current, currentState, true);
changeLocation(to, assign({}, buildState(currentLocation.value, to, null), { position: currentState.position + 1 }, data), false);
currentLocation.value = to;
}
return {
location: currentLocation,
state: historyState,
push,
replace
};
}
/**
* Creates an HTML5 history. Most common history for single page applications.
*
* @param base -
*/
function createWebHistory(base) {
base = normalizeBase(base);
const historyNavigation = useHistoryStateNavigation(base);
const historyListeners = useHistoryListeners(base, historyNavigation.state, historyNavigation.location, historyNavigation.replace);
function go(delta, triggerListeners = true) {
if (!triggerListeners) historyListeners.pauseListeners();
history.go(delta);
}
const routerHistory = assign({
location: "",
base,
go,
createHref: createHref.bind(null, base)
}, historyNavigation, historyListeners);
Object.defineProperty(routerHistory, "location", {
enumerable: true,
get: () => historyNavigation.location.value
});
Object.defineProperty(routerHistory, "state", {
enumerable: true,
get: () => historyNavigation.state.value
});
return routerHistory;
}
//#endregion
//#region src/history/memory.ts
/**
* Creates an in-memory based history. The main purpose of this history is to handle SSR. It starts in a special location that is nowhere.
* It's up to the user to replace that location with the starter location by either calling `router.push` or `router.replace`.
*
* @param base - Base applied to all urls, defaults to '/'
* @returns a history object that can be passed to the router constructor
*/
function createMemoryHistory(base = "") {
let listeners = [];
let queue = [[START, {}]];
let position = 0;
base = normalizeBase(base);
function setLocation(location, state = {}) {
position++;
if (position !== queue.length) queue.splice(position);
queue.push([location, state]);
}
function triggerListeners(to, from, { direction, delta }) {
const info = {
direction,
delta,
type: NavigationType.pop
};
for (const callback of listeners) callback(to, from, info);
}
const routerHistory = {
location: START,
state: {},
base,
createHref: createHref.bind(null, base),
replace(to, state) {
queue.splice(position--, 1);
setLocation(to, state);
},
push(to, state) {
setLocation(to, state);
},
listen(callback) {
listeners.push(callback);
return () => {
const index = listeners.indexOf(callback);
if (index > -1) listeners.splice(index, 1);
};
},
destroy() {
listeners = [];
queue = [[START, {}]];
position = 0;
},
go(delta, shouldTrigger = true) {
const from = this.location;
const direction = delta < 0 ? NavigationDirection.back : NavigationDirection.forward;
position = Math.max(0, Math.min(position + delta, queue.length - 1));
if (shouldTrigger) triggerListeners(this.location, from, {
direction,
delta
});
}
};
Object.defineProperty(routerHistory, "location", {
enumerable: true,
get: () => queue[position][0]
});
Object.defineProperty(routerHistory, "state", {
enumerable: true,
get: () => queue[position][1]
});
return routerHistory;
}
//#endregion
//#region src/history/hash.ts
/**
* Creates a hash history. Useful for web applications with no host (e.g. `file://`) or when configuring a server to
* handle any URL is not possible.
*
* @param base - optional base to provide. Defaults to `location.pathname + location.search` If there is a `<base>` tag
* in the `head`, its value will be ignored in favor of this parameter **but note it affects all the history.pushState()
* calls**, meaning that if you use a `<base>` tag, it's `href` value **has to match this parameter** (ignoring anything
* after the `#`).
*
* @example
* ```js
* // at https://example.com/folder
* createWebHashHistory() // gives a url of `https://example.com/folder#`
* createWebHashHistory('/folder/') // gives a url of `https://example.com/folder/#`
* // if the `#` is provided in the base, it won't be added by `createWebHashHistory`
* createWebHashHistory('/folder/#/app/') // gives a url of `https://example.com/folder/#/app/`
* // you should avoid doing this because it changes the original url and breaks copying urls
* createWebHashHistory('/other-folder/') // gives a url of `https://example.com/other-folder/#`
*
* // at file:///usr/etc/folder/index.html
* // for locations with no `host`, the base is ignored
* createWebHashHistory('/iAmIgnored') // gives a url of `file:///usr/etc/folder/index.html#`
* ```
*/
function createWebHashHistory(base) {
base = location.host ? base || location.pathname + location.search : "";
if (!base.includes("#")) base += "#";
if (!base.endsWith("#/") && !base.endsWith("#")) warn(`A hash base must end with a "#":\n"${base}" should be "${base.replace(/#.*$/, "#")}".`);
return createWebHistory(base);
}
//#endregion
//#region src/types/typeGuards.ts
function isRouteLocation(route) {
return typeof route === "string" || route && typeof route === "object";
}
function isRouteName(name) {
return typeof name === "string" || typeof name === "symbol";
}
//#endregion
//#region src/errors.ts
/**
* Flags so we can combine them when checking for multiple errors. This is the internal version of
* {@link NavigationFailureType}.
*
* @internal
*/
let ErrorTypes = /* @__PURE__ */ function(ErrorTypes) {
ErrorTypes[ErrorTypes["MATCHER_NOT_FOUND"] = 1] = "MATCHER_NOT_FOUND";
ErrorTypes[ErrorTypes["NAVIGATION_GUARD_REDIRECT"] = 2] = "NAVIGATION_GUARD_REDIRECT";
ErrorTypes[ErrorTypes["NAVIGATION_ABORTED"] = 4] = "NAVIGATION_ABORTED";
ErrorTypes[ErrorTypes["NAVIGATION_CANCELLED"] = 8] = "NAVIGATION_CANCELLED";
ErrorTypes[ErrorTypes["NAVIGATION_DUPLICATED"] = 16] = "NAVIGATION_DUPLICATED";
return ErrorTypes;
}({});
const NavigationFailureSymbol = Symbol("navigation failure");
/**
* Enumeration with all possible types for navigation failures. Can be passed to
* {@link isNavigationFailure} to check for specific failures.
*/
let NavigationFailureType = /* @__PURE__ */ function(NavigationFailureType) {
/**
* An aborted navigation is a navigation that failed because a navigation
* guard returned `false` or called `next(false)`
*/
NavigationFailureType[NavigationFailureType["aborted"] = 4] = "aborted";
/**
* A cancelled navigation is a navigation that failed because a more recent
* navigation finished started (not necessarily finished).
*/
NavigationFailureType[NavigationFailureType["cancelled"] = 8] = "cancelled";
/**
* A duplicated navigation is a navigation that failed because it was
* initiated while already being at the exact same location.
*/
NavigationFailureType[NavigationFailureType["duplicated"] = 16] = "duplicated";
return NavigationFailureType;
}({});
const ErrorTypeMessages = {
[ErrorTypes.MATCHER_NOT_FOUND]({ location, currentLocation }) {
return `No match for\n ${JSON.stringify(location)}${currentLocation ? "\nwhile being at\n" + JSON.stringify(currentLocation) : ""}`;
},
[ErrorTypes.NAVIGATION_GUARD_REDIRECT]({ from, to }) {
return `Redirected from "${from.fullPath}" to "${stringifyRoute(to)}" via a navigation guard.`;
},
[ErrorTypes.NAVIGATION_ABORTED]({ from, to }) {
return `Navigation aborted from "${from.fullPath}" to "${to.fullPath}" via a navigation guard.`;
},
[ErrorTypes.NAVIGATION_CANCELLED]({ from, to }) {
return `Navigation cancelled from "${from.fullPath}" to "${to.fullPath}" with a new navigation.`;
},
[ErrorTypes.NAVIGATION_DUPLICATED]({ from, to }) {
return `Avoided redundant navigation to current location: "${from.fullPath}".`;
}
};
/**
* Creates a typed NavigationFailure object.
* @internal
* @param type - NavigationFailureType
* @param params - { from, to }
*/
function createRouterError(type, params) {
return assign(new Error(ErrorTypeMessages[type](params)), {
type,
[NavigationFailureSymbol]: true
}, params);
}
function isNavigationFailure(error, type) {
return error instanceof Error && NavigationFailureSymbol in error && (type == null || !!(error.type & type));
}
const propertiesToLog = [
"params",
"query",
"hash"
];
function stringifyRoute(to) {
if (typeof to === "string") return to;
if (to.path != null) return to.path;
const location = {};
for (const key of propertiesToLog) if (key in to) location[key] = to[key];
return JSON.stringify(location, null, 2);
}
//#endregion
//#region src/matcher/pathTokenizer.ts
let TokenType = /* @__PURE__ */ function(TokenType) {
TokenType[TokenType["Static"] = 0] = "Static";
TokenType[TokenType["Param"] = 1] = "Param";
TokenType[TokenType["Group"] = 2] = "Group";
return TokenType;
}({});
var TokenizerState = /* @__PURE__ */ function(TokenizerState) {
TokenizerState[TokenizerState["Static"] = 0] = "Static";
TokenizerState[TokenizerState["Param"] = 1] = "Param";
TokenizerState[TokenizerState["ParamRegExp"] = 2] = "ParamRegExp";
TokenizerState[TokenizerState["ParamRegExpEnd"] = 3] = "ParamRegExpEnd";
TokenizerState[TokenizerState["EscapeNext"] = 4] = "EscapeNext";
return TokenizerState;
}(TokenizerState || {});
const ROOT_TOKEN = {
type: TokenType.Static,
value: ""
};
const VALID_PARAM_RE = /[a-zA-Z0-9_]/;
function tokenizePath(path) {
if (!path) return [[]];
if (path === "/") return [[ROOT_TOKEN]];
if (!path.startsWith("/")) throw new Error(`Route paths should start with a "/": "${path}" should be "/${path}".`);
function crash(message) {
throw new Error(`ERR (${state})/"${buffer}": ${message}`);
}
let state = TokenizerState.Static;
let previousState = state;
const tokens = [];
let segment;
function finalizeSegment() {
if (segment) tokens.push(segment);
segment = [];
}
let i = 0;
let char;
let buffer = "";
let customRe = "";
function consumeBuffer() {
if (!buffer) return;
if (state === TokenizerState.Static) segment.push({
type: TokenType.Static,
value: buffer
});
else if (state === TokenizerState.Param || state === TokenizerState.ParamRegExp || state === TokenizerState.ParamRegExpEnd) {
if (segment.length > 1 && (char === "*" || char === "+")) crash(`A repeatable param (${buffer}) must be alone in its segment. eg: '/:ids+.`);
segment.push({
type: TokenType.Param,
value: buffer,
regexp: customRe,
repeatable: char === "*" || char === "+",
optional: char === "*" || char === "?"
});
} else crash("Invalid state to consume buffer");
buffer = "";
}
function addCharToBuffer() {
buffer += char;
}
while (i < path.length) {
char = path[i++];
if (char === "\\" && state !== TokenizerState.ParamRegExp) {
previousState = state;
state = TokenizerState.EscapeNext;
continue;
}
switch (state) {
case TokenizerState.Static:
if (char === "/") {
if (buffer) consumeBuffer();
finalizeSegment();
} else if (char === ":") {
consumeBuffer();
state = TokenizerState.Param;
} else addCharToBuffer();
break;
case TokenizerState.EscapeNext:
addCharToBuffer();
state = previousState;
break;
case TokenizerState.Param:
if (char === "(") state = TokenizerState.ParamRegExp;
else if (VALID_PARAM_RE.test(char)) addCharToBuffer();
else {
consumeBuffer();
state = TokenizerState.Static;
if (char !== "*" && char !== "?" && char !== "+") i--;
}
break;
case TokenizerState.ParamRegExp:
if (char === ")") if (customRe[customRe.length - 1] == "\\") customRe = customRe.slice(0, -1) + char;
else state = TokenizerState.ParamRegExpEnd;
else customRe += char;
break;
case TokenizerState.ParamRegExpEnd:
consumeBuffer();
state = TokenizerState.Static;
if (char !== "*" && char !== "?" && char !== "+") i--;
customRe = "";
break;
default:
crash("Unknown state");
break;
}
}
if (state === TokenizerState.ParamRegExp) crash(`Unfinished custom RegExp for param "${buffer}"`);
consumeBuffer();
finalizeSegment();
return tokens;
}
//#endregion
//#region src/matcher/pathParserRanker.ts
const BASE_PARAM_PATTERN = "[^/]+?";
const BASE_PATH_PARSER_OPTIONS = {
sensitive: false,
strict: false,
start: true,
end: true
};
var PathScore = /* @__PURE__ */ function(PathScore) {
PathScore[PathScore["_multiplier"] = 10] = "_multiplier";
PathScore[PathScore["Root"] = 90] = "Root";
PathScore[PathScore["Segment"] = 40] = "Segment";
PathScore[PathScore["SubSegment"] = 30] = "SubSegment";
PathScore[PathScore["Static"] = 40] = "Static";
PathScore[PathScore["Dynamic"] = 20] = "Dynamic";
PathScore[PathScore["BonusCustomRegExp"] = 10] = "BonusCustomRegExp";
PathScore[PathScore["BonusWildcard"] = -50] = "BonusWildcard";
PathScore[PathScore["BonusRepeatable"] = -20] = "BonusRepeatable";
PathScore[PathScore["BonusOptional"] = -8] = "BonusOptional";
PathScore[PathScore["BonusStrict"] = .7000000000000001] = "BonusStrict";
PathScore[PathScore["BonusCaseSensitive"] = .25] = "BonusCaseSensitive";
return PathScore;
}(PathScore || {});
const REGEX_CHARS_RE = /[.+*?^${}()[\]/\\]/g;
/**
* Creates a path parser from an array of Segments (a segment is an array of Tokens)
*
* @param segments - array of segments returned by tokenizePath
* @param extraOptions - optional options for the regexp
* @returns a PathParser
*/
function tokensToParser(segments, extraOptions) {
const options = assign({}, BASE_PATH_PARSER_OPTIONS, extraOptions);
const score = [];
let pattern = options.start ? "^" : "";
const keys = [];
for (const segment of segments) {
const segmentScores = segment.length ? [] : [PathScore.Root];
if (options.strict && !segment.length) pattern += "/";
for (let tokenIndex = 0; tokenIndex < segment.length; tokenIndex++) {
const token = segment[tokenIndex];
let subSegmentScore = PathScore.Segment + (options.sensitive ? PathScore.BonusCaseSensitive : 0);
if (token.type === TokenType.Static) {
if (!tokenIndex) pattern += "/";
pattern += token.value.replace(REGEX_CHARS_RE, "\\$&");
subSegmentScore += PathScore.Static;
} else if (token.type === TokenType.Param) {
const { value, repeatable, optional, regexp } = token;
keys.push({
name: value,
repeatable,
optional
});
const re = regexp ? regexp : BASE_PARAM_PATTERN;
if (re !== BASE_PARAM_PATTERN) {
subSegmentScore += PathScore.BonusCustomRegExp;
try {
new RegExp(`(${re})`);
} catch (err) {
throw new Error(`Invalid custom RegExp for param "${value}" (${re}): ` + err.message);
}
}
let subPattern = repeatable ? `((?:${re})(?:/(?:${re}))*)` : `(${re})`;
if (!tokenIndex) subPattern = optional && segment.length < 2 ? `(?:/${subPattern})` : "/" + subPattern;
if (optional) subPattern += "?";
pattern += subPattern;
subSegmentScore += PathScore.Dynamic;
if (optional) subSegmentScore += PathScore.BonusOptional;
if (repeatable) subSegmentScore += PathScore.BonusRepeatable;
if (re === ".*") subSegmentScore += PathScore.BonusWildcard;
}
segmentScores.push(subSegmentScore);
}
score.push(segmentScores);
}
if (options.strict && options.end) {
const i = score.length - 1;
score[i][score[i].length - 1] += PathScore.BonusStrict;
}
if (!options.strict) pattern += "/?";
if (options.end) pattern += "$";
else if (options.strict && !pattern.endsWith("/")) pattern += "(?:/|$)";
const re = new RegExp(pattern, options.sensitive ? "" : "i");
function parse(path) {
const match = path.match(re);
const params = {};
if (!match) return null;
for (let i = 1; i < match.length; i++) {
const value = match[i] || "";
const key = keys[i - 1];
params[key.name] = value && key.repeatable ? value.split("/") : value;
}
return params;
}
function stringify(params) {
let path = "";
let avoidDuplicatedSlash = false;
for (const segment of segments) {
if (!avoidDuplicatedSlash || !path.endsWith("/")) path += "/";
avoidDuplicatedSlash = false;
for (const token of segment) if (token.type === TokenType.Static) path += token.value;
else if (token.type === TokenType.Param) {
const { value, repeatable, optional } = token;
const param = value in params ? params[value] : "";
if (isArray(param) && !repeatable) throw new Error(`Provided param "${value}" is an array but it is not repeatable (* or + modifiers)`);
const text = isArray(param) ? param.join("/") : param;
if (!text) if (optional) {
if (segment.length < 2) if (path.endsWith("/")) path = path.slice(0, -1);
else avoidDuplicatedSlash = true;
} else throw new Error(`Missing required param "${value}"`);
path += text;
}
}
return path || "/";
}
return {
re,
score,
keys,
parse,
stringify
};
}
/**
* Compares an array of numbers as used in PathParser.score and returns a
* number. This function can be used to `sort` an array
*
* @param a - first array of numbers
* @param b - second array of numbers
* @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
* should be sorted first
*/
function compareScoreArray(a, b) {
let i = 0;
while (i < a.length && i < b.length) {
const diff = b[i] - a[i];
if (diff) return diff;
i++;
}
if (a.length < b.length) return a.length === 1 && a[0] === PathScore.Static + PathScore.Segment ? -1 : 1;
else if (a.length > b.length) return b.length === 1 && b[0] === PathScore.Static + PathScore.Segment ? 1 : -1;
return 0;
}
/**
* Compare function that can be used with `sort` to sort an array of PathParser
*
* @param a - first PathParser
* @param b - second PathParser
* @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
*/
function comparePathParserScore(a, b) {
let i = 0;
const aScore = a.score;
const bScore = b.score;
while (i < aScore.length && i < bScore.length) {
const comp = compareScoreArray(aScore[i], bScore[i]);
if (comp) return comp;
i++;
}
if (Math.abs(bScore.length - aScore.length) === 1) {
if (isLastScoreNegative(aScore)) return 1;
if (isLastScoreNegative(bScore)) return -1;
}
return bScore.length - aScore.length;
}
/**
* This allows detecting splats at the end of a path: /home/:id(.*)*
*
* @param score - score to check
* @returns true if the last entry is negative
*/
function isLastScoreNegative(score) {
const last = score[score.length - 1];
return score.length > 0 && last[last.length - 1] < 0;
}
const PATH_PARSER_OPTIONS_DEFAULTS = {
strict: false,
end: true,
sensitive: false
};
//#endregion
//#region src/matcher/pathMatcher.ts
function createRouteRecordMatcher(record, parent, options) {
const parser = tokensToParser(tokenizePath(record.path), options);
{
const existingKeys = /* @__PURE__ */ new Set();
for (const key of parser.keys) {
if (existingKeys.has(key.name)) warn(`Found duplicated params with name "${key.name}" for path "${record.path}". Only the last one will be available on "$route.params".`);
existingKeys.add(key.name);
}
}
const matcher = assign(parser, {
record,
parent,
children: [],
alias: []
});
if (parent) {
if (!matcher.record.aliasOf === !parent.record.aliasOf) parent.children.push(matcher);
}
return matcher;
}
//#endregion
//#region src/matcher/index.ts
/**
* Creates a Router Matcher.
*
* @internal
* @param routes - array of initial routes
* @param globalOptions - global route options
*/
function createRouterMatcher(routes, globalOptions) {
const matchers = [];
const matcherMap = /* @__PURE__ */ new Map();
globalOptions = mergeOptions(PATH_PARSER_OPTIONS_DEFAULTS, globalOptions);
function getRecordMatcher(name) {
return matcherMap.get(name);
}
function addRoute(record, parent, originalRecord) {
const isRootAdd = !originalRecord;
const mainNormalizedRecord = normalizeRouteRecord(record);
checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent);
mainNormalizedRecord.aliasOf = originalRecord && originalRecord.record;
const options = mergeOptions(globalOptions, record);
const normalizedRecords = [mainNormalizedRecord];
if ("alias" in record) {
const aliases = typeof record.alias === "string" ? [record.alias] : record.alias;
for (const alias of aliases) normalizedRecords.push(normalizeRouteRecord(assign({}, mainNormalizedRecord, {
components: originalRecord ? originalRecord.record.components : mainNormalizedRecord.components,
path: alias,
aliasOf: originalRecord ? originalRecord.record : mainNormalizedRecord
})));
}
let matcher;
let originalMatcher;
for (const normalizedRecord of normalizedRecords) {
const { path } = normalizedRecord;
if (parent && path[0] !== "/") {
const parentPath = parent.record.path;
const connectingSlash = parentPath[parentPath.length - 1] === "/" ? "" : "/";
normalizedRecord.path = parent.record.path + (path && connectingSlash + path);
}
if (normalizedRecord.path === "*") throw new Error("Catch all routes (\"*\") must now be defined using a param with a custom regexp.\nSee more at https://router.vuejs.org/guide/migration/#Removed-star-or-catch-all-routes.");
matcher = createRouteRecordMatcher(normalizedRecord, parent, options);
if (parent && path[0] === "/") checkMissingParamsInAbsolutePath(matcher, parent);
if (originalRecord) {
originalRecord.alias.push(matcher);
checkSameParams(originalRecord, matcher);
} else {
originalMatcher = originalMatcher || matcher;
if (originalMatcher !== matcher) originalMatcher.alias.push(matcher);
if (isRootAdd && record.name && !isAliasRecord(matcher)) {
checkSameNameAsAncestor(record, parent);
removeRoute(record.name);
}
}
if (isMatchable(matcher)) insertMatcher(matcher);
if (mainNormalizedRecord.children) {
const children = mainNormalizedRecord.children;
for (let i = 0; i < children.length; i++) addRoute(children[i], matcher, originalRecord && originalRecord.children[i]);
}
originalRecord = originalRecord || matcher;
}
return originalMatcher ? () => {
removeRoute(originalMatcher);
} : noop;
}
function removeRoute(matcherRef) {
if (isRouteName(matcherRef)) {
const matcher = matcherMap.get(matcherRef);
if (matcher) {
matcherMap.delete(matcherRef);
matchers.splice(matchers.indexOf(matcher), 1);
matcher.children.forEach(removeRoute);
matcher.alias.forEach(removeRoute);
}
} else {
const index = matchers.indexOf(matcherRef);
if (index > -1) {
matchers.splice(index, 1);
if (matcherRef.record.name) matcherMap.delete(matcherRef.record.name);
matcherRef.children.forEach(removeRoute);
matcherRef.alias.forEach(removeRoute);
}
}
}
function getRoutes() {
return matchers;
}
function insertMatcher(matcher) {
const index = findInsertionIndex(matcher, matchers);
matchers.splice(index, 0, matcher);
if (matcher.record.name && !isAliasRecord(matcher)) matcherMap.set(matcher.record.name, matcher);
}
function resolve(location, currentLocation) {
let matcher;
let params = {};
let path;
let name;
if ("name" in location && location.name) {
matcher = matcherMap.get(location.name);
if (!matcher) throw createRouterError(ErrorTypes.MATCHER_NOT_FOUND, { location });
{
const invalidParams = Object.keys(location.params || {}).filter((paramName) => !matcher.keys.find((k) => k.name === paramName));
if (invalidParams.length) warn(`Discarded invalid param(s) "${invalidParams.join("\", \"")}" when navigating. See https://github.com/vuejs/router/blob/main/packages/router/CHANGELOG.md#414-2022-08-22 for more details.`);
}
name = matcher.record.name;
params = assign(pickParams(currentLocation.params, matcher.keys.filter((k) => !k.optional).concat(matcher.parent ? matcher.parent.keys.filter((k) => k.optional) : []).map((k) => k.name)), location.params && pickParams(location.params, matcher.keys.map((k) => k.name)));
path = matcher.stringify(params);
} else if (location.path != null) {
path = location.path;
if (!path.startsWith("/")) warn(`The Matcher cannot resolve relative paths but received "${path}". Unless you directly called \`matcher.resolve("${path}")\`, this is probably a bug in vue-router. Please open an issue at https://github.com/vuejs/router/issues/new/choose.`);
matcher = matchers.find((m) => m.re.test(path));
if (matcher) {
params = matcher.parse(path);
name = matcher.record.name;
}
} else {
matcher = currentLocation.name ? matcherMap.get(currentLocation.name) : matchers.find((m) => m.re.test(currentLocation.path));
if (!matcher) throw createRouterError(ErrorTypes.MATCHER_NOT_FOUND, {
location,
currentLocation
});
name = matcher.record.name;
params = assign({}, currentLocation.params, location.params);
path = matcher.stringify(params);
}
const matched = [];
let parentMatcher = matcher;
while (parentMatcher) {
matched.unshift(parentMatcher.record);
parentMatcher = parentMatcher.parent;
}
return {
name,
path,
params,
matched,
meta: mergeMetaFields(matched)
};
}
routes.forEach((route) => addRoute(route));
function clearRoutes() {
matchers.length = 0;
matcherMap.clear();
}
return {
addRoute,
resolve,
removeRoute,
clearRoutes,
getRoutes,
getRecordMatcher
};
}
/**
* Picks an object param to contain only specified keys.
*
* @param params - params object to pick from
* @param keys - keys to pick
*/
function pickParams(params, keys) {
const newParams = {};
for (const key of keys) if (key in params) newParams[key] = params[key];
return newParams;
}
/**
* Normalizes a RouteRecordRaw. Creates a copy
*
* @param record
* @returns the normalized version
*/
function normalizeRouteRecord(record) {
const normalized = {
path: record.path,
redirect: record.redirect,
name: record.name,
meta: record.meta || {},
aliasOf: record.aliasOf,
beforeEnter: record.beforeEnter,
props: normalizeRecordProps(record),
children: record.children || [],
instances: {},
leaveGuards: /* @__PURE__ */ new Set(),
updateGuards: /* @__PURE__ */ new Set(),
enterCallbacks: {},
components: "components" in record ? record.components || null : record.component && { default: record.component }
};
Object.defineProperty(normalized, "mods", { value: {} });
return normalized;
}
/**
* Normalize the optional `props` in a record to always be an object similar to
* components. Also accept a boolean for components.
* @param record
*/
function normalizeRecordProps(record) {
const propsObject = {};
const props = record.props || false;
if ("component" in record) propsObject.default = props;
else for (const name in record.components) propsObject[name] = typeof props === "object" ? props[name] : props;
return propsObject;
}
/**
* Checks if a record or any of its parent is an alias
* @param record
*/
function isAliasRecord(record) {
while (record) {
if (record.record.aliasOf) return true;
record = record.parent;
}
return false;
}
/**
* Merge meta fields of an array of records
*
* @param matched - array of matched records
*/
function mergeMetaFields(matched) {
return matched.reduce((meta, record) => assign(meta, record.meta), {});
}
function isSameParam(a, b) {
return a.name === b.name && a.optional === b.optional && a.repeatable === b.repeatable;
}
/**
* Check if a path and its alias have the same required params
*
* @param a - original record
* @param b - alias record
*/
function checkSameParams(a, b) {
for (const key of a.keys) if (!key.optional && !b.keys.find(isSameParam.bind(null, key))) return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" must have the exact same param named "${key.name}"`);
for (const key of b.keys) if (!key.optional && !a.keys.find(isSameParam.bind(null, key))) return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" must have the exact same param named "${key.name}"`);
}
/**
* A route with a name and a child with an empty path without a name should warn when adding the route
*
* @param mainNormalizedRecord - RouteRecordNormalized
* @param parent - RouteRecordMatcher
*/
function checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent) {
if (parent && parent.record.name && !mainNormalizedRecord.name && !mainNormalizedRecord.path && mainNormalizedRecord.children.length === 0) warn(`The route named "${String(parent.record.name)}" has a child without a name, an empty path, and no children. This is probably a mistake: using that name won't render the empty path child so you probably want to move the name to the child instead. If this is intentional, add a name to the child route to silence the warning.`);
}
function checkSameNameAsAncestor(record, parent) {
for (let ancestor = parent; ancestor; ancestor = ancestor.parent) if (ancestor.record.name === record.name) throw new Error(`A route named "${String(record.name)}" has been added as a ${parent === ancestor ? "child" : "descendant"} of a route with the same name. Route names must be unique and a nested route cannot use the same name as an ancestor.`);
}
function checkMissingParamsInAbsolutePath(record, parent) {
for (const key of parent.keys) if (!record.keys.find(isSameParam.bind(null, key))) return warn(`Absolute path "${record.record.path}" must have the exact same param named "${key.name}" as its parent "${parent.record.path}".`);
}
/**
* Performs a binary search to find the correct insertion index for a new matcher.
*
* Matchers are primarily sorted by their score. If scores are tied then we also consider parent/child relationships,
* with descendants coming before ancestors. If there's still a tie, new routes are inserted after existing routes.
*
* @param matcher - new matcher to be inserted
* @param matchers - existing matchers
*/
function findInsertionIndex(matcher, matchers) {
let lower = 0;
let upper = matchers.length;
while (lower !== upper) {
const mid = lower + upper >> 1;
if (comparePathParserScore(matcher, matchers[mid]) < 0) upper = mid;
else lower = mid + 1;
}
const insertionAncestor = getInsertionAncestor(matcher);
if (insertionAncestor) {
upper = matchers.lastIndexOf(insertionAncestor, upper - 1);
if (upper < 0) warn(`Finding ancestor route "${insertionAncestor.record.path}" failed for "${matcher.record.path}"`);
}
return upper;
}
function getInsertionAncestor(matcher) {
let ancestor = matcher;
while (ancestor = ancestor.parent) if (isMatchable(ancestor) && comparePathParserScore(matcher, ancestor) === 0) return ancestor;
}
/**
* Checks if a matcher can be reachable. This means if it's possible to reach it as a route. For example, routes without
* a component, or name, or redirect, are just used to group other routes.
* @param matcher
* @param matcher.record record of the matcher
* @returns
*/
function isMatchable({ record }) {
return !!(record.name || record.components && Object.keys(record.components).length || record.redirect);
}
//#endregion
//#region src/query.ts
/**
* Transforms a queryString into a {@link LocationQuery} object. Accept both, a
* version with the leading `?` and without Should work as URLSearchParams
* @internal
*
* @param search - search string to parse
* @returns a query object
*/
function parseQuery(search) {
const query = {};
if (search === "" || search === "?") return query;
const searchParams = (search[0] === "?" ? search.slice(1) : search).split("&");
for (let i = 0; i < searchParams.length; ++i) {
const searchParam = searchParams[i].replace(PLUS_RE, " ");
const eqPos = searchParam.indexOf("=");
const key = decode(eqPos < 0 ? searchParam : searchParam.slice(0, eqPos));
const value = eqPos < 0 ? null : decode(searchParam.slice(eqPos + 1));
if (key in query) {
let currentValue = query[key];
if (!isArray(currentValue)) currentValue = query[key] = [currentValue];
currentValue.push(value);
} else query[key] = value;
}
return query;
}
/**
* Stringifies a {@link LocationQueryRaw} object. Like `URLSearchParams`, it
* doesn't prepend a `?`
*
* @internal
*
* @param query - query object to stringify
* @returns string version of the query without the leading `?`
*/
function stringifyQuery(query) {
let search = "";
for (let key in query) {
const value = query[key];
key = encodeQueryKey(key);
if (value == null) {
if (value !== void 0) search += (search.length ? "&" : "") + key;
continue;
}
(isArray(value) ? value.map((v) => v && encodeQueryValue(v)) : [value && encodeQueryValue(value)]).forEach((value) => {
if (value !== void 0) {
search += (search.length ? "&" : "") + key;
if (value != null) search += "=" + value;
}
});
}
return search;
}
/**
* Transforms a {@link LocationQueryRaw} into a {@link LocationQuery} by casting
* numbers into strings, removing keys with an undefined value and replacing
* undefined with null in arrays
*
* @param query - query object to normalize
* @returns a normalized query object
*/
function normalizeQuery(query) {
const normalizedQuery = {};
for (const key in query) {
const value = query[key];
if (value !== void 0) normalizedQuery[key] = isArray(value) ? value.map((v) => v == null ? null : "" + v) : value == null ? value : "" + value;
}
return normalizedQuery;
}
//#endregion
//#region src/injectionSymbols.ts
/**
* RouteRecord being rendered by the closest ancestor Router View. Used for
* `onBeforeRouteUpdate` and `onBeforeRouteLeave`. rvlm stands for Router View
* Location Matched
*
* @internal
*/
const matchedRouteKey = Symbol("router view location matched");
/**
* Allows overriding the router view depth to control which component in
* `matched` is rendered. rvd stands for Router View Depth
*
* @internal
*/
const viewDepthKey = Symbol("router view depth");
/**
* Allows overriding the router instance returned by `useRouter` in tests. r
* stands for router
*
* @internal
*/
const routerKey = Symbol("router");
/**
* Allows overriding the current route returned by `useRoute` in tests. rl
* stands for route location
*
* @internal
*/
const routeLocationKey = Symbol("route location");
/**
* Allows overriding the current route used by router-view. Internally this is
* used when the `route` prop is passed.
*
* @internal
*/
const routerViewLocationKey = Symbol("router view location");
//#endregion
//#region src/utils/callbacks.ts
/**
* Create a list of callbacks that can be reset. Used to create before and after navigation guards list
*/
function useCallbacks() {
let handlers = [];
function add(handler) {
handlers.push(handler);
return () => {
const i = handlers.indexOf(handler);
if (i > -1) handlers.splice(i, 1);
};
}
function reset() {
handlers = [];
}
return {
add,
list: () => handlers.slice(),
reset
};
}
//#endregion
//#region src/navigationGuards.ts
function registerGuard(activeRecordRef, name, guard) {
const record = activeRecordRef.value;
if (!record) {
warn(`No active route record was found when calling \`${name === "updateGuards" ? "onBeforeRouteUpdate" : "onBeforeRouteLeave"}()\`. Make sure you call this function inside a component child of <router-view>. Maybe you called it inside of App.vue?`);
return;
}
let currentRecord = record;
const removeFromList = () => {
currentRecord[name].delete(guard);
};
onUnmounted(removeFromList);
onDeactivated(removeFromList);
onActivated(() => {
const newRecord = activeRecordRef.value;
if (!newRecord) warn("No active route record was found when reactivating component with navigation guard. This is likely a bug in vue-router. Please report it.");
if (newRecord) currentRecord = newRecord;
currentRecord[name].add(guard);
});
currentRecord[name].add(guard);
}
/**
* Add a navigation guard that triggers whenever the component for the current
* location is about to be left. Similar to {@link beforeRouteLeave} but can be
* used in any component. The guard is removed when the component is unmounted.
*
* @param leaveGuard - {@link NavigationGuard}
*/
function onBeforeRouteLeave(leaveGuard) {
if (!getCurrentInstance()) {
warn("getCurrentInstance() returned null. onBeforeRouteLeave() must be called at the top of a setup function");
return;
}
registerGuard(inject(matchedRouteKey, {}), "leaveGuards", leaveGuard);
}
/**
* Add a navigation guard that triggers whenever the current location is about
* to be updated. Similar to {@link beforeRouteUpdate} but can be used in any
* component. The guard is removed when the component is unmounted.
*
* @param updateGuard - {@link NavigationGuard}
*/
function onBeforeRouteUpdate(updateGuard) {
if (!getCurrentInstance()) {
warn("getCurrentInstance() returned null. onBeforeRouteUpdate() must be called at the top of a setup function");
return;
}
registerGuard(inject(matchedRouteKey, {}), "updateGuards", updateGuard);
}
function guardToPromiseFn(guard, to, from, record, name, runWithContext = (fn) => fn()) {
const enterCallbackArray = record && (record.enterCallbacks[name] = record.enterCallbacks[name] || []);
return () => new Promise((resolve, reject) => {
const next = (valid) => {
if (valid === false) reject(createRouterError(ErrorTypes.NAVIGATION_ABORTED, {
from,
to
}));
else if (valid instanceof Error) reject(valid);
else if (isRouteLocation(valid)) reject(createRouterError(ErrorTypes.NAVIGATION_GUARD_REDIRECT, {
from: to,
to: valid
}));
else {
if (enterCallbackArray && record.enterCallbacks[name] === enterCallbackArray && typeof valid === "function") enterCallbackArray.push(valid);
resolve();
}
};
const guardReturn = runWithContext(() => guard.call(record && record.instances[name], to, from, withDeprecationWarning(canOnlyBeCalledOnce(next, to, from))));
let guardCall = Promise.resolve(guardReturn);
if (guard.length < 3) guardCall = guardCall.then(next);
if (guard.length > 2) {
const message = `The "next" callback was never called inside of ${guard.name ? "\"" + guard.name + "\"" : ""}:\n${guard.toString()}\n. If you are returning a value instead of calling "next", make sure to remove the "next" parameter from your function.`;
if (typeof guardReturn === "object" && "then" in guardReturn) guardCall = guardCall.then((resolvedValue) => {
if (!next._called) {
warn(message);
return Promise.reject(/* @__PURE__ */ new Error("Invalid navigation guard"));
}
return resolvedValue;
});
else if (guardReturn !== void 0) {
if (!next._called) {
warn(message);
reject(/* @__PURE__ */ new Error("Invalid navigation guard"));
return;
}
}
}
guardCall.catch((err) => reject(err));
});
}
/**
* Wraps the next callback to warn when it is used. Dev-only: when __DEV__ is
* false (production builds), this branch is dead code and is stripped from the
* bundle.
*
* @internal
*/
function withDeprecationWarning(next) {
let warned = false;
return function() {
if (!warned) {
warned = true;
warn("The `next()` callback in navigation guards is deprecated. Return the value instead of calling `next(value)`.");
}
return next.apply(this, arguments);
};
}
function canOnlyBeCalledOnce(next, to, from) {
let called = 0;
return function() {
if (called++ === 1) warn(`The "next" callback was called more than once in one navigation guard when going from "${from.fullPath}" to "${to.fullPath}". It should be called exactly one time in each navigation guard. This will fail in production.`);
next._called = true;
if (called === 1) next.apply(null, arguments);
};
}
function extractComponentsGuards(matched, guardType, to, from, runWithContext = (fn) => fn()) {
const guards = [];
for (const record of matched) {
if (!record.components && record.children && !record.children.length) warn(`Record with path "${record.path}" is either missing a "component(s)" or "children" property.`);
for (const name in record.components) {
let rawComponent = record.components[name];
if (!rawComponent || typeof rawComponent !== "object" && typeof rawComponent !== "function") {
warn(`Component "${name}" in record with path "${record.path}" is not a valid component. Received "${String(rawComponent)}".`);
throw new Error("Invalid route component");
} else if ("then" in rawComponent) {
warn(`Component "${name}" in record with path "${record.path}" is a Promise instead of a function that returns a Promise. Did you write "import('./MyPage.vue')" instead of "() => import('./MyPage.vue')" ? This will break in production if not fixed.`);
const promise = rawComponent;
rawComponent = () => promise;
} else if (rawComponent.__asyncLoader && !rawComponent.__warnedDefineAsync) {
rawComponent.__warnedDefineAsync = true;
warn(`Component "${name}" in record with path "${record.path}" is defined using "defineAsyncComponent()". Write "() => import('./MyPage.vue')" instead of "defineAsyncComponent(() => import('./MyPage.vue'))".`);
}
if (guardType !== "beforeRouteEnter" && !record.instances[name]) continue;
if (isRouteComponent(rawComponent)) {
const guard = (rawComponent.__vccOpts || rawComponent)[guardType];
guard && guards.push(guardToPromiseFn(guard, to, from, record, name, runWithContext));
} else {
let componentPromise = rawComponent();
if (!("catch" in componentPromise)) {
warn(`Component "${name}" in record with path "${record.path}" is a function that does not return a Promise. If you were passing a functional component, make sure to add a "displayName" to the component. This will break in production if not fixed.`);
componentPromise = Promise.resolve(componentPromise);
}
guards.push(() => componentPromise.then((resolved) => {
if (!resolved) throw new Error(`Couldn't resolve component "${name}" at "${record.path}"`);
const resolvedComponent = isESModule(resolved) ? resolved.default : resolved;
record.mods[name] = resolved;
record.components[name] = resolvedComponent;
const guard = (resolvedComponent.__vccOpts || resolvedComponent)[guardType];
return guard && guardToPromiseFn(guard, to, from, record, name, runWithContext)();
}));
}
}
}
return guards;
}
/**
* Ensures a route is loaded, so it can be passed as o prop to `<RouterView>`.
*
* @param route - resolved route to load
*/
function loadRouteLocation(route) {
return route.matched.every((record) => record.redirect) ? Promise.reject(/* @__PURE__ */ new Error("Cannot load a route that redirects.")) : Promise.all(route.matched.map((record) => record.components && Promise.all(Object.keys(record.components).reduce((promises, name) => {
const rawComponent = record.components[name];
if (typeof rawComponent === "function" && !("displayName" in rawComponent)) promises.push(rawComponent().then((resolved) => {
if (!resolved) return Promise.reject(/* @__PURE__ */ new Error(`Couldn't resolve component "${name}" at "${record.path}". Ensure you passed a function that returns a promise.`));
const resolvedComponent = isESModule(resolved) ? resolved.default : resolved;
record.mods[name] = resolved;
record.components[name] = resolvedComponent;
}));
return promises;
}, [])))).then(() => route);
}
/**
* Split the leaving, updating, and entering records.
* @internal
*
* @param to - Location we are navigating to
* @param from - Location we are navigating from
*/
function extractChangingRecords(to, from) {
const leavingRecords = [];
const updatingRecords = [];
const enteringRecords = [];
const len = Math.max(from.matched.length, to.matched.length);
for (let i = 0; i < len; i++) {
const recordFrom = from.matched[i];
if (recordFrom) if (to.matched.find((record) => isSameRouteRecord(record, recordFrom))) updatingRecords.push(recordFrom);
else leavingRecords.push(recordFrom);
const recordTo = to.matched[i];
if (recordTo) {
if (!from.matched.find((record) => isSameRouteRecord(record, recordTo))) enteringRecords.push(recordTo);
}
}
return [
leavingRecords,
updatingRecords,
enteringRecords
];
}
//#endregion
//#region src/RouterLink.ts
/**
* Returns the internal behavior of a {@link RouterLink} without the rendering part.
*
* @param props - a `to` location and an optional `replace` flag
*/
function useLink(props) {
const router = inject(routerKey);
const currentRoute = inject(routeLocationKey);
let hasPrevious = false;
let previousTo = null;
const route = computed(() => {
const to = unref(props.to);
if (!hasPrevious || to !== previousTo) {
if (!isRouteLocation(to)) if (hasPrevious) warn(`Invalid value for prop "to" in useLink()\n- to:`, to, `\n- previous to:`, previousTo, `\n- props:`, props);
else warn(`Invalid value for prop "to" in useLink()\n- to:`, to, `\n- props:`, props);
previousTo = to;
hasPrevious = true;
}
return router.resolve(to);
});
const activeRecordIndex = computed(() => {
const { matched } = route.value;
const { length } = matched;
const routeMatched = matched[length - 1];
const currentMatched = currentRoute.matched;
if (!routeMatched || !currentMatched.length) return -1;
const index = currentMatched.findIndex(isSameRouteRecord.bind(null, routeMatched));
if (index > -1) return index;
const parentRecordPath = getOriginalPath(matched[length - 2]);
return length > 1 && getOriginalPath(routeMatched) === parentRecordPath && currentMatched[currentMatched.length - 1].path !== parentRecordPath ? currentMatched.findIndex(isSameRouteRecord.bind(null, matched[length - 2])) : index;
});
const isActive = computed(() => activeRecordIndex.value > -1 && includesParams(currentRoute.params, route.value.params));
const isExactActive = computed(() => activeRecordIndex.value > -1 && activeRecordIndex.value === currentRoute.matched.length - 1 && isSameRouteLocationParams(currentRoute.params, route.value.params));
function navigate(e = {}) {
if (guardEvent(e)) {
const p = router[unref(props.replace) ? "replace" : "push"](unref(props.to)).catch(noop);
if (props.viewTransition && typeof document !== "undefined" && "startViewTransition" in document) document.startViewTransition(() => p);
return p;
}
return Promise.resolve();
}
if (isBrowser) {
const instance = getCurrentInstance();
if (instance) {
const linkContextDevtools = {
route: route.value,
isActive: isActive.value,
isExactActive: isExactActive.value,
error: null
};
instance.__vrl_devtools = instance.__vrl_devtools || [];
instance.__vrl_devtools.push(linkContextDevtools);
watchEffect(() => {
linkContextDevtools.route = route.value;
linkContextDevtools.isActive = isActive.value;
linkContextDevtools.isExactActive = isExactActive.value;
linkContextDevtools.error = isRouteLocation(unref(props.to)) ? null : "Invalid \"to\" value";
}, { flush: "post" });
}
}
/**
* NOTE: update {@link _RouterLinkI}'s `$slots` type when updating this
*/
return {
route,
href: computed(() => route.value.href),
isActive,
isExactActive,
navigate
};
}
function preferSingleVNode(vnodes) {
return vnodes.length === 1 ? vnodes[0] : vnodes;
}
const RouterLinkImpl = /* @__PURE__ */ defineComponent({
name: "RouterLink",
compatConfig: { MODE: 3 },
props: {
to: {
type: [String, Object],
required: true
},
replace: Boolean,
activeClass: String,
exactActiveClass: String,
custom: Boolean,
ariaCurrentValue: {
type: String,
default: "page"
},
viewTransition: Boolean
},
useLink,
setup(props, { slots }) {
const link = reactive(useLink(props));
const { options } = inject(routerKey);
const elClass = computed(() => ({
[getLinkClass(props.activeClass, options.linkActiveClass, "router-link-active")]: link.isActive,
[getLinkClass(props.exactActiveClass, options.linkExactActiveClass, "router-link-exact-active")]: link.isExactActive
}));
return () => {
const children = slots.default && preferSingleVNode(slots.default(link));
return props.custom ? children : h("a", {
"aria-current": link.isExactActive ? props.ariaCurrentValue : null,
href: link.href,
onClick: link.navigate,
class: elClass.value
}, children);
};
}
});
/**
* Component to render a link that triggers a navigation on click.
*/
const RouterLink = RouterLinkImpl;
function guardEvent(e) {
if (e.metaKey || e.altKey || e.ctrlKey || e.shiftKey) return;
if (e.defaultPrevented) return;
if (e.button !== void 0 && e.button !== 0) return;
if (e.currentTarget && e.currentTarget.getAttribute) {
const target = e.currentTarget.getAttribute("target");
if (/\b_blank\b/i.test(target)) return;
}
if (e.preventDefault) e.preventDefault();
return true;
}
function includesParams(outer, inner) {
for (const key in inner) {
const innerValue = inner[key];
const outerValue = outer[key];
if (typeof innerValue === "string") {
if (innerValue !== outerValue) return false;
} else if (!isArray(outerValue) || outerValue.length !== innerValue.length || innerValue.some((value, i) => value.valueOf() !== outerValue[i].valueOf())) return false;
}
return true;
}
/**
* Get the original path value of a record by following its aliasOf
* @param record
*/
function getOriginalPath(record) {
return record ? record.aliasOf ? record.aliasOf.path : record.path : "";
}
/**
* Utility class to get the active class based on defaults.
* @param propClass
* @param globalClass
* @param defaultClass
*/
const getLinkClass = (propClass, globalClass, defaultClass) => propClass != null ? propClass : globalClass != null ? globalClass : defaultClass;
//#endregion
//#region src/RouterView.ts
const RouterViewImpl = /* @__PURE__ */ defineComponent({
name: "RouterView",
inheritAttrs: false,
props: {
name: {
type: String,
default: "default"
},
route: Object
},
compatConfig: { MODE: 3 },
setup(props, { attrs, slots }) {
warnDeprecatedUsage();
const injectedRoute = inject(routerViewLocationKey);
const routeToDisplay = computed(() => props.route || injectedRoute.value);
const injectedDepth = inject(viewDepthKey, 0);
const depth = computed(() => {
let initialDepth = unref(injectedDepth);
const { matched } = routeToDisplay.value;
let matchedRoute;
while ((matchedRoute = matched[initialDepth]) && !matchedRoute.components) initialDepth++;
return initialDepth;
});
const matchedRouteRef = computed(() => routeToDisplay.value.matched[depth.value]);
provide(viewDepthKey, computed(() => depth.value + 1));
provide(matchedRouteKey, matchedRouteRef);
provide(routerViewLocationKey, routeToDisplay);
const viewRef = ref();
watch(() => [
viewRef.value,
matchedRouteRef.value,
props.name
], ([instance, to, name], [oldInstance, from, oldName]) => {
if (to) {
to.instances[name] = instance;
if (from && from !== to && instance && instance === oldInstance) {
if (!to.leaveGuards.size) to.leaveGuards = from.leaveGuards;
if (!to.updateGuards.size) to.updateGuards = from.updateGuards;
}
}
if (instance && to && (!from || !isSameRouteRecord(to, from) || !oldInstance)) (to.enterCallbacks[name] || []).forEach((callback) => callback(instance));
}, { flush: "post" });
return () => {
const route = routeToDisplay.value;
const currentName = props.name;
const matchedRoute = matchedRouteRef.value;
const ViewComponent = matchedRoute && matchedRoute.components[currentName];
if (!ViewComponent) return normalizeSlot(slots.default, {
Component: ViewComponent,
route
});
const routePropsOption = matchedRoute.props[currentName];
const routeProps = routePropsOption ? routePropsOption === true ? route.params : typeof routePropsOption === "function" ? routePropsOption(route) : routePropsOption : null;
const onVnodeUnmounted = (vnode) => {
if (vnode.component.isUnmounted) matchedRoute.instances[currentName] = null;
};
const component = h(ViewComponent, assign({}, routeProps, attrs, {
onVnodeUnmounted,
ref: viewRef
}));
if (isBrowser && component.ref) {
const info = {
depth: depth.value,
name: matchedRoute.name,
path: matchedRoute.path,
meta: matchedRoute.meta
};
(isArray(component.ref) ? component.ref.map((r) => r.i) : [component.ref.i]).forEach((instance) => {
instance.__vrv_devtools = info;
});
}
return normalizeSlot(slots.default, {
Component: component,
route
}) || component;
};
}
});
function normalizeSlot(slot, data) {
if (!slot) return null;
const slotContent = slot(data);
return slotContent.length === 1 ? slotContent[0] : slotContent;
}
/**
* Component to display the current route the user is at.
*/
const RouterView = RouterViewImpl;
function warnDeprecatedUsage() {
const instance = getCurrentInstance();
const parentName = instance.parent && instance.parent.type.name;
const parentSubTreeType = instance.parent && instance.parent.subTree && instance.parent.subTree.type;
if (parentName && (parentName === "KeepAlive" || parentName.includes("Transition")) && typeof parentSubTreeType === "object" && parentSubTreeType.name === "RouterView") {
const comp = parentName === "KeepAlive" ? "keep-alive" : "transition";
warn(`<router-view> can no longer be used directly inside <transition> or <keep-alive>.
Use slot props instead:
<router-view v-slot="{ Component }">
<${comp}>\n <component :is="Component" />\n </${comp}>\n</router-view>`);
}
}
//#endregion
//#region src/devtools.ts
/**
* Copies a route location and removes any problematic properties that cannot be shown in devtools (e.g. Vue instances).
*
* @param routeLocation - routeLocation to format
* @param tooltip - optional tooltip
* @returns a copy of the routeLocation
*/
function formatRouteLocation(routeLocation, tooltip) {
const copy = assign({}, routeLocation, { matched: routeLocation.matched.map((matched) => omit(matched, [
"instances",
"children",
"aliasOf"
])) });
return { _custom: {
type: null,
readOnly: true,
display: routeLocation.fullPath,
tooltip,
value: copy
} };
}
function formatDisplay(display) {
return { _custom: { display } };
}
let routerId = 0;
function addDevtools(app, router, matcher) {
if (router.__hasDevtools) return;
router.__hasDevtools = true;
const id = routerId++;
setupDevtoolsPlugin({
id: "org.vuejs.router" + (id ? "." + id : ""),
label: "Vue Router",
packageName: "vue-router",
homepage: "https://router.vuejs.org",
logo: "https://router.vuejs.org/logo.png",
componentStateTypes: ["Routing"],
app
}, (api) => {
api.on.inspectComponent((payload) => {
if (payload.instanceData) payload.instanceData.state.push({
type: "Routing",
key: "$route",
editable: false,
value: formatRouteLocation(router.currentRoute.value, "Current Route")
});
});
api.on.visitComponentTree(({ treeNode: node, componentInstance }) => {
if (componentInstance.__vrv_devtools) {
const info = componentInstance.__vrv_devtools;
node.tags.push({
label: (info.name ? `${info.name.toString()}: ` : "") + info.path,
textColor: 0,
tooltip: "This component is rendered by &lt;router-view&gt;",
backgroundColor: PINK_500
});
}
if (isArray(componentInstance.__vrl_devtools)) {
componentInstance.__devtoolsApi = api;
componentInstance.__vrl_devtools.forEach((devtoolsData) => {
let label = devtoolsData.route.path;
let backgroundColor = ORANGE_400;
let tooltip = "";
let textColor = 0;
if (devtoolsData.error) {
label = devtoolsData.error;
backgroundColor = RED_100;
textColor = RED_700;
} else if (devtoolsData.isExactActive) {
backgroundColor = LIME_500;
tooltip = "This is exactly active";
} else if (devtoolsData.isActive) {
backgroundColor = BLUE_600;
tooltip = "This link is active";
}
node.tags.push({
label,
textColor,
tooltip,
backgroundColor
});
});
}
});
watch(router.currentRoute, () => {
refreshRoutesView();
api.notifyComponentUpdate();
api.sendInspectorTree(routerInspectorId);
api.sendInspectorState(routerInspectorId);
});
const navigationsLayerId = "router:navigations:" + id;
api.addTimelineLayer({
id: navigationsLayerId,
label: `Router${id ? " " + id : ""} Navigations`,
color: 4237508
});
router.onError((error, to) => {
api.addTimelineEvent({
layerId: navigationsLayerId,
event: {
title: "Error during Navigation",
subtitle: to.fullPath,
logType: "error",
time: api.now(),
data: { error },
groupId: to.meta.__navigationId
}
});
});
let navigationId = 0;
router.beforeEach((to, from) => {
const data = {
guard: formatDisplay("beforeEach"),
from: formatRouteLocation(from, "Current Location during this navigation"),
to: formatRouteLocation(to, "Target location")
};
Object.defineProperty(to.meta, "__navigationId", { value: navigationId++ });
api.addTimelineEvent({
layerId: navigationsLayerId,
event: {
time: api.now(),
title: "Start of navigation",
subtitle: to.fullPath,
data,
groupId: to.meta.__navigationId
}
});
});
router.afterEach((to, from, failure) => {
const data = { guard: formatDisplay("afterEach") };
if (failure) {
data.failure = { _custom: {
type: Error,
readOnly: true,
display: failure ? failure.message : "",
tooltip: "Navigation Failure",
value: failure
} };
data.status = formatDisplay("❌");
} else data.status = formatDisplay("✅");
data.from = formatRouteLocation(from, "Current Location during this navigation");
data.to = formatRouteLocation(to, "Target location");
api.addTimelineEvent({
layerId: navigationsLayerId,
event: {
title: "End of navigation",
subtitle: to.fullPath,
time: api.now(),
data,
logType: failure ? "warning" : "default",
groupId: to.meta.__navigationId
}
});
});
/**
* Inspector of Existing routes
*/
const routerInspectorId = "router-inspector:" + id;
api.addInspector({
id: routerInspectorId,
label: "Routes" + (id ? " " + id : ""),
icon: "book",
treeFilterPlaceholder: "Search routes"
});
function refreshRoutesView() {
if (!activeRoutesPayload) return;
const payload = activeRoutesPayload;
let routes = matcher.getRoutes().filter((route) => !route.parent || !route.parent.record.components);
routes.forEach(resetMatchStateOnRouteRecord);
if (payload.filter) routes = routes.filter((route) => isRouteMatching(route, payload.filter.toLowerCase()));
routes.forEach((route) => markRouteRecordActive(route, router.currentRoute.value));
payload.rootNodes = routes.map(formatRouteRecordForInspector);
}
let activeRoutesPayload;
api.on.getInspectorTree((payload) => {
activeRoutesPayload = payload;
if (payload.app === app && payload.inspectorId === routerInspectorId) refreshRoutesView();
});
/**
* Display information about the currently selected route record
*/
api.on.getInspectorState((payload) => {
if (payload.app === app && payload.inspectorId === routerInspectorId) {
const route = matcher.getRoutes().find((route) => route.record.__vd_id === payload.nodeId);
if (route) payload.state = { options: formatRouteRecordMatcherForStateInspector(route) };
}
});
api.sendInspectorTree(routerInspectorId);
api.sendInspectorState(routerInspectorId);
});
}
function modifierForKey(key) {
if (key.optional) return key.repeatable ? "*" : "?";
else return key.repeatable ? "+" : "";
}
function formatRouteRecordMatcherForStateInspector(route) {
const { record } = route;
const fields = [{
editable: false,
key: "path",
value: record.path
}];
if (record.name != null) fields.push({
editable: false,
key: "name",
value: record.name
});
fields.push({
editable: false,
key: "regexp",
value: route.re
});
if (route.keys.length) fields.push({
editable: false,
key: "keys",
value: { _custom: {
type: null,
readOnly: true,
display: route.keys.map((key) => `${key.name}${modifierForKey(key)}`).join(" "),
tooltip: "Param keys",
value: route.keys
} }
});
if (record.redirect != null) fields.push({
editable: false,
key: "redirect",
value: record.redirect
});
if (route.alias.length) fields.push({
editable: false,
key: "aliases",
value: route.alias.map((alias) => alias.record.path)
});
if (Object.keys(route.record.meta).length) fields.push({
editable: false,
key: "meta",
value: route.record.meta
});
fields.push({
key: "score",
editable: false,
value: { _custom: {
type: null,
readOnly: true,
display: route.score.map((score) => score.join(", ")).join(" | "),
tooltip: "Score used to sort routes",
value: route.score
} }
});
return fields;
}
/**
* Extracted from tailwind palette
*/
const PINK_500 = 15485081;
const BLUE_600 = 2450411;
const LIME_500 = 8702998;
const CYAN_400 = 2282478;
const ORANGE_400 = 16486972;
const DARK = 6710886;
const RED_100 = 16704226;
const RED_700 = 12131356;
function formatRouteRecordForInspector(route) {
const tags = [];
const { record } = route;
if (record.name != null) tags.push({
label: String(record.name),
textColor: 0,
backgroundColor: CYAN_400
});
if (record.aliasOf) tags.push({
label: "alias",
textColor: 0,
backgroundColor: ORANGE_400
});
if (route.__vd_match) tags.push({
label: "matches",
textColor: 0,
backgroundColor: PINK_500
});
if (route.__vd_exactActive) tags.push({
label: "exact",
textColor: 0,
backgroundColor: LIME_500
});
if (route.__vd_active) tags.push({
label: "active",
textColor: 0,
backgroundColor: BLUE_600
});
if (record.redirect) tags.push({
label: typeof record.redirect === "string" ? `redirect: ${record.redirect}` : "redirects",
textColor: 16777215,
backgroundColor: DARK
});
let id = record.__vd_id;
if (id == null) {
id = String(routeRecordId++);
record.__vd_id = id;
}
return {
id,
label: record.path,
tags,
children: route.children.map(formatRouteRecordForInspector)
};
}
let routeRecordId = 0;
const EXTRACT_REGEXP_RE = /^\/(.*)\/([a-z]*)$/;
function markRouteRecordActive(route, currentRoute) {
const isExactActive = currentRoute.matched.length && isSameRouteRecord(currentRoute.matched[currentRoute.matched.length - 1], route.record);
route.__vd_exactActive = route.__vd_active = isExactActive;
if (!isExactActive) route.__vd_active = currentRoute.matched.some((match) => isSameRouteRecord(match, route.record));
route.children.forEach((childRoute) => markRouteRecordActive(childRoute, currentRoute));
}
function resetMatchStateOnRouteRecord(route) {
route.__vd_match = false;
route.children.forEach(resetMatchStateOnRouteRecord);
}
function isRouteMatching(route, filter) {
const found = String(route.re).match(EXTRACT_REGEXP_RE);
route.__vd_match = false;
if (!found || found.length < 3) return false;
if (new RegExp(found[1].replace(/\$$/, ""), found[2]).test(filter)) {
route.children.forEach((child) => isRouteMatching(child, filter));
if (route.record.path !== "/" || filter === "/") {
route.__vd_match = route.re.test(filter);
return true;
}
return false;
}
const path = route.record.path.toLowerCase();
const decodedPath = decode(path);
if (!filter.startsWith("/") && (decodedPath.includes(filter) || path.includes(filter))) return true;
if (decodedPath.startsWith(filter) || path.startsWith(filter)) return true;
if (route.record.name && String(route.record.name).includes(filter)) return true;
return route.children.some((child) => isRouteMatching(child, filter));
}
function omit(obj, keys) {
const ret = {};
for (const key in obj) if (!keys.includes(key)) ret[key] = obj[key];
return ret;
}
//#endregion
//#region src/router.ts
/**
* Creates a Router instance that can be used by a Vue app.
*
* @param options - {@link RouterOptions}
*/
function createRouter(options) {
const matcher = createRouterMatcher(options.routes, options);
const parseQuery$1 = options.parseQuery || parseQuery;
const stringifyQuery$1 = options.stringifyQuery || stringifyQuery;
const routerHistory = options.history;
if (!routerHistory) throw new Error("Provide the \"history\" option when calling \"createRouter()\": https://router.vuejs.org/api/interfaces/RouterOptions.html#history");
const beforeGuards = useCallbacks();
const beforeResolveGuards = useCallbacks();
const afterGuards = useCallbacks();
const currentRoute = shallowRef(START_LOCATION_NORMALIZED);
let pendingLocation = START_LOCATION_NORMALIZED;
if (isBrowser && options.scrollBehavior && "scrollRestoration" in history) history.scrollRestoration = "manual";
const normalizeParams = applyToParams.bind(null, (paramValue) => "" + paramValue);
const encodeParams = applyToParams.bind(null, encodeParam);
const decodeParams = applyToParams.bind(null, decode);
function addRoute(parentOrRoute, route) {
let parent;
let record;
if (isRouteName(parentOrRoute)) {
parent = matcher.getRecordMatcher(parentOrRoute);
if (!parent) warn(`Parent route "${String(parentOrRoute)}" not found when adding child route`, route);
record = route;
} else record = parentOrRoute;
return matcher.addRoute(record, parent);
}
function removeRoute(name) {
const recordMatcher = matcher.getRecordMatcher(name);
if (recordMatcher) matcher.removeRoute(recordMatcher);
else warn(`Cannot remove non-existent route "${String(name)}"`);
}
function getRoutes() {
return matcher.getRoutes().map((routeMatcher) => routeMatcher.record);
}
function hasRoute(name) {
return !!matcher.getRecordMatcher(name);
}
function resolve(rawLocation, currentLocation) {
currentLocation = assign({}, currentLocation || currentRoute.value);
if (typeof rawLocation === "string") {
const locationNormalized = parseURL(parseQuery$1, rawLocation, currentLocation.path);
const matchedRoute = matcher.resolve({ path: locationNormalized.path }, currentLocation);
const href = routerHistory.createHref(locationNormalized.fullPath);
if (href.startsWith("//")) warn(`Location "${rawLocation}" resolved to "${href}". A resolved location cannot start with multiple slashes.`);
else if (!matchedRoute.matched.length) warn(`No match found for location with path "${rawLocation}"`);
return assign(locationNormalized, matchedRoute, {
params: decodeParams(matchedRoute.params),
hash: decode(locationNormalized.hash),
redirectedFrom: void 0,
href
});
}
if (!isRouteLocation(rawLocation)) {
warn(`router.resolve() was passed an invalid location. This will fail in production.\n- Location:`, rawLocation);
return resolve({});
}
let matcherLocation;
if (rawLocation.path != null) {
if ("params" in rawLocation && !("name" in rawLocation) && Object.keys(rawLocation.params).length) warn(`Path "${rawLocation.path}" was passed with params but they will be ignored. Use a named route alongside params instead.`);
matcherLocation = assign({}, rawLocation, { path: parseURL(parseQuery$1, rawLocation.path, currentLocation.path).path });
} else {
const targetParams = assign({}, rawLocation.params);
for (const key in targetParams) if (targetParams[key] == null) delete targetParams[key];
matcherLocation = assign({}, rawLocation, { params: encodeParams(targetParams) });
currentLocation.params = encodeParams(currentLocation.params);
}
const matchedRoute = matcher.resolve(matcherLocation, currentLocation);
const hash = rawLocation.hash || "";
if (hash && !hash.startsWith("#")) warn(`A \`hash\` should always start with the character "#". Replace "${hash}" with "#${hash}".`);
matchedRoute.params = normalizeParams(decodeParams(matchedRoute.params));
const fullPath = stringifyURL(stringifyQuery$1, assign({}, rawLocation, {
hash: encodeHash(hash),
path: matchedRoute.path
}));
const href = routerHistory.createHref(fullPath);
if (href.startsWith("//")) warn(`Location "${rawLocation}" resolved to "${href}". A resolved location cannot start with multiple slashes.`);
else if (!matchedRoute.matched.length) warn(`No match found for location with path "${rawLocation.path != null ? rawLocation.path : rawLocation}"`);
return assign({
fullPath,
hash,
query: stringifyQuery$1 === stringifyQuery ? normalizeQuery(rawLocation.query) : rawLocation.query || {}
}, matchedRoute, {
redirectedFrom: void 0,
href
});
}
function locationAsObject(to) {
return typeof to === "string" ? parseURL(parseQuery$1, to, currentRoute.value.path) : assign({}, to);
}
function checkCanceledNavigation(to, from) {
if (pendingLocation !== to) return createRouterError(ErrorTypes.NAVIGATION_CANCELLED, {
from,
to
});
}
function push(to) {
return pushWithRedirect(to);
}
function replace(to) {
return push(assign(locationAsObject(to), { replace: true }));
}
function handleRedirectRecord(to, from) {
const lastMatched = to.matched[to.matched.length - 1];
if (lastMatched && lastMatched.redirect) {
const { redirect } = lastMatched;
let newTargetLocation = typeof redirect === "function" ? redirect(to, from) : redirect;
if (typeof newTargetLocation === "string") {
newTargetLocation = newTargetLocation.includes("?") || newTargetLocation.includes("#") ? newTargetLocation = locationAsObject(newTargetLocation) : { path: newTargetLocation };
newTargetLocation.params = {};
}
if (newTargetLocation.path == null && !("name" in newTargetLocation)) {
warn(`Invalid redirect found:\n${JSON.stringify(newTargetLocation, null, 2)}\n when navigating to "${to.fullPath}". A redirect must contain a name or path. This will break in production.`);
throw new Error("Invalid redirect");
}
return assign({
query: to.query,
hash: to.hash,
params: newTargetLocation.path != null ? {} : to.params
}, newTargetLocation);
}
}
function pushWithRedirect(to, redirectedFrom) {
const targetLocation = pendingLocation = resolve(to);
const from = currentRoute.value;
const data = to.state;
const force = to.force;
const replace = to.replace === true;
const shouldRedirect = handleRedirectRecord(targetLocation, from);
if (shouldRedirect) return pushWithRedirect(assign(locationAsObject(shouldRedirect), {
state: typeof shouldRedirect === "object" ? assign({}, data, shouldRedirect.state) : data,
force,
replace
}), redirectedFrom || targetLocation);
const toLocation = targetLocation;
toLocation.redirectedFrom = redirectedFrom;
let failure;
if (!force && isSameRouteLocation(stringifyQuery$1, from, targetLocation)) {
failure = createRouterError(ErrorTypes.NAVIGATION_DUPLICATED, {
to: toLocation,
from
});
handleScroll(from, from, true, false);
}
return (failure ? Promise.resolve(failure) : navigate(toLocation, from)).catch((error) => isNavigationFailure(error) ? isNavigationFailure(error, ErrorTypes.NAVIGATION_GUARD_REDIRECT) ? error : markAsReady(error) : triggerError(error, toLocation, from)).then((failure) => {
if (failure) {
if (isNavigationFailure(failure, ErrorTypes.NAVIGATION_GUARD_REDIRECT)) {
if (isSameRouteLocation(stringifyQuery$1, resolve(failure.to), toLocation) && redirectedFrom && (redirectedFrom._count = redirectedFrom._count ? redirectedFrom._count + 1 : 1) > 30) {
warn(`Detected a possibly infinite redirection in a navigation guard when going from "${from.fullPath}" to "${toLocation.fullPath}". Aborting to avoid a Stack Overflow.\n Are you always returning a new location within a navigation guard? That would lead to this error. Only return when redirecting or aborting, that should fix this. This might break in production if not fixed.`);
return Promise.reject(/* @__PURE__ */ new Error("Infinite redirect in navigation guard"));
}
return pushWithRedirect(assign({ replace }, locationAsObject(failure.to), {
state: typeof failure.to === "object" ? assign({}, data, failure.to.state) : data,
force
}), redirectedFrom || toLocation);
}
} else failure = finalizeNavigation(toLocation, from, true, replace, data);
triggerAfterEach(toLocation, from, failure);
return failure;
});
}
/**
* Helper to reject and skip all navigation guards if a new navigation happened
* @param to
* @param from
*/
function checkCanceledNavigationAndReject(to, from) {
const error = checkCanceledNavigation(to, from);
return error ? Promise.reject(error) : Promise.resolve();
}
function runWithContext(fn) {
const app = installedApps.values().next().value;
return app && typeof app.runWithContext === "function" ? app.runWithContext(fn) : fn();
}
function navigate(to, from) {
let guards;
const [leavingRecords, updatingRecords, enteringRecords] = extractChangingRecords(to, from);
guards = extractComponentsGuards(leavingRecords.reverse(), "beforeRouteLeave", to, from);
for (const record of leavingRecords) record.leaveGuards.forEach((guard) => {
guards.push(guardToPromiseFn(guard, to, from));
});
const canceledNavigationCheck = checkCanceledNavigationAndReject.bind(null, to, from);
guards.push(canceledNavigationCheck);
return runGuardQueue(guards).then(() => {
guards = [];
for (const guard of beforeGuards.list()) guards.push(guardToPromiseFn(guard, to, from));
guards.push(canceledNavigationCheck);
return runGuardQueue(guards);
}).then(() => {
guards = extractComponentsGuards(updatingRecords, "beforeRouteUpdate", to, from);
for (const record of updatingRecords) record.updateGuards.forEach((guard) => {
guards.push(guardToPromiseFn(guard, to, from));
});
guards.push(canceledNavigationCheck);
return runGuardQueue(guards);
}).then(() => {
guards = [];
for (const record of enteringRecords) if (record.beforeEnter) if (isArray(record.beforeEnter)) for (const beforeEnter of record.beforeEnter) guards.push(guardToPromiseFn(beforeEnter, to, from));
else guards.push(guardToPromiseFn(record.beforeEnter, to, from));
guards.push(canceledNavigationCheck);
return runGuardQueue(guards);
}).then(() => {
to.matched.forEach((record) => record.enterCallbacks = {});
guards = extractComponentsGuards(enteringRecords, "beforeRouteEnter", to, from, runWithContext);
guards.push(canceledNavigationCheck);
return runGuardQueue(guards);
}).then(() => {
guards = [];
for (const guard of beforeResolveGuards.list()) guards.push(guardToPromiseFn(guard, to, from));
guards.push(canceledNavigationCheck);
return runGuardQueue(guards);
}).catch((err) => isNavigationFailure(err, ErrorTypes.NAVIGATION_CANCELLED) ? err : Promise.reject(err));
}
function triggerAfterEach(to, from, failure) {
afterGuards.list().forEach((guard) => runWithContext(() => guard(to, from, failure)));
}
/**
* - Cleans up any navigation guards
* - Changes the url if necessary
* - Calls the scrollBehavior
*/
function finalizeNavigation(toLocation, from, isPush, replace, data) {
const error = checkCanceledNavigation(toLocation, from);
if (error) return error;
const isFirstNavigation = from === START_LOCATION_NORMALIZED;
const state = !isBrowser ? {} : history.state;
if (isPush) if (replace || isFirstNavigation) routerHistory.replace(toLocation.fullPath, assign({ scroll: isFirstNavigation && state && state.scroll }, data));
else routerHistory.push(toLocation.fullPath, data);
currentRoute.value = toLocation;
handleScroll(toLocation, from, isPush, isFirstNavigation);
markAsReady();
}
let removeHistoryListener;
function setupListeners() {
if (removeHistoryListener) return;
removeHistoryListener = routerHistory.listen((to, _from, info) => {
if (!router.listening) return;
const toLocation = resolve(to);
const shouldRedirect = handleRedirectRecord(toLocation, router.currentRoute.value);
if (shouldRedirect) {
pushWithRedirect(assign(shouldRedirect, {
replace: true,
force: true
}), toLocation).catch(noop);
return;
}
pendingLocation = toLocation;
const from = currentRoute.value;
if (isBrowser) saveScrollPosition(getScrollKey(from.fullPath, info.delta), computeScrollPosition());
navigate(toLocation, from).catch((error) => {
if (isNavigationFailure(error, ErrorTypes.NAVIGATION_ABORTED | ErrorTypes.NAVIGATION_CANCELLED)) return error;
if (isNavigationFailure(error, ErrorTypes.NAVIGATION_GUARD_REDIRECT)) {
pushWithRedirect(assign(locationAsObject(error.to), { force: true }), toLocation).then((failure) => {
if (isNavigationFailure(failure, ErrorTypes.NAVIGATION_ABORTED | ErrorTypes.NAVIGATION_DUPLICATED) && !info.delta && info.type === NavigationType.pop) routerHistory.go(-1, false);
}).catch(noop);
return Promise.reject();
}
if (info.delta) routerHistory.go(-info.delta, false);
return triggerError(error, toLocation, from);
}).then((failure) => {
failure = failure || finalizeNavigation(toLocation, from, false);
if (failure) {
if (info.delta && !isNavigationFailure(failure, ErrorTypes.NAVIGATION_CANCELLED)) routerHistory.go(-info.delta, false);
else if (info.type === NavigationType.pop && isNavigationFailure(failure, ErrorTypes.NAVIGATION_ABORTED | ErrorTypes.NAVIGATION_DUPLICATED)) routerHistory.go(-1, false);
}
triggerAfterEach(toLocation, from, failure);
}).catch(noop);
});
}
let readyHandlers = useCallbacks();
let errorListeners = useCallbacks();
let ready;
/**
* Trigger errorListeners added via onError and throws the error as well
*
* @param error - error to throw
* @param to - location we were navigating to when the error happened
* @param from - location we were navigating from when the error happened
* @returns the error as a rejected promise
*/
function triggerError(error, to, from) {
markAsReady(error);
const list = errorListeners.list();
if (list.length) list.forEach((handler) => handler(error, to, from));
else {
warn("uncaught error during route navigation:");
console.error(error);
}
return Promise.reject(error);
}
function isReady() {
if (ready && currentRoute.value !== START_LOCATION_NORMALIZED) return Promise.resolve();
return new Promise((resolve, reject) => {
readyHandlers.add([resolve, reject]);
});
}
function markAsReady(err) {
if (!ready) {
ready = !err;
setupListeners();
readyHandlers.list().forEach(([resolve, reject]) => err ? reject(err) : resolve());
readyHandlers.reset();
}
return err;
}
function handleScroll(to, from, isPush, isFirstNavigation) {
const { scrollBehavior } = options;
if (!isBrowser || !scrollBehavior) return Promise.resolve();
const scrollPosition = !isPush && getSavedScrollPosition(getScrollKey(to.fullPath, 0)) || (isFirstNavigation || !isPush) && history.state && history.state.scroll || null;
return nextTick().then(() => scrollBehavior(to, from, scrollPosition)).then((position) => position && scrollToPosition(position)).catch((err) => triggerError(err, to, from));
}
const go = (delta) => routerHistory.go(delta);
let started;
const installedApps = /* @__PURE__ */ new Set();
const router = {
currentRoute,
listening: true,
addRoute,
removeRoute,
clearRoutes: matcher.clearRoutes,
hasRoute,
getRoutes,
resolve,
options,
push,
replace,
go,
back: () => go(-1),
forward: () => go(1),
beforeEach: beforeGuards.add,
beforeResolve: beforeResolveGuards.add,
afterEach: afterGuards.add,
onError: errorListeners.add,
isReady,
install(app) {
app.component("RouterLink", RouterLink);
app.component("RouterView", RouterView);
app.config.globalProperties.$router = router;
Object.defineProperty(app.config.globalProperties, "$route", {
enumerable: true,
get: () => unref(currentRoute)
});
if (isBrowser && !started && currentRoute.value === START_LOCATION_NORMALIZED) {
started = true;
push(routerHistory.location).catch((err) => {
warn("Unexpected error when starting the router:", err);
});
}
const reactiveRoute = {};
for (const key in START_LOCATION_NORMALIZED) Object.defineProperty(reactiveRoute, key, {
get: () => currentRoute.value[key],
enumerable: true
});
app.provide(routerKey, router);
app.provide(routeLocationKey, shallowReactive(reactiveRoute));
app.provide(routerViewLocationKey, currentRoute);
const unmountApp = app.unmount;
installedApps.add(app);
app.unmount = function() {
installedApps.delete(app);
if (installedApps.size < 1) {
pendingLocation = START_LOCATION_NORMALIZED;
removeHistoryListener && removeHistoryListener();
removeHistoryListener = null;
currentRoute.value = START_LOCATION_NORMALIZED;
started = false;
ready = false;
}
unmountApp();
};
if (isBrowser && true) addDevtools(app, router, matcher);
}
};
function runGuardQueue(guards) {
return guards.reduce((promise, guard) => promise.then(() => runWithContext(guard)), Promise.resolve());
}
return router;
}
//#endregion
//#region src/useApi.ts
/**
* Returns the router instance. Equivalent to using `$router` inside
* templates.
*/
function useRouter() {
return inject(routerKey);
}
/**
* Returns the current route location. Equivalent to using `$route` inside
* templates.
*/
function useRoute(_name) {
return inject(routeLocationKey);
}
//#endregion
export { NavigationFailureType, RouterLink, RouterView, START_LOCATION_NORMALIZED as START_LOCATION, createMemoryHistory, createRouter, createRouterMatcher, createWebHashHistory, createWebHistory, isNavigationFailure, loadRouteLocation, matchedRouteKey, onBeforeRouteLeave, onBeforeRouteUpdate, parseQuery, routeLocationKey, routerKey, routerViewLocationKey, stringifyQuery, useLink, useRoute, useRouter, viewDepthKey };