Forked from hermes-frontend, stripped openclaw/bun specifics: - Auth tokens: openclaw_session -> nyx_session - Vite proxy: localhost:3003 -> localhost:8000 (assay) - Prod WS: wss://assay.loop42.de/ws - Workspace paths: removed openclaw-specific paths - Added missing deps: @heroicons/vue, overlayscrollbars-vue - Branding: title -> nyx Co-Authored-By: Claude Opus 4.6 (1M context) <noreply@anthropic.com>
2789 lines
103 KiB
JavaScript
2789 lines
103 KiB
JavaScript
/*!
|
|
* vue-router v5.0.3
|
|
* (c) 2026 Eduardo San Martin Morote
|
|
* @license MIT
|
|
*/
|
|
let vue = require("vue");
|
|
let _vue_devtools_api = require("@vue/devtools-api");
|
|
|
|
//#region src/utils/env.ts
|
|
const isBrowser = typeof document !== "undefined";
|
|
|
|
//#endregion
|
|
//#region src/utils/index.ts
|
|
/**
|
|
* Allows differentiating lazy components from functional components and vue-class-component
|
|
* @internal
|
|
*
|
|
* @param component
|
|
*/
|
|
function isRouteComponent(component) {
|
|
return typeof component === "object" || "displayName" in component || "props" in component || "__vccOpts" in component;
|
|
}
|
|
function isESModule(obj) {
|
|
return obj.__esModule || obj[Symbol.toStringTag] === "Module" || obj.default && isRouteComponent(obj.default);
|
|
}
|
|
const assign = Object.assign;
|
|
function applyToParams(fn, params) {
|
|
const newParams = {};
|
|
for (const key in params) {
|
|
const value = params[key];
|
|
newParams[key] = isArray(value) ? value.map(fn) : fn(value);
|
|
}
|
|
return newParams;
|
|
}
|
|
const noop = () => {};
|
|
/**
|
|
* Typesafe alternative to Array.isArray
|
|
* https://github.com/microsoft/TypeScript/pull/48228
|
|
*
|
|
* @internal
|
|
*/
|
|
const isArray = Array.isArray;
|
|
function mergeOptions(defaults, partialOptions) {
|
|
const options = {};
|
|
for (const key in defaults) options[key] = key in partialOptions ? partialOptions[key] : defaults[key];
|
|
return options;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/warning.ts
|
|
function warn(msg) {
|
|
const args = Array.from(arguments).slice(1);
|
|
console.warn.apply(console, ["[Vue Router warn]: " + msg].concat(args));
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/encoding.ts
|
|
/**
|
|
* Encoding Rules (␣ = Space)
|
|
* - Path: ␣ " < > # ? { }
|
|
* - Query: ␣ " < > # & =
|
|
* - Hash: ␣ " < > `
|
|
*
|
|
* On top of that, the RFC3986 (https://tools.ietf.org/html/rfc3986#section-2.2)
|
|
* defines some extra characters to be encoded. Most browsers do not encode them
|
|
* in encodeURI https://github.com/whatwg/url/issues/369, so it may be safer to
|
|
* also encode `!'()*`. Leaving un-encoded only ASCII alphanumeric(`a-zA-Z0-9`)
|
|
* plus `-._~`. This extra safety should be applied to query by patching the
|
|
* string returned by encodeURIComponent encodeURI also encodes `[\]^`. `\`
|
|
* should be encoded to avoid ambiguity. Browsers (IE, FF, C) transform a `\`
|
|
* into a `/` if directly typed in. The _backtick_ (`````) should also be
|
|
* encoded everywhere because some browsers like FF encode it when directly
|
|
* written while others don't. Safari and IE don't encode ``"<>{}``` in hash.
|
|
*/
|
|
const HASH_RE = /#/g;
|
|
const AMPERSAND_RE = /&/g;
|
|
const SLASH_RE = /\//g;
|
|
const EQUAL_RE = /=/g;
|
|
const IM_RE = /\?/g;
|
|
const PLUS_RE = /\+/g;
|
|
/**
|
|
* NOTE: It's not clear to me if we should encode the + symbol in queries, it
|
|
* seems to be less flexible than not doing so and I can't find out the legacy
|
|
* systems requiring this for regular requests like text/html. In the standard,
|
|
* the encoding of the plus character is only mentioned for
|
|
* application/x-www-form-urlencoded
|
|
* (https://url.spec.whatwg.org/#urlencoded-parsing) and most browsers seems lo
|
|
* leave the plus character as is in queries. To be more flexible, we allow the
|
|
* plus character on the query, but it can also be manually encoded by the user.
|
|
*
|
|
* Resources:
|
|
* - https://url.spec.whatwg.org/#urlencoded-parsing
|
|
* - https://stackoverflow.com/questions/1634271/url-encoding-the-space-character-or-20
|
|
*/
|
|
const ENC_BRACKET_OPEN_RE = /%5B/g;
|
|
const ENC_BRACKET_CLOSE_RE = /%5D/g;
|
|
const ENC_CARET_RE = /%5E/g;
|
|
const ENC_BACKTICK_RE = /%60/g;
|
|
const ENC_CURLY_OPEN_RE = /%7B/g;
|
|
const ENC_PIPE_RE = /%7C/g;
|
|
const ENC_CURLY_CLOSE_RE = /%7D/g;
|
|
const ENC_SPACE_RE = /%20/g;
|
|
/**
|
|
* Encode characters that need to be encoded on the path, search and hash
|
|
* sections of the URL.
|
|
*
|
|
* @internal
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function commonEncode(text) {
|
|
return text == null ? "" : encodeURI("" + text).replace(ENC_PIPE_RE, "|").replace(ENC_BRACKET_OPEN_RE, "[").replace(ENC_BRACKET_CLOSE_RE, "]");
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded on the hash section of the URL.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodeHash(text) {
|
|
return commonEncode(text).replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded query values on the query
|
|
* section of the URL.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodeQueryValue(text) {
|
|
return commonEncode(text).replace(PLUS_RE, "%2B").replace(ENC_SPACE_RE, "+").replace(HASH_RE, "%23").replace(AMPERSAND_RE, "%26").replace(ENC_BACKTICK_RE, "`").replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
|
|
}
|
|
/**
|
|
* Like `encodeQueryValue` but also encodes the `=` character.
|
|
*
|
|
* @param text - string to encode
|
|
*/
|
|
function encodeQueryKey(text) {
|
|
return encodeQueryValue(text).replace(EQUAL_RE, "%3D");
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded on the path section of the URL.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodePath(text) {
|
|
return commonEncode(text).replace(HASH_RE, "%23").replace(IM_RE, "%3F");
|
|
}
|
|
/**
|
|
* Encode characters that need to be encoded on the path section of the URL as a
|
|
* param. This function encodes everything {@link encodePath} does plus the
|
|
* slash (`/`) character. If `text` is `null` or `undefined`, returns an empty
|
|
* string instead.
|
|
*
|
|
* @param text - string to encode
|
|
* @returns encoded string
|
|
*/
|
|
function encodeParam(text) {
|
|
return encodePath(text).replace(SLASH_RE, "%2F");
|
|
}
|
|
function decode(text) {
|
|
if (text == null) return null;
|
|
try {
|
|
return decodeURIComponent("" + text);
|
|
} catch (err) {
|
|
process.env.NODE_ENV !== "production" && warn(`Error decoding "${text}". Using original value`);
|
|
}
|
|
return "" + text;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/location.ts
|
|
const TRAILING_SLASH_RE = /\/$/;
|
|
const removeTrailingSlash = (path) => path.replace(TRAILING_SLASH_RE, "");
|
|
/**
|
|
* Transforms a URI into a normalized history location
|
|
*
|
|
* @param parseQuery
|
|
* @param location - URI to normalize
|
|
* @param currentLocation - current absolute location. Allows resolving relative
|
|
* paths. Must start with `/`. Defaults to `/`
|
|
* @returns a normalized history location
|
|
*/
|
|
function parseURL(parseQuery, location, currentLocation = "/") {
|
|
let path, query = {}, searchString = "", hash = "";
|
|
const hashPos = location.indexOf("#");
|
|
let searchPos = location.indexOf("?");
|
|
searchPos = hashPos >= 0 && searchPos > hashPos ? -1 : searchPos;
|
|
if (searchPos >= 0) {
|
|
path = location.slice(0, searchPos);
|
|
searchString = location.slice(searchPos, hashPos > 0 ? hashPos : location.length);
|
|
query = parseQuery(searchString.slice(1));
|
|
}
|
|
if (hashPos >= 0) {
|
|
path = path || location.slice(0, hashPos);
|
|
hash = location.slice(hashPos, location.length);
|
|
}
|
|
path = resolveRelativePath(path != null ? path : location, currentLocation);
|
|
return {
|
|
fullPath: path + searchString + hash,
|
|
path,
|
|
query,
|
|
hash: decode(hash)
|
|
};
|
|
}
|
|
/**
|
|
* Stringifies a URL object
|
|
*
|
|
* @param stringifyQuery
|
|
* @param location
|
|
*/
|
|
function stringifyURL(stringifyQuery, location) {
|
|
const query = location.query ? stringifyQuery(location.query) : "";
|
|
return location.path + (query && "?") + query + (location.hash || "");
|
|
}
|
|
/**
|
|
* Strips off the base from the beginning of a location.pathname in a non-case-sensitive way.
|
|
*
|
|
* @param pathname - location.pathname
|
|
* @param base - base to strip off
|
|
*/
|
|
function stripBase(pathname, base) {
|
|
if (!base || !pathname.toLowerCase().startsWith(base.toLowerCase())) return pathname;
|
|
return pathname.slice(base.length) || "/";
|
|
}
|
|
/**
|
|
* Checks if two RouteLocation are equal. This means that both locations are
|
|
* pointing towards the same {@link RouteRecord} and that all `params`, `query`
|
|
* parameters and `hash` are the same
|
|
*
|
|
* @param stringifyQuery - A function that takes a query object of type LocationQueryRaw and returns a string representation of it.
|
|
* @param a - first {@link RouteLocation}
|
|
* @param b - second {@link RouteLocation}
|
|
*/
|
|
function isSameRouteLocation(stringifyQuery, a, b) {
|
|
const aLastIndex = a.matched.length - 1;
|
|
const bLastIndex = b.matched.length - 1;
|
|
return aLastIndex > -1 && aLastIndex === bLastIndex && isSameRouteRecord(a.matched[aLastIndex], b.matched[bLastIndex]) && isSameRouteLocationParams(a.params, b.params) && stringifyQuery(a.query) === stringifyQuery(b.query) && a.hash === b.hash;
|
|
}
|
|
/**
|
|
* Check if two `RouteRecords` are equal. Takes into account aliases: they are
|
|
* considered equal to the `RouteRecord` they are aliasing.
|
|
*
|
|
* @param a - first {@link RouteRecord}
|
|
* @param b - second {@link RouteRecord}
|
|
*/
|
|
function isSameRouteRecord(a, b) {
|
|
return (a.aliasOf || a) === (b.aliasOf || b);
|
|
}
|
|
function isSameRouteLocationParams(a, b) {
|
|
if (Object.keys(a).length !== Object.keys(b).length) return false;
|
|
for (var key in a) if (!isSameRouteLocationParamsValue(a[key], b[key])) return false;
|
|
return true;
|
|
}
|
|
function isSameRouteLocationParamsValue(a, b) {
|
|
return isArray(a) ? isEquivalentArray(a, b) : isArray(b) ? isEquivalentArray(b, a) : (a && a.valueOf()) === (b && b.valueOf());
|
|
}
|
|
/**
|
|
* Check if two arrays are the same or if an array with one single entry is the
|
|
* same as another primitive value. Used to check query and parameters
|
|
*
|
|
* @param a - array of values
|
|
* @param b - array of values or a single value
|
|
*/
|
|
function isEquivalentArray(a, b) {
|
|
return isArray(b) ? a.length === b.length && a.every((value, i) => value === b[i]) : a.length === 1 && a[0] === b;
|
|
}
|
|
/**
|
|
* Resolves a relative path that starts with `.`.
|
|
*
|
|
* @param to - path location we are resolving
|
|
* @param from - currentLocation.path, should start with `/`
|
|
*/
|
|
function resolveRelativePath(to, from) {
|
|
if (to.startsWith("/")) return to;
|
|
if (process.env.NODE_ENV !== "production" && !from.startsWith("/")) {
|
|
warn(`Cannot resolve a relative location without an absolute path. Trying to resolve "${to}" from "${from}". It should look like "/${from}".`);
|
|
return to;
|
|
}
|
|
if (!to) return from;
|
|
const fromSegments = from.split("/");
|
|
const toSegments = to.split("/");
|
|
const lastToSegment = toSegments[toSegments.length - 1];
|
|
if (lastToSegment === ".." || lastToSegment === ".") toSegments.push("");
|
|
let position = fromSegments.length - 1;
|
|
let toPosition;
|
|
let segment;
|
|
for (toPosition = 0; toPosition < toSegments.length; toPosition++) {
|
|
segment = toSegments[toPosition];
|
|
if (segment === ".") continue;
|
|
if (segment === "..") {
|
|
if (position > 1) position--;
|
|
} else break;
|
|
}
|
|
return fromSegments.slice(0, position).join("/") + "/" + toSegments.slice(toPosition).join("/");
|
|
}
|
|
/**
|
|
* Initial route location where the router is. Can be used in navigation guards
|
|
* to differentiate the initial navigation.
|
|
*
|
|
* @example
|
|
* ```js
|
|
* import { START_LOCATION } from 'vue-router'
|
|
*
|
|
* router.beforeEach((to, from) => {
|
|
* if (from === START_LOCATION) {
|
|
* // initial navigation
|
|
* }
|
|
* })
|
|
* ```
|
|
*/
|
|
const START_LOCATION_NORMALIZED = {
|
|
path: "/",
|
|
name: void 0,
|
|
params: {},
|
|
query: {},
|
|
hash: "",
|
|
fullPath: "/",
|
|
matched: [],
|
|
meta: {},
|
|
redirectedFrom: void 0
|
|
};
|
|
|
|
//#endregion
|
|
//#region src/history/common.ts
|
|
let NavigationType = /* @__PURE__ */ function(NavigationType) {
|
|
NavigationType["pop"] = "pop";
|
|
NavigationType["push"] = "push";
|
|
return NavigationType;
|
|
}({});
|
|
let NavigationDirection = /* @__PURE__ */ function(NavigationDirection) {
|
|
NavigationDirection["back"] = "back";
|
|
NavigationDirection["forward"] = "forward";
|
|
NavigationDirection["unknown"] = "";
|
|
return NavigationDirection;
|
|
}({});
|
|
/**
|
|
* Starting location for Histories
|
|
*/
|
|
const START = "";
|
|
/**
|
|
* Normalizes a base by removing any trailing slash and reading the base tag if
|
|
* present.
|
|
*
|
|
* @param base - base to normalize
|
|
*/
|
|
function normalizeBase(base) {
|
|
if (!base) if (isBrowser) {
|
|
const baseEl = document.querySelector("base");
|
|
base = baseEl && baseEl.getAttribute("href") || "/";
|
|
base = base.replace(/^\w+:\/\/[^\/]+/, "");
|
|
} else base = "/";
|
|
if (base[0] !== "/" && base[0] !== "#") base = "/" + base;
|
|
return removeTrailingSlash(base);
|
|
}
|
|
const BEFORE_HASH_RE = /^[^#]+#/;
|
|
function createHref(base, location) {
|
|
return base.replace(BEFORE_HASH_RE, "#") + location;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/scrollBehavior.ts
|
|
function getElementPosition(el, offset) {
|
|
const docRect = document.documentElement.getBoundingClientRect();
|
|
const elRect = el.getBoundingClientRect();
|
|
return {
|
|
behavior: offset.behavior,
|
|
left: elRect.left - docRect.left - (offset.left || 0),
|
|
top: elRect.top - docRect.top - (offset.top || 0)
|
|
};
|
|
}
|
|
const computeScrollPosition = () => ({
|
|
left: window.scrollX,
|
|
top: window.scrollY
|
|
});
|
|
function scrollToPosition(position) {
|
|
let scrollToOptions;
|
|
if ("el" in position) {
|
|
const positionEl = position.el;
|
|
const isIdSelector = typeof positionEl === "string" && positionEl.startsWith("#");
|
|
/**
|
|
* `id`s can accept pretty much any characters, including CSS combinators
|
|
* like `>` or `~`. It's still possible to retrieve elements using
|
|
* `document.getElementById('~')` but it needs to be escaped when using
|
|
* `document.querySelector('#\\~')` for it to be valid. The only
|
|
* requirements for `id`s are them to be unique on the page and to not be
|
|
* empty (`id=""`). Because of that, when passing an id selector, it should
|
|
* be properly escaped for it to work with `querySelector`. We could check
|
|
* for the id selector to be simple (no CSS combinators `+ >~`) but that
|
|
* would make things inconsistent since they are valid characters for an
|
|
* `id` but would need to be escaped when using `querySelector`, breaking
|
|
* their usage and ending up in no selector returned. Selectors need to be
|
|
* escaped:
|
|
*
|
|
* - `#1-thing` becomes `#\31 -thing`
|
|
* - `#with~symbols` becomes `#with\\~symbols`
|
|
*
|
|
* - More information about the topic can be found at
|
|
* https://mathiasbynens.be/notes/html5-id-class.
|
|
* - Practical example: https://mathiasbynens.be/demo/html5-id
|
|
*/
|
|
if (process.env.NODE_ENV !== "production" && typeof position.el === "string") {
|
|
if (!isIdSelector || !document.getElementById(position.el.slice(1))) try {
|
|
const foundEl = document.querySelector(position.el);
|
|
if (isIdSelector && foundEl) {
|
|
warn(`The selector "${position.el}" should be passed as "el: document.querySelector('${position.el}')" because it starts with "#".`);
|
|
return;
|
|
}
|
|
} catch (err) {
|
|
warn(`The selector "${position.el}" is invalid. If you are using an id selector, make sure to escape it. You can find more information about escaping characters in selectors at https://mathiasbynens.be/notes/css-escapes or use CSS.escape (https://developer.mozilla.org/en-US/docs/Web/API/CSS/escape).`);
|
|
return;
|
|
}
|
|
}
|
|
const el = typeof positionEl === "string" ? isIdSelector ? document.getElementById(positionEl.slice(1)) : document.querySelector(positionEl) : positionEl;
|
|
if (!el) {
|
|
process.env.NODE_ENV !== "production" && warn(`Couldn't find element using selector "${position.el}" returned by scrollBehavior.`);
|
|
return;
|
|
}
|
|
scrollToOptions = getElementPosition(el, position);
|
|
} else scrollToOptions = position;
|
|
if ("scrollBehavior" in document.documentElement.style) window.scrollTo(scrollToOptions);
|
|
else window.scrollTo(scrollToOptions.left != null ? scrollToOptions.left : window.scrollX, scrollToOptions.top != null ? scrollToOptions.top : window.scrollY);
|
|
}
|
|
function getScrollKey(path, delta) {
|
|
return (history.state ? history.state.position - delta : -1) + path;
|
|
}
|
|
const scrollPositions = /* @__PURE__ */ new Map();
|
|
function saveScrollPosition(key, scrollPosition) {
|
|
scrollPositions.set(key, scrollPosition);
|
|
}
|
|
function getSavedScrollPosition(key) {
|
|
const scroll = scrollPositions.get(key);
|
|
scrollPositions.delete(key);
|
|
return scroll;
|
|
}
|
|
/**
|
|
* ScrollBehavior instance used by the router to compute and restore the scroll
|
|
* position when navigating.
|
|
*/
|
|
|
|
//#endregion
|
|
//#region src/history/html5.ts
|
|
let createBaseLocation = () => location.protocol + "//" + location.host;
|
|
/**
|
|
* Creates a normalized history location from a window.location object
|
|
* @param base - The base path
|
|
* @param location - The window.location object
|
|
*/
|
|
function createCurrentLocation(base, location) {
|
|
const { pathname, search, hash } = location;
|
|
const hashPos = base.indexOf("#");
|
|
if (hashPos > -1) {
|
|
let slicePos = hash.includes(base.slice(hashPos)) ? base.slice(hashPos).length : 1;
|
|
let pathFromHash = hash.slice(slicePos);
|
|
if (pathFromHash[0] !== "/") pathFromHash = "/" + pathFromHash;
|
|
return stripBase(pathFromHash, "");
|
|
}
|
|
return stripBase(pathname, base) + search + hash;
|
|
}
|
|
function useHistoryListeners(base, historyState, currentLocation, replace) {
|
|
let listeners = [];
|
|
let teardowns = [];
|
|
let pauseState = null;
|
|
const popStateHandler = ({ state }) => {
|
|
const to = createCurrentLocation(base, location);
|
|
const from = currentLocation.value;
|
|
const fromState = historyState.value;
|
|
let delta = 0;
|
|
if (state) {
|
|
currentLocation.value = to;
|
|
historyState.value = state;
|
|
if (pauseState && pauseState === from) {
|
|
pauseState = null;
|
|
return;
|
|
}
|
|
delta = fromState ? state.position - fromState.position : 0;
|
|
} else replace(to);
|
|
listeners.forEach((listener) => {
|
|
listener(currentLocation.value, from, {
|
|
delta,
|
|
type: NavigationType.pop,
|
|
direction: delta ? delta > 0 ? NavigationDirection.forward : NavigationDirection.back : NavigationDirection.unknown
|
|
});
|
|
});
|
|
};
|
|
function pauseListeners() {
|
|
pauseState = currentLocation.value;
|
|
}
|
|
function listen(callback) {
|
|
listeners.push(callback);
|
|
const teardown = () => {
|
|
const index = listeners.indexOf(callback);
|
|
if (index > -1) listeners.splice(index, 1);
|
|
};
|
|
teardowns.push(teardown);
|
|
return teardown;
|
|
}
|
|
function beforeUnloadListener() {
|
|
if (document.visibilityState === "hidden") {
|
|
const { history } = window;
|
|
if (!history.state) return;
|
|
history.replaceState(assign({}, history.state, { scroll: computeScrollPosition() }), "");
|
|
}
|
|
}
|
|
function destroy() {
|
|
for (const teardown of teardowns) teardown();
|
|
teardowns = [];
|
|
window.removeEventListener("popstate", popStateHandler);
|
|
window.removeEventListener("pagehide", beforeUnloadListener);
|
|
document.removeEventListener("visibilitychange", beforeUnloadListener);
|
|
}
|
|
window.addEventListener("popstate", popStateHandler);
|
|
window.addEventListener("pagehide", beforeUnloadListener);
|
|
document.addEventListener("visibilitychange", beforeUnloadListener);
|
|
return {
|
|
pauseListeners,
|
|
listen,
|
|
destroy
|
|
};
|
|
}
|
|
/**
|
|
* Creates a state object
|
|
*/
|
|
function buildState(back, current, forward, replaced = false, computeScroll = false) {
|
|
return {
|
|
back,
|
|
current,
|
|
forward,
|
|
replaced,
|
|
position: window.history.length,
|
|
scroll: computeScroll ? computeScrollPosition() : null
|
|
};
|
|
}
|
|
function useHistoryStateNavigation(base) {
|
|
const { history, location } = window;
|
|
const currentLocation = { value: createCurrentLocation(base, location) };
|
|
const historyState = { value: history.state };
|
|
if (!historyState.value) changeLocation(currentLocation.value, {
|
|
back: null,
|
|
current: currentLocation.value,
|
|
forward: null,
|
|
position: history.length - 1,
|
|
replaced: true,
|
|
scroll: null
|
|
}, true);
|
|
function changeLocation(to, state, replace) {
|
|
/**
|
|
* if a base tag is provided, and we are on a normal domain, we have to
|
|
* respect the provided `base` attribute because pushState() will use it and
|
|
* potentially erase anything before the `#` like at
|
|
* https://github.com/vuejs/router/issues/685 where a base of
|
|
* `/folder/#` but a base of `/` would erase the `/folder/` section. If
|
|
* there is no host, the `<base>` tag makes no sense and if there isn't a
|
|
* base tag we can just use everything after the `#`.
|
|
*/
|
|
const hashIndex = base.indexOf("#");
|
|
const url = hashIndex > -1 ? (location.host && document.querySelector("base") ? base : base.slice(hashIndex)) + to : createBaseLocation() + base + to;
|
|
try {
|
|
history[replace ? "replaceState" : "pushState"](state, "", url);
|
|
historyState.value = state;
|
|
} catch (err) {
|
|
if (process.env.NODE_ENV !== "production") warn("Error with push/replace State", err);
|
|
else console.error(err);
|
|
location[replace ? "replace" : "assign"](url);
|
|
}
|
|
}
|
|
function replace(to, data) {
|
|
changeLocation(to, assign({}, history.state, buildState(historyState.value.back, to, historyState.value.forward, true), data, { position: historyState.value.position }), true);
|
|
currentLocation.value = to;
|
|
}
|
|
function push(to, data) {
|
|
const currentState = assign({}, historyState.value, history.state, {
|
|
forward: to,
|
|
scroll: computeScrollPosition()
|
|
});
|
|
if (process.env.NODE_ENV !== "production" && !history.state) warn("history.state seems to have been manually replaced without preserving the necessary values. Make sure to preserve existing history state if you are manually calling history.replaceState:\n\nhistory.replaceState(history.state, '', url)\n\nYou can find more information at https://router.vuejs.org/guide/migration/#Usage-of-history-state");
|
|
changeLocation(currentState.current, currentState, true);
|
|
changeLocation(to, assign({}, buildState(currentLocation.value, to, null), { position: currentState.position + 1 }, data), false);
|
|
currentLocation.value = to;
|
|
}
|
|
return {
|
|
location: currentLocation,
|
|
state: historyState,
|
|
push,
|
|
replace
|
|
};
|
|
}
|
|
/**
|
|
* Creates an HTML5 history. Most common history for single page applications.
|
|
*
|
|
* @param base -
|
|
*/
|
|
function createWebHistory(base) {
|
|
base = normalizeBase(base);
|
|
const historyNavigation = useHistoryStateNavigation(base);
|
|
const historyListeners = useHistoryListeners(base, historyNavigation.state, historyNavigation.location, historyNavigation.replace);
|
|
function go(delta, triggerListeners = true) {
|
|
if (!triggerListeners) historyListeners.pauseListeners();
|
|
history.go(delta);
|
|
}
|
|
const routerHistory = assign({
|
|
location: "",
|
|
base,
|
|
go,
|
|
createHref: createHref.bind(null, base)
|
|
}, historyNavigation, historyListeners);
|
|
Object.defineProperty(routerHistory, "location", {
|
|
enumerable: true,
|
|
get: () => historyNavigation.location.value
|
|
});
|
|
Object.defineProperty(routerHistory, "state", {
|
|
enumerable: true,
|
|
get: () => historyNavigation.state.value
|
|
});
|
|
return routerHistory;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/history/memory.ts
|
|
/**
|
|
* Creates an in-memory based history. The main purpose of this history is to handle SSR. It starts in a special location that is nowhere.
|
|
* It's up to the user to replace that location with the starter location by either calling `router.push` or `router.replace`.
|
|
*
|
|
* @param base - Base applied to all urls, defaults to '/'
|
|
* @returns a history object that can be passed to the router constructor
|
|
*/
|
|
function createMemoryHistory(base = "") {
|
|
let listeners = [];
|
|
let queue = [[START, {}]];
|
|
let position = 0;
|
|
base = normalizeBase(base);
|
|
function setLocation(location, state = {}) {
|
|
position++;
|
|
if (position !== queue.length) queue.splice(position);
|
|
queue.push([location, state]);
|
|
}
|
|
function triggerListeners(to, from, { direction, delta }) {
|
|
const info = {
|
|
direction,
|
|
delta,
|
|
type: NavigationType.pop
|
|
};
|
|
for (const callback of listeners) callback(to, from, info);
|
|
}
|
|
const routerHistory = {
|
|
location: START,
|
|
state: {},
|
|
base,
|
|
createHref: createHref.bind(null, base),
|
|
replace(to, state) {
|
|
queue.splice(position--, 1);
|
|
setLocation(to, state);
|
|
},
|
|
push(to, state) {
|
|
setLocation(to, state);
|
|
},
|
|
listen(callback) {
|
|
listeners.push(callback);
|
|
return () => {
|
|
const index = listeners.indexOf(callback);
|
|
if (index > -1) listeners.splice(index, 1);
|
|
};
|
|
},
|
|
destroy() {
|
|
listeners = [];
|
|
queue = [[START, {}]];
|
|
position = 0;
|
|
},
|
|
go(delta, shouldTrigger = true) {
|
|
const from = this.location;
|
|
const direction = delta < 0 ? NavigationDirection.back : NavigationDirection.forward;
|
|
position = Math.max(0, Math.min(position + delta, queue.length - 1));
|
|
if (shouldTrigger) triggerListeners(this.location, from, {
|
|
direction,
|
|
delta
|
|
});
|
|
}
|
|
};
|
|
Object.defineProperty(routerHistory, "location", {
|
|
enumerable: true,
|
|
get: () => queue[position][0]
|
|
});
|
|
Object.defineProperty(routerHistory, "state", {
|
|
enumerable: true,
|
|
get: () => queue[position][1]
|
|
});
|
|
return routerHistory;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/history/hash.ts
|
|
/**
|
|
* Creates a hash history. Useful for web applications with no host (e.g. `file://`) or when configuring a server to
|
|
* handle any URL is not possible.
|
|
*
|
|
* @param base - optional base to provide. Defaults to `location.pathname + location.search` If there is a `<base>` tag
|
|
* in the `head`, its value will be ignored in favor of this parameter **but note it affects all the history.pushState()
|
|
* calls**, meaning that if you use a `<base>` tag, it's `href` value **has to match this parameter** (ignoring anything
|
|
* after the `#`).
|
|
*
|
|
* @example
|
|
* ```js
|
|
* // at https://example.com/folder
|
|
* createWebHashHistory() // gives a url of `https://example.com/folder#`
|
|
* createWebHashHistory('/folder/') // gives a url of `https://example.com/folder/#`
|
|
* // if the `#` is provided in the base, it won't be added by `createWebHashHistory`
|
|
* createWebHashHistory('/folder/#/app/') // gives a url of `https://example.com/folder/#/app/`
|
|
* // you should avoid doing this because it changes the original url and breaks copying urls
|
|
* createWebHashHistory('/other-folder/') // gives a url of `https://example.com/other-folder/#`
|
|
*
|
|
* // at file:///usr/etc/folder/index.html
|
|
* // for locations with no `host`, the base is ignored
|
|
* createWebHashHistory('/iAmIgnored') // gives a url of `file:///usr/etc/folder/index.html#`
|
|
* ```
|
|
*/
|
|
function createWebHashHistory(base) {
|
|
base = location.host ? base || location.pathname + location.search : "";
|
|
if (!base.includes("#")) base += "#";
|
|
if (process.env.NODE_ENV !== "production" && !base.endsWith("#/") && !base.endsWith("#")) warn(`A hash base must end with a "#":\n"${base}" should be "${base.replace(/#.*$/, "#")}".`);
|
|
return createWebHistory(base);
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/types/typeGuards.ts
|
|
function isRouteLocation(route) {
|
|
return typeof route === "string" || route && typeof route === "object";
|
|
}
|
|
function isRouteName(name) {
|
|
return typeof name === "string" || typeof name === "symbol";
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/errors.ts
|
|
/**
|
|
* Flags so we can combine them when checking for multiple errors. This is the internal version of
|
|
* {@link NavigationFailureType}.
|
|
*
|
|
* @internal
|
|
*/
|
|
let ErrorTypes = /* @__PURE__ */ function(ErrorTypes) {
|
|
ErrorTypes[ErrorTypes["MATCHER_NOT_FOUND"] = 1] = "MATCHER_NOT_FOUND";
|
|
ErrorTypes[ErrorTypes["NAVIGATION_GUARD_REDIRECT"] = 2] = "NAVIGATION_GUARD_REDIRECT";
|
|
ErrorTypes[ErrorTypes["NAVIGATION_ABORTED"] = 4] = "NAVIGATION_ABORTED";
|
|
ErrorTypes[ErrorTypes["NAVIGATION_CANCELLED"] = 8] = "NAVIGATION_CANCELLED";
|
|
ErrorTypes[ErrorTypes["NAVIGATION_DUPLICATED"] = 16] = "NAVIGATION_DUPLICATED";
|
|
return ErrorTypes;
|
|
}({});
|
|
const NavigationFailureSymbol = Symbol(process.env.NODE_ENV !== "production" ? "navigation failure" : "");
|
|
/**
|
|
* Enumeration with all possible types for navigation failures. Can be passed to
|
|
* {@link isNavigationFailure} to check for specific failures.
|
|
*/
|
|
let NavigationFailureType = /* @__PURE__ */ function(NavigationFailureType) {
|
|
/**
|
|
* An aborted navigation is a navigation that failed because a navigation
|
|
* guard returned `false` or called `next(false)`
|
|
*/
|
|
NavigationFailureType[NavigationFailureType["aborted"] = 4] = "aborted";
|
|
/**
|
|
* A cancelled navigation is a navigation that failed because a more recent
|
|
* navigation finished started (not necessarily finished).
|
|
*/
|
|
NavigationFailureType[NavigationFailureType["cancelled"] = 8] = "cancelled";
|
|
/**
|
|
* A duplicated navigation is a navigation that failed because it was
|
|
* initiated while already being at the exact same location.
|
|
*/
|
|
NavigationFailureType[NavigationFailureType["duplicated"] = 16] = "duplicated";
|
|
return NavigationFailureType;
|
|
}({});
|
|
const ErrorTypeMessages = {
|
|
[ErrorTypes.MATCHER_NOT_FOUND]({ location, currentLocation }) {
|
|
return `No match for\n ${JSON.stringify(location)}${currentLocation ? "\nwhile being at\n" + JSON.stringify(currentLocation) : ""}`;
|
|
},
|
|
[ErrorTypes.NAVIGATION_GUARD_REDIRECT]({ from, to }) {
|
|
return `Redirected from "${from.fullPath}" to "${stringifyRoute(to)}" via a navigation guard.`;
|
|
},
|
|
[ErrorTypes.NAVIGATION_ABORTED]({ from, to }) {
|
|
return `Navigation aborted from "${from.fullPath}" to "${to.fullPath}" via a navigation guard.`;
|
|
},
|
|
[ErrorTypes.NAVIGATION_CANCELLED]({ from, to }) {
|
|
return `Navigation cancelled from "${from.fullPath}" to "${to.fullPath}" with a new navigation.`;
|
|
},
|
|
[ErrorTypes.NAVIGATION_DUPLICATED]({ from, to }) {
|
|
return `Avoided redundant navigation to current location: "${from.fullPath}".`;
|
|
}
|
|
};
|
|
/**
|
|
* Creates a typed NavigationFailure object.
|
|
* @internal
|
|
* @param type - NavigationFailureType
|
|
* @param params - { from, to }
|
|
*/
|
|
function createRouterError(type, params) {
|
|
if (process.env.NODE_ENV !== "production" || true) return assign(new Error(ErrorTypeMessages[type](params)), {
|
|
type,
|
|
[NavigationFailureSymbol]: true
|
|
}, params);
|
|
}
|
|
function isNavigationFailure(error, type) {
|
|
return error instanceof Error && NavigationFailureSymbol in error && (type == null || !!(error.type & type));
|
|
}
|
|
const propertiesToLog = [
|
|
"params",
|
|
"query",
|
|
"hash"
|
|
];
|
|
function stringifyRoute(to) {
|
|
if (typeof to === "string") return to;
|
|
if (to.path != null) return to.path;
|
|
const location = {};
|
|
for (const key of propertiesToLog) if (key in to) location[key] = to[key];
|
|
return JSON.stringify(location, null, 2);
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/matcher/pathTokenizer.ts
|
|
let TokenType = /* @__PURE__ */ function(TokenType) {
|
|
TokenType[TokenType["Static"] = 0] = "Static";
|
|
TokenType[TokenType["Param"] = 1] = "Param";
|
|
TokenType[TokenType["Group"] = 2] = "Group";
|
|
return TokenType;
|
|
}({});
|
|
var TokenizerState = /* @__PURE__ */ function(TokenizerState) {
|
|
TokenizerState[TokenizerState["Static"] = 0] = "Static";
|
|
TokenizerState[TokenizerState["Param"] = 1] = "Param";
|
|
TokenizerState[TokenizerState["ParamRegExp"] = 2] = "ParamRegExp";
|
|
TokenizerState[TokenizerState["ParamRegExpEnd"] = 3] = "ParamRegExpEnd";
|
|
TokenizerState[TokenizerState["EscapeNext"] = 4] = "EscapeNext";
|
|
return TokenizerState;
|
|
}(TokenizerState || {});
|
|
const ROOT_TOKEN = {
|
|
type: TokenType.Static,
|
|
value: ""
|
|
};
|
|
const VALID_PARAM_RE = /[a-zA-Z0-9_]/;
|
|
function tokenizePath(path) {
|
|
if (!path) return [[]];
|
|
if (path === "/") return [[ROOT_TOKEN]];
|
|
if (!path.startsWith("/")) throw new Error(process.env.NODE_ENV !== "production" ? `Route paths should start with a "/": "${path}" should be "/${path}".` : `Invalid path "${path}"`);
|
|
function crash(message) {
|
|
throw new Error(`ERR (${state})/"${buffer}": ${message}`);
|
|
}
|
|
let state = TokenizerState.Static;
|
|
let previousState = state;
|
|
const tokens = [];
|
|
let segment;
|
|
function finalizeSegment() {
|
|
if (segment) tokens.push(segment);
|
|
segment = [];
|
|
}
|
|
let i = 0;
|
|
let char;
|
|
let buffer = "";
|
|
let customRe = "";
|
|
function consumeBuffer() {
|
|
if (!buffer) return;
|
|
if (state === TokenizerState.Static) segment.push({
|
|
type: TokenType.Static,
|
|
value: buffer
|
|
});
|
|
else if (state === TokenizerState.Param || state === TokenizerState.ParamRegExp || state === TokenizerState.ParamRegExpEnd) {
|
|
if (segment.length > 1 && (char === "*" || char === "+")) crash(`A repeatable param (${buffer}) must be alone in its segment. eg: '/:ids+.`);
|
|
segment.push({
|
|
type: TokenType.Param,
|
|
value: buffer,
|
|
regexp: customRe,
|
|
repeatable: char === "*" || char === "+",
|
|
optional: char === "*" || char === "?"
|
|
});
|
|
} else crash("Invalid state to consume buffer");
|
|
buffer = "";
|
|
}
|
|
function addCharToBuffer() {
|
|
buffer += char;
|
|
}
|
|
while (i < path.length) {
|
|
char = path[i++];
|
|
if (char === "\\" && state !== TokenizerState.ParamRegExp) {
|
|
previousState = state;
|
|
state = TokenizerState.EscapeNext;
|
|
continue;
|
|
}
|
|
switch (state) {
|
|
case TokenizerState.Static:
|
|
if (char === "/") {
|
|
if (buffer) consumeBuffer();
|
|
finalizeSegment();
|
|
} else if (char === ":") {
|
|
consumeBuffer();
|
|
state = TokenizerState.Param;
|
|
} else addCharToBuffer();
|
|
break;
|
|
case TokenizerState.EscapeNext:
|
|
addCharToBuffer();
|
|
state = previousState;
|
|
break;
|
|
case TokenizerState.Param:
|
|
if (char === "(") state = TokenizerState.ParamRegExp;
|
|
else if (VALID_PARAM_RE.test(char)) addCharToBuffer();
|
|
else {
|
|
consumeBuffer();
|
|
state = TokenizerState.Static;
|
|
if (char !== "*" && char !== "?" && char !== "+") i--;
|
|
}
|
|
break;
|
|
case TokenizerState.ParamRegExp:
|
|
if (char === ")") if (customRe[customRe.length - 1] == "\\") customRe = customRe.slice(0, -1) + char;
|
|
else state = TokenizerState.ParamRegExpEnd;
|
|
else customRe += char;
|
|
break;
|
|
case TokenizerState.ParamRegExpEnd:
|
|
consumeBuffer();
|
|
state = TokenizerState.Static;
|
|
if (char !== "*" && char !== "?" && char !== "+") i--;
|
|
customRe = "";
|
|
break;
|
|
default:
|
|
crash("Unknown state");
|
|
break;
|
|
}
|
|
}
|
|
if (state === TokenizerState.ParamRegExp) crash(`Unfinished custom RegExp for param "${buffer}"`);
|
|
consumeBuffer();
|
|
finalizeSegment();
|
|
return tokens;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/matcher/pathParserRanker.ts
|
|
const BASE_PARAM_PATTERN = "[^/]+?";
|
|
const BASE_PATH_PARSER_OPTIONS = {
|
|
sensitive: false,
|
|
strict: false,
|
|
start: true,
|
|
end: true
|
|
};
|
|
var PathScore = /* @__PURE__ */ function(PathScore) {
|
|
PathScore[PathScore["_multiplier"] = 10] = "_multiplier";
|
|
PathScore[PathScore["Root"] = 90] = "Root";
|
|
PathScore[PathScore["Segment"] = 40] = "Segment";
|
|
PathScore[PathScore["SubSegment"] = 30] = "SubSegment";
|
|
PathScore[PathScore["Static"] = 40] = "Static";
|
|
PathScore[PathScore["Dynamic"] = 20] = "Dynamic";
|
|
PathScore[PathScore["BonusCustomRegExp"] = 10] = "BonusCustomRegExp";
|
|
PathScore[PathScore["BonusWildcard"] = -50] = "BonusWildcard";
|
|
PathScore[PathScore["BonusRepeatable"] = -20] = "BonusRepeatable";
|
|
PathScore[PathScore["BonusOptional"] = -8] = "BonusOptional";
|
|
PathScore[PathScore["BonusStrict"] = .7000000000000001] = "BonusStrict";
|
|
PathScore[PathScore["BonusCaseSensitive"] = .25] = "BonusCaseSensitive";
|
|
return PathScore;
|
|
}(PathScore || {});
|
|
const REGEX_CHARS_RE = /[.+*?^${}()[\]/\\]/g;
|
|
/**
|
|
* Creates a path parser from an array of Segments (a segment is an array of Tokens)
|
|
*
|
|
* @param segments - array of segments returned by tokenizePath
|
|
* @param extraOptions - optional options for the regexp
|
|
* @returns a PathParser
|
|
*/
|
|
function tokensToParser(segments, extraOptions) {
|
|
const options = assign({}, BASE_PATH_PARSER_OPTIONS, extraOptions);
|
|
const score = [];
|
|
let pattern = options.start ? "^" : "";
|
|
const keys = [];
|
|
for (const segment of segments) {
|
|
const segmentScores = segment.length ? [] : [PathScore.Root];
|
|
if (options.strict && !segment.length) pattern += "/";
|
|
for (let tokenIndex = 0; tokenIndex < segment.length; tokenIndex++) {
|
|
const token = segment[tokenIndex];
|
|
let subSegmentScore = PathScore.Segment + (options.sensitive ? PathScore.BonusCaseSensitive : 0);
|
|
if (token.type === TokenType.Static) {
|
|
if (!tokenIndex) pattern += "/";
|
|
pattern += token.value.replace(REGEX_CHARS_RE, "\\$&");
|
|
subSegmentScore += PathScore.Static;
|
|
} else if (token.type === TokenType.Param) {
|
|
const { value, repeatable, optional, regexp } = token;
|
|
keys.push({
|
|
name: value,
|
|
repeatable,
|
|
optional
|
|
});
|
|
const re = regexp ? regexp : BASE_PARAM_PATTERN;
|
|
if (re !== BASE_PARAM_PATTERN) {
|
|
subSegmentScore += PathScore.BonusCustomRegExp;
|
|
try {
|
|
new RegExp(`(${re})`);
|
|
} catch (err) {
|
|
throw new Error(`Invalid custom RegExp for param "${value}" (${re}): ` + err.message);
|
|
}
|
|
}
|
|
let subPattern = repeatable ? `((?:${re})(?:/(?:${re}))*)` : `(${re})`;
|
|
if (!tokenIndex) subPattern = optional && segment.length < 2 ? `(?:/${subPattern})` : "/" + subPattern;
|
|
if (optional) subPattern += "?";
|
|
pattern += subPattern;
|
|
subSegmentScore += PathScore.Dynamic;
|
|
if (optional) subSegmentScore += PathScore.BonusOptional;
|
|
if (repeatable) subSegmentScore += PathScore.BonusRepeatable;
|
|
if (re === ".*") subSegmentScore += PathScore.BonusWildcard;
|
|
}
|
|
segmentScores.push(subSegmentScore);
|
|
}
|
|
score.push(segmentScores);
|
|
}
|
|
if (options.strict && options.end) {
|
|
const i = score.length - 1;
|
|
score[i][score[i].length - 1] += PathScore.BonusStrict;
|
|
}
|
|
if (!options.strict) pattern += "/?";
|
|
if (options.end) pattern += "$";
|
|
else if (options.strict && !pattern.endsWith("/")) pattern += "(?:/|$)";
|
|
const re = new RegExp(pattern, options.sensitive ? "" : "i");
|
|
function parse(path) {
|
|
const match = path.match(re);
|
|
const params = {};
|
|
if (!match) return null;
|
|
for (let i = 1; i < match.length; i++) {
|
|
const value = match[i] || "";
|
|
const key = keys[i - 1];
|
|
params[key.name] = value && key.repeatable ? value.split("/") : value;
|
|
}
|
|
return params;
|
|
}
|
|
function stringify(params) {
|
|
let path = "";
|
|
let avoidDuplicatedSlash = false;
|
|
for (const segment of segments) {
|
|
if (!avoidDuplicatedSlash || !path.endsWith("/")) path += "/";
|
|
avoidDuplicatedSlash = false;
|
|
for (const token of segment) if (token.type === TokenType.Static) path += token.value;
|
|
else if (token.type === TokenType.Param) {
|
|
const { value, repeatable, optional } = token;
|
|
const param = value in params ? params[value] : "";
|
|
if (isArray(param) && !repeatable) throw new Error(`Provided param "${value}" is an array but it is not repeatable (* or + modifiers)`);
|
|
const text = isArray(param) ? param.join("/") : param;
|
|
if (!text) if (optional) {
|
|
if (segment.length < 2) if (path.endsWith("/")) path = path.slice(0, -1);
|
|
else avoidDuplicatedSlash = true;
|
|
} else throw new Error(`Missing required param "${value}"`);
|
|
path += text;
|
|
}
|
|
}
|
|
return path || "/";
|
|
}
|
|
return {
|
|
re,
|
|
score,
|
|
keys,
|
|
parse,
|
|
stringify
|
|
};
|
|
}
|
|
/**
|
|
* Compares an array of numbers as used in PathParser.score and returns a
|
|
* number. This function can be used to `sort` an array
|
|
*
|
|
* @param a - first array of numbers
|
|
* @param b - second array of numbers
|
|
* @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
|
|
* should be sorted first
|
|
*/
|
|
function compareScoreArray(a, b) {
|
|
let i = 0;
|
|
while (i < a.length && i < b.length) {
|
|
const diff = b[i] - a[i];
|
|
if (diff) return diff;
|
|
i++;
|
|
}
|
|
if (a.length < b.length) return a.length === 1 && a[0] === PathScore.Static + PathScore.Segment ? -1 : 1;
|
|
else if (a.length > b.length) return b.length === 1 && b[0] === PathScore.Static + PathScore.Segment ? 1 : -1;
|
|
return 0;
|
|
}
|
|
/**
|
|
* Compare function that can be used with `sort` to sort an array of PathParser
|
|
*
|
|
* @param a - first PathParser
|
|
* @param b - second PathParser
|
|
* @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
|
|
*/
|
|
function comparePathParserScore(a, b) {
|
|
let i = 0;
|
|
const aScore = a.score;
|
|
const bScore = b.score;
|
|
while (i < aScore.length && i < bScore.length) {
|
|
const comp = compareScoreArray(aScore[i], bScore[i]);
|
|
if (comp) return comp;
|
|
i++;
|
|
}
|
|
if (Math.abs(bScore.length - aScore.length) === 1) {
|
|
if (isLastScoreNegative(aScore)) return 1;
|
|
if (isLastScoreNegative(bScore)) return -1;
|
|
}
|
|
return bScore.length - aScore.length;
|
|
}
|
|
/**
|
|
* This allows detecting splats at the end of a path: /home/:id(.*)*
|
|
*
|
|
* @param score - score to check
|
|
* @returns true if the last entry is negative
|
|
*/
|
|
function isLastScoreNegative(score) {
|
|
const last = score[score.length - 1];
|
|
return score.length > 0 && last[last.length - 1] < 0;
|
|
}
|
|
const PATH_PARSER_OPTIONS_DEFAULTS = {
|
|
strict: false,
|
|
end: true,
|
|
sensitive: false
|
|
};
|
|
|
|
//#endregion
|
|
//#region src/matcher/pathMatcher.ts
|
|
function createRouteRecordMatcher(record, parent, options) {
|
|
const parser = tokensToParser(tokenizePath(record.path), options);
|
|
if (process.env.NODE_ENV !== "production") {
|
|
const existingKeys = /* @__PURE__ */ new Set();
|
|
for (const key of parser.keys) {
|
|
if (existingKeys.has(key.name)) warn(`Found duplicated params with name "${key.name}" for path "${record.path}". Only the last one will be available on "$route.params".`);
|
|
existingKeys.add(key.name);
|
|
}
|
|
}
|
|
const matcher = assign(parser, {
|
|
record,
|
|
parent,
|
|
children: [],
|
|
alias: []
|
|
});
|
|
if (parent) {
|
|
if (!matcher.record.aliasOf === !parent.record.aliasOf) parent.children.push(matcher);
|
|
}
|
|
return matcher;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/matcher/index.ts
|
|
/**
|
|
* Creates a Router Matcher.
|
|
*
|
|
* @internal
|
|
* @param routes - array of initial routes
|
|
* @param globalOptions - global route options
|
|
*/
|
|
function createRouterMatcher(routes, globalOptions) {
|
|
const matchers = [];
|
|
const matcherMap = /* @__PURE__ */ new Map();
|
|
globalOptions = mergeOptions(PATH_PARSER_OPTIONS_DEFAULTS, globalOptions);
|
|
function getRecordMatcher(name) {
|
|
return matcherMap.get(name);
|
|
}
|
|
function addRoute(record, parent, originalRecord) {
|
|
const isRootAdd = !originalRecord;
|
|
const mainNormalizedRecord = normalizeRouteRecord(record);
|
|
if (process.env.NODE_ENV !== "production") checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent);
|
|
mainNormalizedRecord.aliasOf = originalRecord && originalRecord.record;
|
|
const options = mergeOptions(globalOptions, record);
|
|
const normalizedRecords = [mainNormalizedRecord];
|
|
if ("alias" in record) {
|
|
const aliases = typeof record.alias === "string" ? [record.alias] : record.alias;
|
|
for (const alias of aliases) normalizedRecords.push(normalizeRouteRecord(assign({}, mainNormalizedRecord, {
|
|
components: originalRecord ? originalRecord.record.components : mainNormalizedRecord.components,
|
|
path: alias,
|
|
aliasOf: originalRecord ? originalRecord.record : mainNormalizedRecord
|
|
})));
|
|
}
|
|
let matcher;
|
|
let originalMatcher;
|
|
for (const normalizedRecord of normalizedRecords) {
|
|
const { path } = normalizedRecord;
|
|
if (parent && path[0] !== "/") {
|
|
const parentPath = parent.record.path;
|
|
const connectingSlash = parentPath[parentPath.length - 1] === "/" ? "" : "/";
|
|
normalizedRecord.path = parent.record.path + (path && connectingSlash + path);
|
|
}
|
|
if (process.env.NODE_ENV !== "production" && normalizedRecord.path === "*") throw new Error("Catch all routes (\"*\") must now be defined using a param with a custom regexp.\nSee more at https://router.vuejs.org/guide/migration/#Removed-star-or-catch-all-routes.");
|
|
matcher = createRouteRecordMatcher(normalizedRecord, parent, options);
|
|
if (process.env.NODE_ENV !== "production" && parent && path[0] === "/") checkMissingParamsInAbsolutePath(matcher, parent);
|
|
if (originalRecord) {
|
|
originalRecord.alias.push(matcher);
|
|
if (process.env.NODE_ENV !== "production") checkSameParams(originalRecord, matcher);
|
|
} else {
|
|
originalMatcher = originalMatcher || matcher;
|
|
if (originalMatcher !== matcher) originalMatcher.alias.push(matcher);
|
|
if (isRootAdd && record.name && !isAliasRecord(matcher)) {
|
|
if (process.env.NODE_ENV !== "production") checkSameNameAsAncestor(record, parent);
|
|
removeRoute(record.name);
|
|
}
|
|
}
|
|
if (isMatchable(matcher)) insertMatcher(matcher);
|
|
if (mainNormalizedRecord.children) {
|
|
const children = mainNormalizedRecord.children;
|
|
for (let i = 0; i < children.length; i++) addRoute(children[i], matcher, originalRecord && originalRecord.children[i]);
|
|
}
|
|
originalRecord = originalRecord || matcher;
|
|
}
|
|
return originalMatcher ? () => {
|
|
removeRoute(originalMatcher);
|
|
} : noop;
|
|
}
|
|
function removeRoute(matcherRef) {
|
|
if (isRouteName(matcherRef)) {
|
|
const matcher = matcherMap.get(matcherRef);
|
|
if (matcher) {
|
|
matcherMap.delete(matcherRef);
|
|
matchers.splice(matchers.indexOf(matcher), 1);
|
|
matcher.children.forEach(removeRoute);
|
|
matcher.alias.forEach(removeRoute);
|
|
}
|
|
} else {
|
|
const index = matchers.indexOf(matcherRef);
|
|
if (index > -1) {
|
|
matchers.splice(index, 1);
|
|
if (matcherRef.record.name) matcherMap.delete(matcherRef.record.name);
|
|
matcherRef.children.forEach(removeRoute);
|
|
matcherRef.alias.forEach(removeRoute);
|
|
}
|
|
}
|
|
}
|
|
function getRoutes() {
|
|
return matchers;
|
|
}
|
|
function insertMatcher(matcher) {
|
|
const index = findInsertionIndex(matcher, matchers);
|
|
matchers.splice(index, 0, matcher);
|
|
if (matcher.record.name && !isAliasRecord(matcher)) matcherMap.set(matcher.record.name, matcher);
|
|
}
|
|
function resolve(location, currentLocation) {
|
|
let matcher;
|
|
let params = {};
|
|
let path;
|
|
let name;
|
|
if ("name" in location && location.name) {
|
|
matcher = matcherMap.get(location.name);
|
|
if (!matcher) throw createRouterError(ErrorTypes.MATCHER_NOT_FOUND, { location });
|
|
if (process.env.NODE_ENV !== "production") {
|
|
const invalidParams = Object.keys(location.params || {}).filter((paramName) => !matcher.keys.find((k) => k.name === paramName));
|
|
if (invalidParams.length) warn(`Discarded invalid param(s) "${invalidParams.join("\", \"")}" when navigating. See https://github.com/vuejs/router/blob/main/packages/router/CHANGELOG.md#414-2022-08-22 for more details.`);
|
|
}
|
|
name = matcher.record.name;
|
|
params = assign(pickParams(currentLocation.params, matcher.keys.filter((k) => !k.optional).concat(matcher.parent ? matcher.parent.keys.filter((k) => k.optional) : []).map((k) => k.name)), location.params && pickParams(location.params, matcher.keys.map((k) => k.name)));
|
|
path = matcher.stringify(params);
|
|
} else if (location.path != null) {
|
|
path = location.path;
|
|
if (process.env.NODE_ENV !== "production" && !path.startsWith("/")) warn(`The Matcher cannot resolve relative paths but received "${path}". Unless you directly called \`matcher.resolve("${path}")\`, this is probably a bug in vue-router. Please open an issue at https://github.com/vuejs/router/issues/new/choose.`);
|
|
matcher = matchers.find((m) => m.re.test(path));
|
|
if (matcher) {
|
|
params = matcher.parse(path);
|
|
name = matcher.record.name;
|
|
}
|
|
} else {
|
|
matcher = currentLocation.name ? matcherMap.get(currentLocation.name) : matchers.find((m) => m.re.test(currentLocation.path));
|
|
if (!matcher) throw createRouterError(ErrorTypes.MATCHER_NOT_FOUND, {
|
|
location,
|
|
currentLocation
|
|
});
|
|
name = matcher.record.name;
|
|
params = assign({}, currentLocation.params, location.params);
|
|
path = matcher.stringify(params);
|
|
}
|
|
const matched = [];
|
|
let parentMatcher = matcher;
|
|
while (parentMatcher) {
|
|
matched.unshift(parentMatcher.record);
|
|
parentMatcher = parentMatcher.parent;
|
|
}
|
|
return {
|
|
name,
|
|
path,
|
|
params,
|
|
matched,
|
|
meta: mergeMetaFields(matched)
|
|
};
|
|
}
|
|
routes.forEach((route) => addRoute(route));
|
|
function clearRoutes() {
|
|
matchers.length = 0;
|
|
matcherMap.clear();
|
|
}
|
|
return {
|
|
addRoute,
|
|
resolve,
|
|
removeRoute,
|
|
clearRoutes,
|
|
getRoutes,
|
|
getRecordMatcher
|
|
};
|
|
}
|
|
/**
|
|
* Picks an object param to contain only specified keys.
|
|
*
|
|
* @param params - params object to pick from
|
|
* @param keys - keys to pick
|
|
*/
|
|
function pickParams(params, keys) {
|
|
const newParams = {};
|
|
for (const key of keys) if (key in params) newParams[key] = params[key];
|
|
return newParams;
|
|
}
|
|
/**
|
|
* Normalizes a RouteRecordRaw. Creates a copy
|
|
*
|
|
* @param record
|
|
* @returns the normalized version
|
|
*/
|
|
function normalizeRouteRecord(record) {
|
|
const normalized = {
|
|
path: record.path,
|
|
redirect: record.redirect,
|
|
name: record.name,
|
|
meta: record.meta || {},
|
|
aliasOf: record.aliasOf,
|
|
beforeEnter: record.beforeEnter,
|
|
props: normalizeRecordProps(record),
|
|
children: record.children || [],
|
|
instances: {},
|
|
leaveGuards: /* @__PURE__ */ new Set(),
|
|
updateGuards: /* @__PURE__ */ new Set(),
|
|
enterCallbacks: {},
|
|
components: "components" in record ? record.components || null : record.component && { default: record.component }
|
|
};
|
|
Object.defineProperty(normalized, "mods", { value: {} });
|
|
return normalized;
|
|
}
|
|
/**
|
|
* Normalize the optional `props` in a record to always be an object similar to
|
|
* components. Also accept a boolean for components.
|
|
* @param record
|
|
*/
|
|
function normalizeRecordProps(record) {
|
|
const propsObject = {};
|
|
const props = record.props || false;
|
|
if ("component" in record) propsObject.default = props;
|
|
else for (const name in record.components) propsObject[name] = typeof props === "object" ? props[name] : props;
|
|
return propsObject;
|
|
}
|
|
/**
|
|
* Checks if a record or any of its parent is an alias
|
|
* @param record
|
|
*/
|
|
function isAliasRecord(record) {
|
|
while (record) {
|
|
if (record.record.aliasOf) return true;
|
|
record = record.parent;
|
|
}
|
|
return false;
|
|
}
|
|
/**
|
|
* Merge meta fields of an array of records
|
|
*
|
|
* @param matched - array of matched records
|
|
*/
|
|
function mergeMetaFields(matched) {
|
|
return matched.reduce((meta, record) => assign(meta, record.meta), {});
|
|
}
|
|
function isSameParam(a, b) {
|
|
return a.name === b.name && a.optional === b.optional && a.repeatable === b.repeatable;
|
|
}
|
|
/**
|
|
* Check if a path and its alias have the same required params
|
|
*
|
|
* @param a - original record
|
|
* @param b - alias record
|
|
*/
|
|
function checkSameParams(a, b) {
|
|
for (const key of a.keys) if (!key.optional && !b.keys.find(isSameParam.bind(null, key))) return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" must have the exact same param named "${key.name}"`);
|
|
for (const key of b.keys) if (!key.optional && !a.keys.find(isSameParam.bind(null, key))) return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" must have the exact same param named "${key.name}"`);
|
|
}
|
|
/**
|
|
* A route with a name and a child with an empty path without a name should warn when adding the route
|
|
*
|
|
* @param mainNormalizedRecord - RouteRecordNormalized
|
|
* @param parent - RouteRecordMatcher
|
|
*/
|
|
function checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent) {
|
|
if (parent && parent.record.name && !mainNormalizedRecord.name && !mainNormalizedRecord.path && mainNormalizedRecord.children.length === 0) warn(`The route named "${String(parent.record.name)}" has a child without a name, an empty path, and no children. This is probably a mistake: using that name won't render the empty path child so you probably want to move the name to the child instead. If this is intentional, add a name to the child route to silence the warning.`);
|
|
}
|
|
function checkSameNameAsAncestor(record, parent) {
|
|
for (let ancestor = parent; ancestor; ancestor = ancestor.parent) if (ancestor.record.name === record.name) throw new Error(`A route named "${String(record.name)}" has been added as a ${parent === ancestor ? "child" : "descendant"} of a route with the same name. Route names must be unique and a nested route cannot use the same name as an ancestor.`);
|
|
}
|
|
function checkMissingParamsInAbsolutePath(record, parent) {
|
|
for (const key of parent.keys) if (!record.keys.find(isSameParam.bind(null, key))) return warn(`Absolute path "${record.record.path}" must have the exact same param named "${key.name}" as its parent "${parent.record.path}".`);
|
|
}
|
|
/**
|
|
* Performs a binary search to find the correct insertion index for a new matcher.
|
|
*
|
|
* Matchers are primarily sorted by their score. If scores are tied then we also consider parent/child relationships,
|
|
* with descendants coming before ancestors. If there's still a tie, new routes are inserted after existing routes.
|
|
*
|
|
* @param matcher - new matcher to be inserted
|
|
* @param matchers - existing matchers
|
|
*/
|
|
function findInsertionIndex(matcher, matchers) {
|
|
let lower = 0;
|
|
let upper = matchers.length;
|
|
while (lower !== upper) {
|
|
const mid = lower + upper >> 1;
|
|
if (comparePathParserScore(matcher, matchers[mid]) < 0) upper = mid;
|
|
else lower = mid + 1;
|
|
}
|
|
const insertionAncestor = getInsertionAncestor(matcher);
|
|
if (insertionAncestor) {
|
|
upper = matchers.lastIndexOf(insertionAncestor, upper - 1);
|
|
if (process.env.NODE_ENV !== "production" && upper < 0) warn(`Finding ancestor route "${insertionAncestor.record.path}" failed for "${matcher.record.path}"`);
|
|
}
|
|
return upper;
|
|
}
|
|
function getInsertionAncestor(matcher) {
|
|
let ancestor = matcher;
|
|
while (ancestor = ancestor.parent) if (isMatchable(ancestor) && comparePathParserScore(matcher, ancestor) === 0) return ancestor;
|
|
}
|
|
/**
|
|
* Checks if a matcher can be reachable. This means if it's possible to reach it as a route. For example, routes without
|
|
* a component, or name, or redirect, are just used to group other routes.
|
|
* @param matcher
|
|
* @param matcher.record record of the matcher
|
|
* @returns
|
|
*/
|
|
function isMatchable({ record }) {
|
|
return !!(record.name || record.components && Object.keys(record.components).length || record.redirect);
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/query.ts
|
|
/**
|
|
* Transforms a queryString into a {@link LocationQuery} object. Accept both, a
|
|
* version with the leading `?` and without Should work as URLSearchParams
|
|
|
|
* @internal
|
|
*
|
|
* @param search - search string to parse
|
|
* @returns a query object
|
|
*/
|
|
function parseQuery(search) {
|
|
const query = {};
|
|
if (search === "" || search === "?") return query;
|
|
const searchParams = (search[0] === "?" ? search.slice(1) : search).split("&");
|
|
for (let i = 0; i < searchParams.length; ++i) {
|
|
const searchParam = searchParams[i].replace(PLUS_RE, " ");
|
|
const eqPos = searchParam.indexOf("=");
|
|
const key = decode(eqPos < 0 ? searchParam : searchParam.slice(0, eqPos));
|
|
const value = eqPos < 0 ? null : decode(searchParam.slice(eqPos + 1));
|
|
if (key in query) {
|
|
let currentValue = query[key];
|
|
if (!isArray(currentValue)) currentValue = query[key] = [currentValue];
|
|
currentValue.push(value);
|
|
} else query[key] = value;
|
|
}
|
|
return query;
|
|
}
|
|
/**
|
|
* Stringifies a {@link LocationQueryRaw} object. Like `URLSearchParams`, it
|
|
* doesn't prepend a `?`
|
|
*
|
|
* @internal
|
|
*
|
|
* @param query - query object to stringify
|
|
* @returns string version of the query without the leading `?`
|
|
*/
|
|
function stringifyQuery(query) {
|
|
let search = "";
|
|
for (let key in query) {
|
|
const value = query[key];
|
|
key = encodeQueryKey(key);
|
|
if (value == null) {
|
|
if (value !== void 0) search += (search.length ? "&" : "") + key;
|
|
continue;
|
|
}
|
|
(isArray(value) ? value.map((v) => v && encodeQueryValue(v)) : [value && encodeQueryValue(value)]).forEach((value) => {
|
|
if (value !== void 0) {
|
|
search += (search.length ? "&" : "") + key;
|
|
if (value != null) search += "=" + value;
|
|
}
|
|
});
|
|
}
|
|
return search;
|
|
}
|
|
/**
|
|
* Transforms a {@link LocationQueryRaw} into a {@link LocationQuery} by casting
|
|
* numbers into strings, removing keys with an undefined value and replacing
|
|
* undefined with null in arrays
|
|
*
|
|
* @param query - query object to normalize
|
|
* @returns a normalized query object
|
|
*/
|
|
function normalizeQuery(query) {
|
|
const normalizedQuery = {};
|
|
for (const key in query) {
|
|
const value = query[key];
|
|
if (value !== void 0) normalizedQuery[key] = isArray(value) ? value.map((v) => v == null ? null : "" + v) : value == null ? value : "" + value;
|
|
}
|
|
return normalizedQuery;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/injectionSymbols.ts
|
|
/**
|
|
* RouteRecord being rendered by the closest ancestor Router View. Used for
|
|
* `onBeforeRouteUpdate` and `onBeforeRouteLeave`. rvlm stands for Router View
|
|
* Location Matched
|
|
*
|
|
* @internal
|
|
*/
|
|
const matchedRouteKey = Symbol(process.env.NODE_ENV !== "production" ? "router view location matched" : "");
|
|
/**
|
|
* Allows overriding the router view depth to control which component in
|
|
* `matched` is rendered. rvd stands for Router View Depth
|
|
*
|
|
* @internal
|
|
*/
|
|
const viewDepthKey = Symbol(process.env.NODE_ENV !== "production" ? "router view depth" : "");
|
|
/**
|
|
* Allows overriding the router instance returned by `useRouter` in tests. r
|
|
* stands for router
|
|
*
|
|
* @internal
|
|
*/
|
|
const routerKey = Symbol(process.env.NODE_ENV !== "production" ? "router" : "");
|
|
/**
|
|
* Allows overriding the current route returned by `useRoute` in tests. rl
|
|
* stands for route location
|
|
*
|
|
* @internal
|
|
*/
|
|
const routeLocationKey = Symbol(process.env.NODE_ENV !== "production" ? "route location" : "");
|
|
/**
|
|
* Allows overriding the current route used by router-view. Internally this is
|
|
* used when the `route` prop is passed.
|
|
*
|
|
* @internal
|
|
*/
|
|
const routerViewLocationKey = Symbol(process.env.NODE_ENV !== "production" ? "router view location" : "");
|
|
|
|
//#endregion
|
|
//#region src/utils/callbacks.ts
|
|
/**
|
|
* Create a list of callbacks that can be reset. Used to create before and after navigation guards list
|
|
*/
|
|
function useCallbacks() {
|
|
let handlers = [];
|
|
function add(handler) {
|
|
handlers.push(handler);
|
|
return () => {
|
|
const i = handlers.indexOf(handler);
|
|
if (i > -1) handlers.splice(i, 1);
|
|
};
|
|
}
|
|
function reset() {
|
|
handlers = [];
|
|
}
|
|
return {
|
|
add,
|
|
list: () => handlers.slice(),
|
|
reset
|
|
};
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/navigationGuards.ts
|
|
function registerGuard(activeRecordRef, name, guard) {
|
|
const record = activeRecordRef.value;
|
|
if (!record) {
|
|
if (process.env.NODE_ENV !== "production") warn(`No active route record was found when calling \`${name === "updateGuards" ? "onBeforeRouteUpdate" : "onBeforeRouteLeave"}()\`. Make sure you call this function inside a component child of <router-view>. Maybe you called it inside of App.vue?`);
|
|
return;
|
|
}
|
|
let currentRecord = record;
|
|
const removeFromList = () => {
|
|
currentRecord[name].delete(guard);
|
|
};
|
|
(0, vue.onUnmounted)(removeFromList);
|
|
(0, vue.onDeactivated)(removeFromList);
|
|
(0, vue.onActivated)(() => {
|
|
const newRecord = activeRecordRef.value;
|
|
if (process.env.NODE_ENV !== "production" && !newRecord) warn("No active route record was found when reactivating component with navigation guard. This is likely a bug in vue-router. Please report it.");
|
|
if (newRecord) currentRecord = newRecord;
|
|
currentRecord[name].add(guard);
|
|
});
|
|
currentRecord[name].add(guard);
|
|
}
|
|
/**
|
|
* Add a navigation guard that triggers whenever the component for the current
|
|
* location is about to be left. Similar to {@link beforeRouteLeave} but can be
|
|
* used in any component. The guard is removed when the component is unmounted.
|
|
*
|
|
* @param leaveGuard - {@link NavigationGuard}
|
|
*/
|
|
function onBeforeRouteLeave(leaveGuard) {
|
|
if (process.env.NODE_ENV !== "production" && !(0, vue.getCurrentInstance)()) {
|
|
warn("getCurrentInstance() returned null. onBeforeRouteLeave() must be called at the top of a setup function");
|
|
return;
|
|
}
|
|
registerGuard((0, vue.inject)(matchedRouteKey, {}), "leaveGuards", leaveGuard);
|
|
}
|
|
/**
|
|
* Add a navigation guard that triggers whenever the current location is about
|
|
* to be updated. Similar to {@link beforeRouteUpdate} but can be used in any
|
|
* component. The guard is removed when the component is unmounted.
|
|
*
|
|
* @param updateGuard - {@link NavigationGuard}
|
|
*/
|
|
function onBeforeRouteUpdate(updateGuard) {
|
|
if (process.env.NODE_ENV !== "production" && !(0, vue.getCurrentInstance)()) {
|
|
warn("getCurrentInstance() returned null. onBeforeRouteUpdate() must be called at the top of a setup function");
|
|
return;
|
|
}
|
|
registerGuard((0, vue.inject)(matchedRouteKey, {}), "updateGuards", updateGuard);
|
|
}
|
|
function guardToPromiseFn(guard, to, from, record, name, runWithContext = (fn) => fn()) {
|
|
const enterCallbackArray = record && (record.enterCallbacks[name] = record.enterCallbacks[name] || []);
|
|
return () => new Promise((resolve, reject) => {
|
|
const next = (valid) => {
|
|
if (valid === false) reject(createRouterError(ErrorTypes.NAVIGATION_ABORTED, {
|
|
from,
|
|
to
|
|
}));
|
|
else if (valid instanceof Error) reject(valid);
|
|
else if (isRouteLocation(valid)) reject(createRouterError(ErrorTypes.NAVIGATION_GUARD_REDIRECT, {
|
|
from: to,
|
|
to: valid
|
|
}));
|
|
else {
|
|
if (enterCallbackArray && record.enterCallbacks[name] === enterCallbackArray && typeof valid === "function") enterCallbackArray.push(valid);
|
|
resolve();
|
|
}
|
|
};
|
|
const guardReturn = runWithContext(() => guard.call(record && record.instances[name], to, from, process.env.NODE_ENV !== "production" ? withDeprecationWarning(canOnlyBeCalledOnce(next, to, from)) : next));
|
|
let guardCall = Promise.resolve(guardReturn);
|
|
if (guard.length < 3) guardCall = guardCall.then(next);
|
|
if (process.env.NODE_ENV !== "production" && guard.length > 2) {
|
|
const message = `The "next" callback was never called inside of ${guard.name ? "\"" + guard.name + "\"" : ""}:\n${guard.toString()}\n. If you are returning a value instead of calling "next", make sure to remove the "next" parameter from your function.`;
|
|
if (typeof guardReturn === "object" && "then" in guardReturn) guardCall = guardCall.then((resolvedValue) => {
|
|
if (!next._called) {
|
|
warn(message);
|
|
return Promise.reject(/* @__PURE__ */ new Error("Invalid navigation guard"));
|
|
}
|
|
return resolvedValue;
|
|
});
|
|
else if (guardReturn !== void 0) {
|
|
if (!next._called) {
|
|
warn(message);
|
|
reject(/* @__PURE__ */ new Error("Invalid navigation guard"));
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
guardCall.catch((err) => reject(err));
|
|
});
|
|
}
|
|
/**
|
|
* Wraps the next callback to warn when it is used. Dev-only: when __DEV__ is
|
|
* false (production builds), this branch is dead code and is stripped from the
|
|
* bundle.
|
|
*
|
|
* @internal
|
|
*/
|
|
function withDeprecationWarning(next) {
|
|
let warned = false;
|
|
return function() {
|
|
if (!warned) {
|
|
warned = true;
|
|
warn("The `next()` callback in navigation guards is deprecated. Return the value instead of calling `next(value)`.");
|
|
}
|
|
return next.apply(this, arguments);
|
|
};
|
|
}
|
|
function canOnlyBeCalledOnce(next, to, from) {
|
|
let called = 0;
|
|
return function() {
|
|
if (called++ === 1) warn(`The "next" callback was called more than once in one navigation guard when going from "${from.fullPath}" to "${to.fullPath}". It should be called exactly one time in each navigation guard. This will fail in production.`);
|
|
next._called = true;
|
|
if (called === 1) next.apply(null, arguments);
|
|
};
|
|
}
|
|
function extractComponentsGuards(matched, guardType, to, from, runWithContext = (fn) => fn()) {
|
|
const guards = [];
|
|
for (const record of matched) {
|
|
if (process.env.NODE_ENV !== "production" && !record.components && record.children && !record.children.length) warn(`Record with path "${record.path}" is either missing a "component(s)" or "children" property.`);
|
|
for (const name in record.components) {
|
|
let rawComponent = record.components[name];
|
|
if (process.env.NODE_ENV !== "production") {
|
|
if (!rawComponent || typeof rawComponent !== "object" && typeof rawComponent !== "function") {
|
|
warn(`Component "${name}" in record with path "${record.path}" is not a valid component. Received "${String(rawComponent)}".`);
|
|
throw new Error("Invalid route component");
|
|
} else if ("then" in rawComponent) {
|
|
warn(`Component "${name}" in record with path "${record.path}" is a Promise instead of a function that returns a Promise. Did you write "import('./MyPage.vue')" instead of "() => import('./MyPage.vue')" ? This will break in production if not fixed.`);
|
|
const promise = rawComponent;
|
|
rawComponent = () => promise;
|
|
} else if (rawComponent.__asyncLoader && !rawComponent.__warnedDefineAsync) {
|
|
rawComponent.__warnedDefineAsync = true;
|
|
warn(`Component "${name}" in record with path "${record.path}" is defined using "defineAsyncComponent()". Write "() => import('./MyPage.vue')" instead of "defineAsyncComponent(() => import('./MyPage.vue'))".`);
|
|
}
|
|
}
|
|
if (guardType !== "beforeRouteEnter" && !record.instances[name]) continue;
|
|
if (isRouteComponent(rawComponent)) {
|
|
const guard = (rawComponent.__vccOpts || rawComponent)[guardType];
|
|
guard && guards.push(guardToPromiseFn(guard, to, from, record, name, runWithContext));
|
|
} else {
|
|
let componentPromise = rawComponent();
|
|
if (process.env.NODE_ENV !== "production" && !("catch" in componentPromise)) {
|
|
warn(`Component "${name}" in record with path "${record.path}" is a function that does not return a Promise. If you were passing a functional component, make sure to add a "displayName" to the component. This will break in production if not fixed.`);
|
|
componentPromise = Promise.resolve(componentPromise);
|
|
}
|
|
guards.push(() => componentPromise.then((resolved) => {
|
|
if (!resolved) throw new Error(`Couldn't resolve component "${name}" at "${record.path}"`);
|
|
const resolvedComponent = isESModule(resolved) ? resolved.default : resolved;
|
|
record.mods[name] = resolved;
|
|
record.components[name] = resolvedComponent;
|
|
const guard = (resolvedComponent.__vccOpts || resolvedComponent)[guardType];
|
|
return guard && guardToPromiseFn(guard, to, from, record, name, runWithContext)();
|
|
}));
|
|
}
|
|
}
|
|
}
|
|
return guards;
|
|
}
|
|
/**
|
|
* Ensures a route is loaded, so it can be passed as o prop to `<RouterView>`.
|
|
*
|
|
* @param route - resolved route to load
|
|
*/
|
|
function loadRouteLocation(route) {
|
|
return route.matched.every((record) => record.redirect) ? Promise.reject(/* @__PURE__ */ new Error("Cannot load a route that redirects.")) : Promise.all(route.matched.map((record) => record.components && Promise.all(Object.keys(record.components).reduce((promises, name) => {
|
|
const rawComponent = record.components[name];
|
|
if (typeof rawComponent === "function" && !("displayName" in rawComponent)) promises.push(rawComponent().then((resolved) => {
|
|
if (!resolved) return Promise.reject(/* @__PURE__ */ new Error(`Couldn't resolve component "${name}" at "${record.path}". Ensure you passed a function that returns a promise.`));
|
|
const resolvedComponent = isESModule(resolved) ? resolved.default : resolved;
|
|
record.mods[name] = resolved;
|
|
record.components[name] = resolvedComponent;
|
|
}));
|
|
return promises;
|
|
}, [])))).then(() => route);
|
|
}
|
|
/**
|
|
* Split the leaving, updating, and entering records.
|
|
* @internal
|
|
*
|
|
* @param to - Location we are navigating to
|
|
* @param from - Location we are navigating from
|
|
*/
|
|
function extractChangingRecords(to, from) {
|
|
const leavingRecords = [];
|
|
const updatingRecords = [];
|
|
const enteringRecords = [];
|
|
const len = Math.max(from.matched.length, to.matched.length);
|
|
for (let i = 0; i < len; i++) {
|
|
const recordFrom = from.matched[i];
|
|
if (recordFrom) if (to.matched.find((record) => isSameRouteRecord(record, recordFrom))) updatingRecords.push(recordFrom);
|
|
else leavingRecords.push(recordFrom);
|
|
const recordTo = to.matched[i];
|
|
if (recordTo) {
|
|
if (!from.matched.find((record) => isSameRouteRecord(record, recordTo))) enteringRecords.push(recordTo);
|
|
}
|
|
}
|
|
return [
|
|
leavingRecords,
|
|
updatingRecords,
|
|
enteringRecords
|
|
];
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/RouterLink.ts
|
|
/**
|
|
* Returns the internal behavior of a {@link RouterLink} without the rendering part.
|
|
*
|
|
* @param props - a `to` location and an optional `replace` flag
|
|
*/
|
|
function useLink(props) {
|
|
const router = (0, vue.inject)(routerKey);
|
|
const currentRoute = (0, vue.inject)(routeLocationKey);
|
|
let hasPrevious = false;
|
|
let previousTo = null;
|
|
const route = (0, vue.computed)(() => {
|
|
const to = (0, vue.unref)(props.to);
|
|
if (process.env.NODE_ENV !== "production" && (!hasPrevious || to !== previousTo)) {
|
|
if (!isRouteLocation(to)) if (hasPrevious) warn(`Invalid value for prop "to" in useLink()\n- to:`, to, `\n- previous to:`, previousTo, `\n- props:`, props);
|
|
else warn(`Invalid value for prop "to" in useLink()\n- to:`, to, `\n- props:`, props);
|
|
previousTo = to;
|
|
hasPrevious = true;
|
|
}
|
|
return router.resolve(to);
|
|
});
|
|
const activeRecordIndex = (0, vue.computed)(() => {
|
|
const { matched } = route.value;
|
|
const { length } = matched;
|
|
const routeMatched = matched[length - 1];
|
|
const currentMatched = currentRoute.matched;
|
|
if (!routeMatched || !currentMatched.length) return -1;
|
|
const index = currentMatched.findIndex(isSameRouteRecord.bind(null, routeMatched));
|
|
if (index > -1) return index;
|
|
const parentRecordPath = getOriginalPath(matched[length - 2]);
|
|
return length > 1 && getOriginalPath(routeMatched) === parentRecordPath && currentMatched[currentMatched.length - 1].path !== parentRecordPath ? currentMatched.findIndex(isSameRouteRecord.bind(null, matched[length - 2])) : index;
|
|
});
|
|
const isActive = (0, vue.computed)(() => activeRecordIndex.value > -1 && includesParams(currentRoute.params, route.value.params));
|
|
const isExactActive = (0, vue.computed)(() => activeRecordIndex.value > -1 && activeRecordIndex.value === currentRoute.matched.length - 1 && isSameRouteLocationParams(currentRoute.params, route.value.params));
|
|
function navigate(e = {}) {
|
|
if (guardEvent(e)) {
|
|
const p = router[(0, vue.unref)(props.replace) ? "replace" : "push"]((0, vue.unref)(props.to)).catch(noop);
|
|
if (props.viewTransition && typeof document !== "undefined" && "startViewTransition" in document) document.startViewTransition(() => p);
|
|
return p;
|
|
}
|
|
return Promise.resolve();
|
|
}
|
|
if ((process.env.NODE_ENV !== "production" || false) && isBrowser) {
|
|
const instance = (0, vue.getCurrentInstance)();
|
|
if (instance) {
|
|
const linkContextDevtools = {
|
|
route: route.value,
|
|
isActive: isActive.value,
|
|
isExactActive: isExactActive.value,
|
|
error: null
|
|
};
|
|
instance.__vrl_devtools = instance.__vrl_devtools || [];
|
|
instance.__vrl_devtools.push(linkContextDevtools);
|
|
(0, vue.watchEffect)(() => {
|
|
linkContextDevtools.route = route.value;
|
|
linkContextDevtools.isActive = isActive.value;
|
|
linkContextDevtools.isExactActive = isExactActive.value;
|
|
linkContextDevtools.error = isRouteLocation((0, vue.unref)(props.to)) ? null : "Invalid \"to\" value";
|
|
}, { flush: "post" });
|
|
}
|
|
}
|
|
/**
|
|
* NOTE: update {@link _RouterLinkI}'s `$slots` type when updating this
|
|
*/
|
|
return {
|
|
route,
|
|
href: (0, vue.computed)(() => route.value.href),
|
|
isActive,
|
|
isExactActive,
|
|
navigate
|
|
};
|
|
}
|
|
function preferSingleVNode(vnodes) {
|
|
return vnodes.length === 1 ? vnodes[0] : vnodes;
|
|
}
|
|
const RouterLinkImpl = /* @__PURE__ */ (0, vue.defineComponent)({
|
|
name: "RouterLink",
|
|
compatConfig: { MODE: 3 },
|
|
props: {
|
|
to: {
|
|
type: [String, Object],
|
|
required: true
|
|
},
|
|
replace: Boolean,
|
|
activeClass: String,
|
|
exactActiveClass: String,
|
|
custom: Boolean,
|
|
ariaCurrentValue: {
|
|
type: String,
|
|
default: "page"
|
|
},
|
|
viewTransition: Boolean
|
|
},
|
|
useLink,
|
|
setup(props, { slots }) {
|
|
const link = (0, vue.reactive)(useLink(props));
|
|
const { options } = (0, vue.inject)(routerKey);
|
|
const elClass = (0, vue.computed)(() => ({
|
|
[getLinkClass(props.activeClass, options.linkActiveClass, "router-link-active")]: link.isActive,
|
|
[getLinkClass(props.exactActiveClass, options.linkExactActiveClass, "router-link-exact-active")]: link.isExactActive
|
|
}));
|
|
return () => {
|
|
const children = slots.default && preferSingleVNode(slots.default(link));
|
|
return props.custom ? children : (0, vue.h)("a", {
|
|
"aria-current": link.isExactActive ? props.ariaCurrentValue : null,
|
|
href: link.href,
|
|
onClick: link.navigate,
|
|
class: elClass.value
|
|
}, children);
|
|
};
|
|
}
|
|
});
|
|
/**
|
|
* Component to render a link that triggers a navigation on click.
|
|
*/
|
|
const RouterLink = RouterLinkImpl;
|
|
function guardEvent(e) {
|
|
if (e.metaKey || e.altKey || e.ctrlKey || e.shiftKey) return;
|
|
if (e.defaultPrevented) return;
|
|
if (e.button !== void 0 && e.button !== 0) return;
|
|
if (e.currentTarget && e.currentTarget.getAttribute) {
|
|
const target = e.currentTarget.getAttribute("target");
|
|
if (/\b_blank\b/i.test(target)) return;
|
|
}
|
|
if (e.preventDefault) e.preventDefault();
|
|
return true;
|
|
}
|
|
function includesParams(outer, inner) {
|
|
for (const key in inner) {
|
|
const innerValue = inner[key];
|
|
const outerValue = outer[key];
|
|
if (typeof innerValue === "string") {
|
|
if (innerValue !== outerValue) return false;
|
|
} else if (!isArray(outerValue) || outerValue.length !== innerValue.length || innerValue.some((value, i) => value.valueOf() !== outerValue[i].valueOf())) return false;
|
|
}
|
|
return true;
|
|
}
|
|
/**
|
|
* Get the original path value of a record by following its aliasOf
|
|
* @param record
|
|
*/
|
|
function getOriginalPath(record) {
|
|
return record ? record.aliasOf ? record.aliasOf.path : record.path : "";
|
|
}
|
|
/**
|
|
* Utility class to get the active class based on defaults.
|
|
* @param propClass
|
|
* @param globalClass
|
|
* @param defaultClass
|
|
*/
|
|
const getLinkClass = (propClass, globalClass, defaultClass) => propClass != null ? propClass : globalClass != null ? globalClass : defaultClass;
|
|
|
|
//#endregion
|
|
//#region src/RouterView.ts
|
|
const RouterViewImpl = /* @__PURE__ */ (0, vue.defineComponent)({
|
|
name: "RouterView",
|
|
inheritAttrs: false,
|
|
props: {
|
|
name: {
|
|
type: String,
|
|
default: "default"
|
|
},
|
|
route: Object
|
|
},
|
|
compatConfig: { MODE: 3 },
|
|
setup(props, { attrs, slots }) {
|
|
process.env.NODE_ENV !== "production" && warnDeprecatedUsage();
|
|
const injectedRoute = (0, vue.inject)(routerViewLocationKey);
|
|
const routeToDisplay = (0, vue.computed)(() => props.route || injectedRoute.value);
|
|
const injectedDepth = (0, vue.inject)(viewDepthKey, 0);
|
|
const depth = (0, vue.computed)(() => {
|
|
let initialDepth = (0, vue.unref)(injectedDepth);
|
|
const { matched } = routeToDisplay.value;
|
|
let matchedRoute;
|
|
while ((matchedRoute = matched[initialDepth]) && !matchedRoute.components) initialDepth++;
|
|
return initialDepth;
|
|
});
|
|
const matchedRouteRef = (0, vue.computed)(() => routeToDisplay.value.matched[depth.value]);
|
|
(0, vue.provide)(viewDepthKey, (0, vue.computed)(() => depth.value + 1));
|
|
(0, vue.provide)(matchedRouteKey, matchedRouteRef);
|
|
(0, vue.provide)(routerViewLocationKey, routeToDisplay);
|
|
const viewRef = (0, vue.ref)();
|
|
(0, vue.watch)(() => [
|
|
viewRef.value,
|
|
matchedRouteRef.value,
|
|
props.name
|
|
], ([instance, to, name], [oldInstance, from, oldName]) => {
|
|
if (to) {
|
|
to.instances[name] = instance;
|
|
if (from && from !== to && instance && instance === oldInstance) {
|
|
if (!to.leaveGuards.size) to.leaveGuards = from.leaveGuards;
|
|
if (!to.updateGuards.size) to.updateGuards = from.updateGuards;
|
|
}
|
|
}
|
|
if (instance && to && (!from || !isSameRouteRecord(to, from) || !oldInstance)) (to.enterCallbacks[name] || []).forEach((callback) => callback(instance));
|
|
}, { flush: "post" });
|
|
return () => {
|
|
const route = routeToDisplay.value;
|
|
const currentName = props.name;
|
|
const matchedRoute = matchedRouteRef.value;
|
|
const ViewComponent = matchedRoute && matchedRoute.components[currentName];
|
|
if (!ViewComponent) return normalizeSlot(slots.default, {
|
|
Component: ViewComponent,
|
|
route
|
|
});
|
|
const routePropsOption = matchedRoute.props[currentName];
|
|
const routeProps = routePropsOption ? routePropsOption === true ? route.params : typeof routePropsOption === "function" ? routePropsOption(route) : routePropsOption : null;
|
|
const onVnodeUnmounted = (vnode) => {
|
|
if (vnode.component.isUnmounted) matchedRoute.instances[currentName] = null;
|
|
};
|
|
const component = (0, vue.h)(ViewComponent, assign({}, routeProps, attrs, {
|
|
onVnodeUnmounted,
|
|
ref: viewRef
|
|
}));
|
|
if ((process.env.NODE_ENV !== "production" || false) && isBrowser && component.ref) {
|
|
const info = {
|
|
depth: depth.value,
|
|
name: matchedRoute.name,
|
|
path: matchedRoute.path,
|
|
meta: matchedRoute.meta
|
|
};
|
|
(isArray(component.ref) ? component.ref.map((r) => r.i) : [component.ref.i]).forEach((instance) => {
|
|
instance.__vrv_devtools = info;
|
|
});
|
|
}
|
|
return normalizeSlot(slots.default, {
|
|
Component: component,
|
|
route
|
|
}) || component;
|
|
};
|
|
}
|
|
});
|
|
function normalizeSlot(slot, data) {
|
|
if (!slot) return null;
|
|
const slotContent = slot(data);
|
|
return slotContent.length === 1 ? slotContent[0] : slotContent;
|
|
}
|
|
/**
|
|
* Component to display the current route the user is at.
|
|
*/
|
|
const RouterView = RouterViewImpl;
|
|
function warnDeprecatedUsage() {
|
|
const instance = (0, vue.getCurrentInstance)();
|
|
const parentName = instance.parent && instance.parent.type.name;
|
|
const parentSubTreeType = instance.parent && instance.parent.subTree && instance.parent.subTree.type;
|
|
if (parentName && (parentName === "KeepAlive" || parentName.includes("Transition")) && typeof parentSubTreeType === "object" && parentSubTreeType.name === "RouterView") {
|
|
const comp = parentName === "KeepAlive" ? "keep-alive" : "transition";
|
|
warn(`<router-view> can no longer be used directly inside <transition> or <keep-alive>.
|
|
Use slot props instead:
|
|
|
|
<router-view v-slot="{ Component }">
|
|
<${comp}>\n <component :is="Component" />\n </${comp}>\n</router-view>`);
|
|
}
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/devtools.ts
|
|
/**
|
|
* Copies a route location and removes any problematic properties that cannot be shown in devtools (e.g. Vue instances).
|
|
*
|
|
* @param routeLocation - routeLocation to format
|
|
* @param tooltip - optional tooltip
|
|
* @returns a copy of the routeLocation
|
|
*/
|
|
function formatRouteLocation(routeLocation, tooltip) {
|
|
const copy = assign({}, routeLocation, { matched: routeLocation.matched.map((matched) => omit(matched, [
|
|
"instances",
|
|
"children",
|
|
"aliasOf"
|
|
])) });
|
|
return { _custom: {
|
|
type: null,
|
|
readOnly: true,
|
|
display: routeLocation.fullPath,
|
|
tooltip,
|
|
value: copy
|
|
} };
|
|
}
|
|
function formatDisplay(display) {
|
|
return { _custom: { display } };
|
|
}
|
|
let routerId = 0;
|
|
function addDevtools(app, router, matcher) {
|
|
if (router.__hasDevtools) return;
|
|
router.__hasDevtools = true;
|
|
const id = routerId++;
|
|
(0, _vue_devtools_api.setupDevtoolsPlugin)({
|
|
id: "org.vuejs.router" + (id ? "." + id : ""),
|
|
label: "Vue Router",
|
|
packageName: "vue-router",
|
|
homepage: "https://router.vuejs.org",
|
|
logo: "https://router.vuejs.org/logo.png",
|
|
componentStateTypes: ["Routing"],
|
|
app
|
|
}, (api) => {
|
|
api.on.inspectComponent((payload) => {
|
|
if (payload.instanceData) payload.instanceData.state.push({
|
|
type: "Routing",
|
|
key: "$route",
|
|
editable: false,
|
|
value: formatRouteLocation(router.currentRoute.value, "Current Route")
|
|
});
|
|
});
|
|
api.on.visitComponentTree(({ treeNode: node, componentInstance }) => {
|
|
if (componentInstance.__vrv_devtools) {
|
|
const info = componentInstance.__vrv_devtools;
|
|
node.tags.push({
|
|
label: (info.name ? `${info.name.toString()}: ` : "") + info.path,
|
|
textColor: 0,
|
|
tooltip: "This component is rendered by <router-view>",
|
|
backgroundColor: PINK_500
|
|
});
|
|
}
|
|
if (isArray(componentInstance.__vrl_devtools)) {
|
|
componentInstance.__devtoolsApi = api;
|
|
componentInstance.__vrl_devtools.forEach((devtoolsData) => {
|
|
let label = devtoolsData.route.path;
|
|
let backgroundColor = ORANGE_400;
|
|
let tooltip = "";
|
|
let textColor = 0;
|
|
if (devtoolsData.error) {
|
|
label = devtoolsData.error;
|
|
backgroundColor = RED_100;
|
|
textColor = RED_700;
|
|
} else if (devtoolsData.isExactActive) {
|
|
backgroundColor = LIME_500;
|
|
tooltip = "This is exactly active";
|
|
} else if (devtoolsData.isActive) {
|
|
backgroundColor = BLUE_600;
|
|
tooltip = "This link is active";
|
|
}
|
|
node.tags.push({
|
|
label,
|
|
textColor,
|
|
tooltip,
|
|
backgroundColor
|
|
});
|
|
});
|
|
}
|
|
});
|
|
(0, vue.watch)(router.currentRoute, () => {
|
|
refreshRoutesView();
|
|
api.notifyComponentUpdate();
|
|
api.sendInspectorTree(routerInspectorId);
|
|
api.sendInspectorState(routerInspectorId);
|
|
});
|
|
const navigationsLayerId = "router:navigations:" + id;
|
|
api.addTimelineLayer({
|
|
id: navigationsLayerId,
|
|
label: `Router${id ? " " + id : ""} Navigations`,
|
|
color: 4237508
|
|
});
|
|
router.onError((error, to) => {
|
|
api.addTimelineEvent({
|
|
layerId: navigationsLayerId,
|
|
event: {
|
|
title: "Error during Navigation",
|
|
subtitle: to.fullPath,
|
|
logType: "error",
|
|
time: api.now(),
|
|
data: { error },
|
|
groupId: to.meta.__navigationId
|
|
}
|
|
});
|
|
});
|
|
let navigationId = 0;
|
|
router.beforeEach((to, from) => {
|
|
const data = {
|
|
guard: formatDisplay("beforeEach"),
|
|
from: formatRouteLocation(from, "Current Location during this navigation"),
|
|
to: formatRouteLocation(to, "Target location")
|
|
};
|
|
Object.defineProperty(to.meta, "__navigationId", { value: navigationId++ });
|
|
api.addTimelineEvent({
|
|
layerId: navigationsLayerId,
|
|
event: {
|
|
time: api.now(),
|
|
title: "Start of navigation",
|
|
subtitle: to.fullPath,
|
|
data,
|
|
groupId: to.meta.__navigationId
|
|
}
|
|
});
|
|
});
|
|
router.afterEach((to, from, failure) => {
|
|
const data = { guard: formatDisplay("afterEach") };
|
|
if (failure) {
|
|
data.failure = { _custom: {
|
|
type: Error,
|
|
readOnly: true,
|
|
display: failure ? failure.message : "",
|
|
tooltip: "Navigation Failure",
|
|
value: failure
|
|
} };
|
|
data.status = formatDisplay("❌");
|
|
} else data.status = formatDisplay("✅");
|
|
data.from = formatRouteLocation(from, "Current Location during this navigation");
|
|
data.to = formatRouteLocation(to, "Target location");
|
|
api.addTimelineEvent({
|
|
layerId: navigationsLayerId,
|
|
event: {
|
|
title: "End of navigation",
|
|
subtitle: to.fullPath,
|
|
time: api.now(),
|
|
data,
|
|
logType: failure ? "warning" : "default",
|
|
groupId: to.meta.__navigationId
|
|
}
|
|
});
|
|
});
|
|
/**
|
|
* Inspector of Existing routes
|
|
*/
|
|
const routerInspectorId = "router-inspector:" + id;
|
|
api.addInspector({
|
|
id: routerInspectorId,
|
|
label: "Routes" + (id ? " " + id : ""),
|
|
icon: "book",
|
|
treeFilterPlaceholder: "Search routes"
|
|
});
|
|
function refreshRoutesView() {
|
|
if (!activeRoutesPayload) return;
|
|
const payload = activeRoutesPayload;
|
|
let routes = matcher.getRoutes().filter((route) => !route.parent || !route.parent.record.components);
|
|
routes.forEach(resetMatchStateOnRouteRecord);
|
|
if (payload.filter) routes = routes.filter((route) => isRouteMatching(route, payload.filter.toLowerCase()));
|
|
routes.forEach((route) => markRouteRecordActive(route, router.currentRoute.value));
|
|
payload.rootNodes = routes.map(formatRouteRecordForInspector);
|
|
}
|
|
let activeRoutesPayload;
|
|
api.on.getInspectorTree((payload) => {
|
|
activeRoutesPayload = payload;
|
|
if (payload.app === app && payload.inspectorId === routerInspectorId) refreshRoutesView();
|
|
});
|
|
/**
|
|
* Display information about the currently selected route record
|
|
*/
|
|
api.on.getInspectorState((payload) => {
|
|
if (payload.app === app && payload.inspectorId === routerInspectorId) {
|
|
const route = matcher.getRoutes().find((route) => route.record.__vd_id === payload.nodeId);
|
|
if (route) payload.state = { options: formatRouteRecordMatcherForStateInspector(route) };
|
|
}
|
|
});
|
|
api.sendInspectorTree(routerInspectorId);
|
|
api.sendInspectorState(routerInspectorId);
|
|
});
|
|
}
|
|
function modifierForKey(key) {
|
|
if (key.optional) return key.repeatable ? "*" : "?";
|
|
else return key.repeatable ? "+" : "";
|
|
}
|
|
function formatRouteRecordMatcherForStateInspector(route) {
|
|
const { record } = route;
|
|
const fields = [{
|
|
editable: false,
|
|
key: "path",
|
|
value: record.path
|
|
}];
|
|
if (record.name != null) fields.push({
|
|
editable: false,
|
|
key: "name",
|
|
value: record.name
|
|
});
|
|
fields.push({
|
|
editable: false,
|
|
key: "regexp",
|
|
value: route.re
|
|
});
|
|
if (route.keys.length) fields.push({
|
|
editable: false,
|
|
key: "keys",
|
|
value: { _custom: {
|
|
type: null,
|
|
readOnly: true,
|
|
display: route.keys.map((key) => `${key.name}${modifierForKey(key)}`).join(" "),
|
|
tooltip: "Param keys",
|
|
value: route.keys
|
|
} }
|
|
});
|
|
if (record.redirect != null) fields.push({
|
|
editable: false,
|
|
key: "redirect",
|
|
value: record.redirect
|
|
});
|
|
if (route.alias.length) fields.push({
|
|
editable: false,
|
|
key: "aliases",
|
|
value: route.alias.map((alias) => alias.record.path)
|
|
});
|
|
if (Object.keys(route.record.meta).length) fields.push({
|
|
editable: false,
|
|
key: "meta",
|
|
value: route.record.meta
|
|
});
|
|
fields.push({
|
|
key: "score",
|
|
editable: false,
|
|
value: { _custom: {
|
|
type: null,
|
|
readOnly: true,
|
|
display: route.score.map((score) => score.join(", ")).join(" | "),
|
|
tooltip: "Score used to sort routes",
|
|
value: route.score
|
|
} }
|
|
});
|
|
return fields;
|
|
}
|
|
/**
|
|
* Extracted from tailwind palette
|
|
*/
|
|
const PINK_500 = 15485081;
|
|
const BLUE_600 = 2450411;
|
|
const LIME_500 = 8702998;
|
|
const CYAN_400 = 2282478;
|
|
const ORANGE_400 = 16486972;
|
|
const DARK = 6710886;
|
|
const RED_100 = 16704226;
|
|
const RED_700 = 12131356;
|
|
function formatRouteRecordForInspector(route) {
|
|
const tags = [];
|
|
const { record } = route;
|
|
if (record.name != null) tags.push({
|
|
label: String(record.name),
|
|
textColor: 0,
|
|
backgroundColor: CYAN_400
|
|
});
|
|
if (record.aliasOf) tags.push({
|
|
label: "alias",
|
|
textColor: 0,
|
|
backgroundColor: ORANGE_400
|
|
});
|
|
if (route.__vd_match) tags.push({
|
|
label: "matches",
|
|
textColor: 0,
|
|
backgroundColor: PINK_500
|
|
});
|
|
if (route.__vd_exactActive) tags.push({
|
|
label: "exact",
|
|
textColor: 0,
|
|
backgroundColor: LIME_500
|
|
});
|
|
if (route.__vd_active) tags.push({
|
|
label: "active",
|
|
textColor: 0,
|
|
backgroundColor: BLUE_600
|
|
});
|
|
if (record.redirect) tags.push({
|
|
label: typeof record.redirect === "string" ? `redirect: ${record.redirect}` : "redirects",
|
|
textColor: 16777215,
|
|
backgroundColor: DARK
|
|
});
|
|
let id = record.__vd_id;
|
|
if (id == null) {
|
|
id = String(routeRecordId++);
|
|
record.__vd_id = id;
|
|
}
|
|
return {
|
|
id,
|
|
label: record.path,
|
|
tags,
|
|
children: route.children.map(formatRouteRecordForInspector)
|
|
};
|
|
}
|
|
let routeRecordId = 0;
|
|
const EXTRACT_REGEXP_RE = /^\/(.*)\/([a-z]*)$/;
|
|
function markRouteRecordActive(route, currentRoute) {
|
|
const isExactActive = currentRoute.matched.length && isSameRouteRecord(currentRoute.matched[currentRoute.matched.length - 1], route.record);
|
|
route.__vd_exactActive = route.__vd_active = isExactActive;
|
|
if (!isExactActive) route.__vd_active = currentRoute.matched.some((match) => isSameRouteRecord(match, route.record));
|
|
route.children.forEach((childRoute) => markRouteRecordActive(childRoute, currentRoute));
|
|
}
|
|
function resetMatchStateOnRouteRecord(route) {
|
|
route.__vd_match = false;
|
|
route.children.forEach(resetMatchStateOnRouteRecord);
|
|
}
|
|
function isRouteMatching(route, filter) {
|
|
const found = String(route.re).match(EXTRACT_REGEXP_RE);
|
|
route.__vd_match = false;
|
|
if (!found || found.length < 3) return false;
|
|
if (new RegExp(found[1].replace(/\$$/, ""), found[2]).test(filter)) {
|
|
route.children.forEach((child) => isRouteMatching(child, filter));
|
|
if (route.record.path !== "/" || filter === "/") {
|
|
route.__vd_match = route.re.test(filter);
|
|
return true;
|
|
}
|
|
return false;
|
|
}
|
|
const path = route.record.path.toLowerCase();
|
|
const decodedPath = decode(path);
|
|
if (!filter.startsWith("/") && (decodedPath.includes(filter) || path.includes(filter))) return true;
|
|
if (decodedPath.startsWith(filter) || path.startsWith(filter)) return true;
|
|
if (route.record.name && String(route.record.name).includes(filter)) return true;
|
|
return route.children.some((child) => isRouteMatching(child, filter));
|
|
}
|
|
function omit(obj, keys) {
|
|
const ret = {};
|
|
for (const key in obj) if (!keys.includes(key)) ret[key] = obj[key];
|
|
return ret;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/router.ts
|
|
/**
|
|
* Creates a Router instance that can be used by a Vue app.
|
|
*
|
|
* @param options - {@link RouterOptions}
|
|
*/
|
|
function createRouter(options) {
|
|
const matcher = createRouterMatcher(options.routes, options);
|
|
const parseQuery$1 = options.parseQuery || parseQuery;
|
|
const stringifyQuery$1 = options.stringifyQuery || stringifyQuery;
|
|
const routerHistory = options.history;
|
|
if (process.env.NODE_ENV !== "production" && !routerHistory) throw new Error("Provide the \"history\" option when calling \"createRouter()\": https://router.vuejs.org/api/interfaces/RouterOptions.html#history");
|
|
const beforeGuards = useCallbacks();
|
|
const beforeResolveGuards = useCallbacks();
|
|
const afterGuards = useCallbacks();
|
|
const currentRoute = (0, vue.shallowRef)(START_LOCATION_NORMALIZED);
|
|
let pendingLocation = START_LOCATION_NORMALIZED;
|
|
if (isBrowser && options.scrollBehavior && "scrollRestoration" in history) history.scrollRestoration = "manual";
|
|
const normalizeParams = applyToParams.bind(null, (paramValue) => "" + paramValue);
|
|
const encodeParams = applyToParams.bind(null, encodeParam);
|
|
const decodeParams = applyToParams.bind(null, decode);
|
|
function addRoute(parentOrRoute, route) {
|
|
let parent;
|
|
let record;
|
|
if (isRouteName(parentOrRoute)) {
|
|
parent = matcher.getRecordMatcher(parentOrRoute);
|
|
if (process.env.NODE_ENV !== "production" && !parent) warn(`Parent route "${String(parentOrRoute)}" not found when adding child route`, route);
|
|
record = route;
|
|
} else record = parentOrRoute;
|
|
return matcher.addRoute(record, parent);
|
|
}
|
|
function removeRoute(name) {
|
|
const recordMatcher = matcher.getRecordMatcher(name);
|
|
if (recordMatcher) matcher.removeRoute(recordMatcher);
|
|
else if (process.env.NODE_ENV !== "production") warn(`Cannot remove non-existent route "${String(name)}"`);
|
|
}
|
|
function getRoutes() {
|
|
return matcher.getRoutes().map((routeMatcher) => routeMatcher.record);
|
|
}
|
|
function hasRoute(name) {
|
|
return !!matcher.getRecordMatcher(name);
|
|
}
|
|
function resolve(rawLocation, currentLocation) {
|
|
currentLocation = assign({}, currentLocation || currentRoute.value);
|
|
if (typeof rawLocation === "string") {
|
|
const locationNormalized = parseURL(parseQuery$1, rawLocation, currentLocation.path);
|
|
const matchedRoute = matcher.resolve({ path: locationNormalized.path }, currentLocation);
|
|
const href = routerHistory.createHref(locationNormalized.fullPath);
|
|
if (process.env.NODE_ENV !== "production") {
|
|
if (href.startsWith("//")) warn(`Location "${rawLocation}" resolved to "${href}". A resolved location cannot start with multiple slashes.`);
|
|
else if (!matchedRoute.matched.length) warn(`No match found for location with path "${rawLocation}"`);
|
|
}
|
|
return assign(locationNormalized, matchedRoute, {
|
|
params: decodeParams(matchedRoute.params),
|
|
hash: decode(locationNormalized.hash),
|
|
redirectedFrom: void 0,
|
|
href
|
|
});
|
|
}
|
|
if (process.env.NODE_ENV !== "production" && !isRouteLocation(rawLocation)) {
|
|
warn(`router.resolve() was passed an invalid location. This will fail in production.\n- Location:`, rawLocation);
|
|
return resolve({});
|
|
}
|
|
let matcherLocation;
|
|
if (rawLocation.path != null) {
|
|
if (process.env.NODE_ENV !== "production" && "params" in rawLocation && !("name" in rawLocation) && Object.keys(rawLocation.params).length) warn(`Path "${rawLocation.path}" was passed with params but they will be ignored. Use a named route alongside params instead.`);
|
|
matcherLocation = assign({}, rawLocation, { path: parseURL(parseQuery$1, rawLocation.path, currentLocation.path).path });
|
|
} else {
|
|
const targetParams = assign({}, rawLocation.params);
|
|
for (const key in targetParams) if (targetParams[key] == null) delete targetParams[key];
|
|
matcherLocation = assign({}, rawLocation, { params: encodeParams(targetParams) });
|
|
currentLocation.params = encodeParams(currentLocation.params);
|
|
}
|
|
const matchedRoute = matcher.resolve(matcherLocation, currentLocation);
|
|
const hash = rawLocation.hash || "";
|
|
if (process.env.NODE_ENV !== "production" && hash && !hash.startsWith("#")) warn(`A \`hash\` should always start with the character "#". Replace "${hash}" with "#${hash}".`);
|
|
matchedRoute.params = normalizeParams(decodeParams(matchedRoute.params));
|
|
const fullPath = stringifyURL(stringifyQuery$1, assign({}, rawLocation, {
|
|
hash: encodeHash(hash),
|
|
path: matchedRoute.path
|
|
}));
|
|
const href = routerHistory.createHref(fullPath);
|
|
if (process.env.NODE_ENV !== "production") {
|
|
if (href.startsWith("//")) warn(`Location "${rawLocation}" resolved to "${href}". A resolved location cannot start with multiple slashes.`);
|
|
else if (!matchedRoute.matched.length) warn(`No match found for location with path "${rawLocation.path != null ? rawLocation.path : rawLocation}"`);
|
|
}
|
|
return assign({
|
|
fullPath,
|
|
hash,
|
|
query: stringifyQuery$1 === stringifyQuery ? normalizeQuery(rawLocation.query) : rawLocation.query || {}
|
|
}, matchedRoute, {
|
|
redirectedFrom: void 0,
|
|
href
|
|
});
|
|
}
|
|
function locationAsObject(to) {
|
|
return typeof to === "string" ? parseURL(parseQuery$1, to, currentRoute.value.path) : assign({}, to);
|
|
}
|
|
function checkCanceledNavigation(to, from) {
|
|
if (pendingLocation !== to) return createRouterError(ErrorTypes.NAVIGATION_CANCELLED, {
|
|
from,
|
|
to
|
|
});
|
|
}
|
|
function push(to) {
|
|
return pushWithRedirect(to);
|
|
}
|
|
function replace(to) {
|
|
return push(assign(locationAsObject(to), { replace: true }));
|
|
}
|
|
function handleRedirectRecord(to, from) {
|
|
const lastMatched = to.matched[to.matched.length - 1];
|
|
if (lastMatched && lastMatched.redirect) {
|
|
const { redirect } = lastMatched;
|
|
let newTargetLocation = typeof redirect === "function" ? redirect(to, from) : redirect;
|
|
if (typeof newTargetLocation === "string") {
|
|
newTargetLocation = newTargetLocation.includes("?") || newTargetLocation.includes("#") ? newTargetLocation = locationAsObject(newTargetLocation) : { path: newTargetLocation };
|
|
newTargetLocation.params = {};
|
|
}
|
|
if (process.env.NODE_ENV !== "production" && newTargetLocation.path == null && !("name" in newTargetLocation)) {
|
|
warn(`Invalid redirect found:\n${JSON.stringify(newTargetLocation, null, 2)}\n when navigating to "${to.fullPath}". A redirect must contain a name or path. This will break in production.`);
|
|
throw new Error("Invalid redirect");
|
|
}
|
|
return assign({
|
|
query: to.query,
|
|
hash: to.hash,
|
|
params: newTargetLocation.path != null ? {} : to.params
|
|
}, newTargetLocation);
|
|
}
|
|
}
|
|
function pushWithRedirect(to, redirectedFrom) {
|
|
const targetLocation = pendingLocation = resolve(to);
|
|
const from = currentRoute.value;
|
|
const data = to.state;
|
|
const force = to.force;
|
|
const replace = to.replace === true;
|
|
const shouldRedirect = handleRedirectRecord(targetLocation, from);
|
|
if (shouldRedirect) return pushWithRedirect(assign(locationAsObject(shouldRedirect), {
|
|
state: typeof shouldRedirect === "object" ? assign({}, data, shouldRedirect.state) : data,
|
|
force,
|
|
replace
|
|
}), redirectedFrom || targetLocation);
|
|
const toLocation = targetLocation;
|
|
toLocation.redirectedFrom = redirectedFrom;
|
|
let failure;
|
|
if (!force && isSameRouteLocation(stringifyQuery$1, from, targetLocation)) {
|
|
failure = createRouterError(ErrorTypes.NAVIGATION_DUPLICATED, {
|
|
to: toLocation,
|
|
from
|
|
});
|
|
handleScroll(from, from, true, false);
|
|
}
|
|
return (failure ? Promise.resolve(failure) : navigate(toLocation, from)).catch((error) => isNavigationFailure(error) ? isNavigationFailure(error, ErrorTypes.NAVIGATION_GUARD_REDIRECT) ? error : markAsReady(error) : triggerError(error, toLocation, from)).then((failure) => {
|
|
if (failure) {
|
|
if (isNavigationFailure(failure, ErrorTypes.NAVIGATION_GUARD_REDIRECT)) {
|
|
if (process.env.NODE_ENV !== "production" && isSameRouteLocation(stringifyQuery$1, resolve(failure.to), toLocation) && redirectedFrom && (redirectedFrom._count = redirectedFrom._count ? redirectedFrom._count + 1 : 1) > 30) {
|
|
warn(`Detected a possibly infinite redirection in a navigation guard when going from "${from.fullPath}" to "${toLocation.fullPath}". Aborting to avoid a Stack Overflow.\n Are you always returning a new location within a navigation guard? That would lead to this error. Only return when redirecting or aborting, that should fix this. This might break in production if not fixed.`);
|
|
return Promise.reject(/* @__PURE__ */ new Error("Infinite redirect in navigation guard"));
|
|
}
|
|
return pushWithRedirect(assign({ replace }, locationAsObject(failure.to), {
|
|
state: typeof failure.to === "object" ? assign({}, data, failure.to.state) : data,
|
|
force
|
|
}), redirectedFrom || toLocation);
|
|
}
|
|
} else failure = finalizeNavigation(toLocation, from, true, replace, data);
|
|
triggerAfterEach(toLocation, from, failure);
|
|
return failure;
|
|
});
|
|
}
|
|
/**
|
|
* Helper to reject and skip all navigation guards if a new navigation happened
|
|
* @param to
|
|
* @param from
|
|
*/
|
|
function checkCanceledNavigationAndReject(to, from) {
|
|
const error = checkCanceledNavigation(to, from);
|
|
return error ? Promise.reject(error) : Promise.resolve();
|
|
}
|
|
function runWithContext(fn) {
|
|
const app = installedApps.values().next().value;
|
|
return app && typeof app.runWithContext === "function" ? app.runWithContext(fn) : fn();
|
|
}
|
|
function navigate(to, from) {
|
|
let guards;
|
|
const [leavingRecords, updatingRecords, enteringRecords] = extractChangingRecords(to, from);
|
|
guards = extractComponentsGuards(leavingRecords.reverse(), "beforeRouteLeave", to, from);
|
|
for (const record of leavingRecords) record.leaveGuards.forEach((guard) => {
|
|
guards.push(guardToPromiseFn(guard, to, from));
|
|
});
|
|
const canceledNavigationCheck = checkCanceledNavigationAndReject.bind(null, to, from);
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards).then(() => {
|
|
guards = [];
|
|
for (const guard of beforeGuards.list()) guards.push(guardToPromiseFn(guard, to, from));
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards);
|
|
}).then(() => {
|
|
guards = extractComponentsGuards(updatingRecords, "beforeRouteUpdate", to, from);
|
|
for (const record of updatingRecords) record.updateGuards.forEach((guard) => {
|
|
guards.push(guardToPromiseFn(guard, to, from));
|
|
});
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards);
|
|
}).then(() => {
|
|
guards = [];
|
|
for (const record of enteringRecords) if (record.beforeEnter) if (isArray(record.beforeEnter)) for (const beforeEnter of record.beforeEnter) guards.push(guardToPromiseFn(beforeEnter, to, from));
|
|
else guards.push(guardToPromiseFn(record.beforeEnter, to, from));
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards);
|
|
}).then(() => {
|
|
to.matched.forEach((record) => record.enterCallbacks = {});
|
|
guards = extractComponentsGuards(enteringRecords, "beforeRouteEnter", to, from, runWithContext);
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards);
|
|
}).then(() => {
|
|
guards = [];
|
|
for (const guard of beforeResolveGuards.list()) guards.push(guardToPromiseFn(guard, to, from));
|
|
guards.push(canceledNavigationCheck);
|
|
return runGuardQueue(guards);
|
|
}).catch((err) => isNavigationFailure(err, ErrorTypes.NAVIGATION_CANCELLED) ? err : Promise.reject(err));
|
|
}
|
|
function triggerAfterEach(to, from, failure) {
|
|
afterGuards.list().forEach((guard) => runWithContext(() => guard(to, from, failure)));
|
|
}
|
|
/**
|
|
* - Cleans up any navigation guards
|
|
* - Changes the url if necessary
|
|
* - Calls the scrollBehavior
|
|
*/
|
|
function finalizeNavigation(toLocation, from, isPush, replace, data) {
|
|
const error = checkCanceledNavigation(toLocation, from);
|
|
if (error) return error;
|
|
const isFirstNavigation = from === START_LOCATION_NORMALIZED;
|
|
const state = !isBrowser ? {} : history.state;
|
|
if (isPush) if (replace || isFirstNavigation) routerHistory.replace(toLocation.fullPath, assign({ scroll: isFirstNavigation && state && state.scroll }, data));
|
|
else routerHistory.push(toLocation.fullPath, data);
|
|
currentRoute.value = toLocation;
|
|
handleScroll(toLocation, from, isPush, isFirstNavigation);
|
|
markAsReady();
|
|
}
|
|
let removeHistoryListener;
|
|
function setupListeners() {
|
|
if (removeHistoryListener) return;
|
|
removeHistoryListener = routerHistory.listen((to, _from, info) => {
|
|
if (!router.listening) return;
|
|
const toLocation = resolve(to);
|
|
const shouldRedirect = handleRedirectRecord(toLocation, router.currentRoute.value);
|
|
if (shouldRedirect) {
|
|
pushWithRedirect(assign(shouldRedirect, {
|
|
replace: true,
|
|
force: true
|
|
}), toLocation).catch(noop);
|
|
return;
|
|
}
|
|
pendingLocation = toLocation;
|
|
const from = currentRoute.value;
|
|
if (isBrowser) saveScrollPosition(getScrollKey(from.fullPath, info.delta), computeScrollPosition());
|
|
navigate(toLocation, from).catch((error) => {
|
|
if (isNavigationFailure(error, ErrorTypes.NAVIGATION_ABORTED | ErrorTypes.NAVIGATION_CANCELLED)) return error;
|
|
if (isNavigationFailure(error, ErrorTypes.NAVIGATION_GUARD_REDIRECT)) {
|
|
pushWithRedirect(assign(locationAsObject(error.to), { force: true }), toLocation).then((failure) => {
|
|
if (isNavigationFailure(failure, ErrorTypes.NAVIGATION_ABORTED | ErrorTypes.NAVIGATION_DUPLICATED) && !info.delta && info.type === NavigationType.pop) routerHistory.go(-1, false);
|
|
}).catch(noop);
|
|
return Promise.reject();
|
|
}
|
|
if (info.delta) routerHistory.go(-info.delta, false);
|
|
return triggerError(error, toLocation, from);
|
|
}).then((failure) => {
|
|
failure = failure || finalizeNavigation(toLocation, from, false);
|
|
if (failure) {
|
|
if (info.delta && !isNavigationFailure(failure, ErrorTypes.NAVIGATION_CANCELLED)) routerHistory.go(-info.delta, false);
|
|
else if (info.type === NavigationType.pop && isNavigationFailure(failure, ErrorTypes.NAVIGATION_ABORTED | ErrorTypes.NAVIGATION_DUPLICATED)) routerHistory.go(-1, false);
|
|
}
|
|
triggerAfterEach(toLocation, from, failure);
|
|
}).catch(noop);
|
|
});
|
|
}
|
|
let readyHandlers = useCallbacks();
|
|
let errorListeners = useCallbacks();
|
|
let ready;
|
|
/**
|
|
* Trigger errorListeners added via onError and throws the error as well
|
|
*
|
|
* @param error - error to throw
|
|
* @param to - location we were navigating to when the error happened
|
|
* @param from - location we were navigating from when the error happened
|
|
* @returns the error as a rejected promise
|
|
*/
|
|
function triggerError(error, to, from) {
|
|
markAsReady(error);
|
|
const list = errorListeners.list();
|
|
if (list.length) list.forEach((handler) => handler(error, to, from));
|
|
else {
|
|
if (process.env.NODE_ENV !== "production") warn("uncaught error during route navigation:");
|
|
console.error(error);
|
|
}
|
|
return Promise.reject(error);
|
|
}
|
|
function isReady() {
|
|
if (ready && currentRoute.value !== START_LOCATION_NORMALIZED) return Promise.resolve();
|
|
return new Promise((resolve, reject) => {
|
|
readyHandlers.add([resolve, reject]);
|
|
});
|
|
}
|
|
function markAsReady(err) {
|
|
if (!ready) {
|
|
ready = !err;
|
|
setupListeners();
|
|
readyHandlers.list().forEach(([resolve, reject]) => err ? reject(err) : resolve());
|
|
readyHandlers.reset();
|
|
}
|
|
return err;
|
|
}
|
|
function handleScroll(to, from, isPush, isFirstNavigation) {
|
|
const { scrollBehavior } = options;
|
|
if (!isBrowser || !scrollBehavior) return Promise.resolve();
|
|
const scrollPosition = !isPush && getSavedScrollPosition(getScrollKey(to.fullPath, 0)) || (isFirstNavigation || !isPush) && history.state && history.state.scroll || null;
|
|
return (0, vue.nextTick)().then(() => scrollBehavior(to, from, scrollPosition)).then((position) => position && scrollToPosition(position)).catch((err) => triggerError(err, to, from));
|
|
}
|
|
const go = (delta) => routerHistory.go(delta);
|
|
let started;
|
|
const installedApps = /* @__PURE__ */ new Set();
|
|
const router = {
|
|
currentRoute,
|
|
listening: true,
|
|
addRoute,
|
|
removeRoute,
|
|
clearRoutes: matcher.clearRoutes,
|
|
hasRoute,
|
|
getRoutes,
|
|
resolve,
|
|
options,
|
|
push,
|
|
replace,
|
|
go,
|
|
back: () => go(-1),
|
|
forward: () => go(1),
|
|
beforeEach: beforeGuards.add,
|
|
beforeResolve: beforeResolveGuards.add,
|
|
afterEach: afterGuards.add,
|
|
onError: errorListeners.add,
|
|
isReady,
|
|
install(app) {
|
|
app.component("RouterLink", RouterLink);
|
|
app.component("RouterView", RouterView);
|
|
app.config.globalProperties.$router = router;
|
|
Object.defineProperty(app.config.globalProperties, "$route", {
|
|
enumerable: true,
|
|
get: () => (0, vue.unref)(currentRoute)
|
|
});
|
|
if (isBrowser && !started && currentRoute.value === START_LOCATION_NORMALIZED) {
|
|
started = true;
|
|
push(routerHistory.location).catch((err) => {
|
|
if (process.env.NODE_ENV !== "production") warn("Unexpected error when starting the router:", err);
|
|
});
|
|
}
|
|
const reactiveRoute = {};
|
|
for (const key in START_LOCATION_NORMALIZED) Object.defineProperty(reactiveRoute, key, {
|
|
get: () => currentRoute.value[key],
|
|
enumerable: true
|
|
});
|
|
app.provide(routerKey, router);
|
|
app.provide(routeLocationKey, (0, vue.shallowReactive)(reactiveRoute));
|
|
app.provide(routerViewLocationKey, currentRoute);
|
|
const unmountApp = app.unmount;
|
|
installedApps.add(app);
|
|
app.unmount = function() {
|
|
installedApps.delete(app);
|
|
if (installedApps.size < 1) {
|
|
pendingLocation = START_LOCATION_NORMALIZED;
|
|
removeHistoryListener && removeHistoryListener();
|
|
removeHistoryListener = null;
|
|
currentRoute.value = START_LOCATION_NORMALIZED;
|
|
started = false;
|
|
ready = false;
|
|
}
|
|
unmountApp();
|
|
};
|
|
if ((process.env.NODE_ENV !== "production" || false) && isBrowser && true) addDevtools(app, router, matcher);
|
|
}
|
|
};
|
|
function runGuardQueue(guards) {
|
|
return guards.reduce((promise, guard) => promise.then(() => runWithContext(guard)), Promise.resolve());
|
|
}
|
|
return router;
|
|
}
|
|
|
|
//#endregion
|
|
//#region src/useApi.ts
|
|
/**
|
|
* Returns the router instance. Equivalent to using `$router` inside
|
|
* templates.
|
|
*/
|
|
function useRouter() {
|
|
return (0, vue.inject)(routerKey);
|
|
}
|
|
/**
|
|
* Returns the current route location. Equivalent to using `$route` inside
|
|
* templates.
|
|
*/
|
|
function useRoute(_name) {
|
|
return (0, vue.inject)(routeLocationKey);
|
|
}
|
|
|
|
//#endregion
|
|
exports.NavigationFailureType = NavigationFailureType;
|
|
exports.RouterLink = RouterLink;
|
|
exports.RouterView = RouterView;
|
|
exports.START_LOCATION = START_LOCATION_NORMALIZED;
|
|
exports.createMemoryHistory = createMemoryHistory;
|
|
exports.createRouter = createRouter;
|
|
exports.createRouterMatcher = createRouterMatcher;
|
|
exports.createWebHashHistory = createWebHashHistory;
|
|
exports.createWebHistory = createWebHistory;
|
|
exports.isNavigationFailure = isNavigationFailure;
|
|
exports.loadRouteLocation = loadRouteLocation;
|
|
exports.matchedRouteKey = matchedRouteKey;
|
|
exports.onBeforeRouteLeave = onBeforeRouteLeave;
|
|
exports.onBeforeRouteUpdate = onBeforeRouteUpdate;
|
|
exports.parseQuery = parseQuery;
|
|
exports.routeLocationKey = routeLocationKey;
|
|
exports.routerKey = routerKey;
|
|
exports.routerViewLocationKey = routerViewLocationKey;
|
|
exports.stringifyQuery = stringifyQuery;
|
|
exports.useLink = useLink;
|
|
exports.useRoute = useRoute;
|
|
exports.useRouter = useRouter;
|
|
exports.viewDepthKey = viewDepthKey; |